From 4ba0d54794814ec0de1ec87987d0c3b89379b436 Mon Sep 17 00:00:00 2001 From: "djm@openbsd.org" Date: Tue, 3 Jul 2018 11:39:54 +0000 Subject: upstream: Improve strictness and control over RSA-SHA2 signature In ssh, when an agent fails to return a RSA-SHA2 signature when requested and falls back to RSA-SHA1 instead, retry the signature to ensure that the public key algorithm sent in the SSH_MSG_USERAUTH matches the one in the signature itself. In sshd, strictly enforce that the public key algorithm sent in the SSH_MSG_USERAUTH message matches what appears in the signature. Make the sshd_config PubkeyAcceptedKeyTypes and HostbasedAcceptedKeyTypes options control accepted signature algorithms (previously they selected supported key types). This allows these options to ban RSA-SHA1 in favour of RSA-SHA2. Add new signature algorithms "rsa-sha2-256-cert-v01@openssh.com" and "rsa-sha2-512-cert-v01@openssh.com" to force use of RSA-SHA2 signatures with certificate keys. feedback and ok markus@ OpenBSD-Commit-ID: c6e9f6d45eed8962ad502d315d7eaef32c419dde --- kex.h | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) (limited to 'kex.h') diff --git a/kex.h b/kex.h index 01bb3986a..6210630df 100644 --- a/kex.h +++ b/kex.h @@ -1,4 +1,4 @@ -/* $OpenBSD: kex.h,v 1.83 2017/05/30 14:23:52 markus Exp $ */ +/* $OpenBSD: kex.h,v 1.84 2018/07/03 11:39:54 djm Exp $ */ /* * Copyright (c) 2000, 2001 Markus Friedl. All rights reserved. @@ -139,7 +139,7 @@ struct kex { int hostkey_type; int hostkey_nid; u_int kex_type; - int rsa_sha2; + char *server_sig_algs; int ext_info_c; struct sshbuf *my; struct sshbuf *peer; -- cgit v1.2.3 From 312d2f2861a2598ed08587cb6c45c0e98a85408f Mon Sep 17 00:00:00 2001 From: "djm@openbsd.org" Date: Wed, 4 Jul 2018 13:49:31 +0000 Subject: upstream: repair PubkeyAcceptedKeyTypes (and friends) after RSA signature work - returns ability to add/remove/specify algorithms by wildcard. Algorithm lists are now fully expanded when the server/client configs are finalised, so errors are reported early and the config dumps (e.g. "ssh -G ...") now list the actual algorithms selected. Clarify that, while wildcards are accepted in algorithm lists, they aren't full pattern-lists that support negation. (lots of) feedback, ok markus@ OpenBSD-Commit-ID: a8894c5c81f399a002f02ff4fe6b4fa46b1f3207 --- compat.c | 18 +++++------ kex.c | 95 ++++++++++++++++++++++++++++++++++++++++++++++++----------- kex.h | 4 +-- match.c | 36 ++++++++++++++++++---- match.h | 5 ++-- readconf.c | 38 +++++++++++++++++------- servconf.c | 32 ++++++++++++++------ ssh_config.5 | 8 ++--- sshconnect2.c | 10 ++++--- sshd_config.5 | 8 ++--- 10 files changed, 187 insertions(+), 67 deletions(-) (limited to 'kex.h') diff --git a/compat.c b/compat.c index 8335f2a94..d8fd6eaf8 100644 --- a/compat.c +++ b/compat.c @@ -1,4 +1,4 @@ -/* $OpenBSD: compat.c,v 1.109 2018/07/03 11:42:12 djm Exp $ */ +/* $OpenBSD: compat.c,v 1.110 2018/07/04 13:49:31 djm Exp $ */ /* * Copyright (c) 1999, 2000, 2001, 2002 Markus Friedl. All rights reserved. * @@ -190,8 +190,8 @@ compat_cipher_proposal(char *cipher_prop) if (!(datafellows & SSH_BUG_BIGENDIANAES)) return cipher_prop; debug2("%s: original cipher proposal: %s", __func__, cipher_prop); - if ((cipher_prop = match_filter_list(cipher_prop, "aes*")) == NULL) - fatal("match_filter_list failed"); + if ((cipher_prop = match_filter_blacklist(cipher_prop, "aes*")) == NULL) + fatal("match_filter_blacklist failed"); debug2("%s: compat cipher proposal: %s", __func__, cipher_prop); if (*cipher_prop == '\0') fatal("No supported ciphers found"); @@ -204,8 +204,8 @@ compat_pkalg_proposal(char *pkalg_prop) if (!(datafellows & SSH_BUG_RSASIGMD5)) return pkalg_prop; debug2("%s: original public key proposal: %s", __func__, pkalg_prop); - if ((pkalg_prop = match_filter_list(pkalg_prop, "ssh-rsa")) == NULL) - fatal("match_filter_list failed"); + if ((pkalg_prop = match_filter_blacklist(pkalg_prop, "ssh-rsa")) == NULL) + fatal("match_filter_blacklist failed"); debug2("%s: compat public key proposal: %s", __func__, pkalg_prop); if (*pkalg_prop == '\0') fatal("No supported PK algorithms found"); @@ -219,14 +219,14 @@ compat_kex_proposal(char *p) return p; debug2("%s: original KEX proposal: %s", __func__, p); if ((datafellows & SSH_BUG_CURVE25519PAD) != 0) - if ((p = match_filter_list(p, + if ((p = match_filter_blacklist(p, "curve25519-sha256@libssh.org")) == NULL) - fatal("match_filter_list failed"); + fatal("match_filter_blacklist failed"); if ((datafellows & SSH_OLD_DHGEX) != 0) { - if ((p = match_filter_list(p, + if ((p = match_filter_blacklist(p, "diffie-hellman-group-exchange-sha256," "diffie-hellman-group-exchange-sha1")) == NULL) - fatal("match_filter_list failed"); + fatal("match_filter_blacklist failed"); } debug2("%s: compat KEX proposal: %s", __func__, p); if (*p == '\0') diff --git a/kex.c b/kex.c index d0a5f1b66..2fd052e96 100644 --- a/kex.c +++ b/kex.c @@ -1,4 +1,4 @@ -/* $OpenBSD: kex.c,v 1.137 2018/07/03 11:39:54 djm Exp $ */ +/* $OpenBSD: kex.c,v 1.138 2018/07/04 13:49:31 djm Exp $ */ /* * Copyright (c) 2000, 2001 Markus Friedl. All rights reserved. * @@ -174,7 +174,7 @@ kex_names_cat(const char *a, const char *b) size_t len; if (a == NULL || *a == '\0') - return NULL; + return strdup(b); if (b == NULL || *b == '\0') return strdup(a); if (strlen(b) > 1024*1024) @@ -209,27 +209,88 @@ kex_names_cat(const char *a, const char *b) * specified names should be removed. */ int -kex_assemble_names(const char *def, char **list) +kex_assemble_names(char **listp, const char *def, const char *all) { - char *ret; + char *cp, *tmp, *patterns; + char *list = NULL, *ret = NULL, *matching = NULL, *opatterns = NULL; + int r = SSH_ERR_INTERNAL_ERROR; - if (list == NULL || *list == NULL || **list == '\0') { - *list = strdup(def); + if (listp == NULL || *listp == NULL || **listp == '\0') { + if ((*listp = strdup(def)) == NULL) + return SSH_ERR_ALLOC_FAIL; return 0; } - if (**list == '+') { - if ((ret = kex_names_cat(def, *list + 1)) == NULL) - return SSH_ERR_ALLOC_FAIL; - free(*list); - *list = ret; - } else if (**list == '-') { - if ((ret = match_filter_list(def, *list + 1)) == NULL) - return SSH_ERR_ALLOC_FAIL; - free(*list); - *list = ret; + + list = *listp; + *listp = NULL; + if (*list == '+') { + /* Append names to default list */ + if ((tmp = kex_names_cat(def, list + 1)) == NULL) { + r = SSH_ERR_ALLOC_FAIL; + goto fail; + } + free(list); + list = tmp; + } else if (*list == '-') { + /* Remove names from default list */ + if ((*listp = match_filter_blacklist(def, list + 1)) == NULL) { + r = SSH_ERR_ALLOC_FAIL; + goto fail; + } + free(list); + /* filtering has already been done */ + return 0; + } else { + /* Explicit list, overrides default - just use "list" as is */ } - return 0; + /* + * The supplied names may be a pattern-list. For the -list case, + * the patterns are applied above. For the +list and explicit list + * cases we need to do it now. + */ + ret = NULL; + if ((patterns = opatterns = strdup(list)) == NULL) { + r = SSH_ERR_ALLOC_FAIL; + goto fail; + } + /* Apply positive (i.e. non-negated) patterns from the list */ + while ((cp = strsep(&patterns, ",")) != NULL) { + if (*cp == '!') { + /* negated matches are not supported here */ + r = SSH_ERR_INVALID_ARGUMENT; + goto fail; + } + free(matching); + if ((matching = match_filter_whitelist(all, cp)) == NULL) { + r = SSH_ERR_ALLOC_FAIL; + goto fail; + } + if ((tmp = kex_names_cat(ret, matching)) == NULL) { + r = SSH_ERR_ALLOC_FAIL; + goto fail; + } + free(ret); + ret = tmp; + } + if (ret == NULL || *ret == '\0') { + /* An empty name-list is an error */ + /* XXX better error code? */ + r = SSH_ERR_INVALID_ARGUMENT; + goto fail; + } + + /* success */ + *listp = ret; + ret = NULL; + r = 0; + + fail: + free(matching); + free(opatterns); + free(list); + free(ret); + return r; } /* put algorithm proposal into buffer */ diff --git a/kex.h b/kex.h index 6210630df..3ffae2df0 100644 --- a/kex.h +++ b/kex.h @@ -1,4 +1,4 @@ -/* $OpenBSD: kex.h,v 1.84 2018/07/03 11:39:54 djm Exp $ */ +/* $OpenBSD: kex.h,v 1.85 2018/07/04 13:49:31 djm Exp $ */ /* * Copyright (c) 2000, 2001 Markus Friedl. All rights reserved. @@ -169,7 +169,7 @@ struct kex { int kex_names_valid(const char *); char *kex_alg_list(char); char *kex_names_cat(const char *, const char *); -int kex_assemble_names(const char *, char **); +int kex_assemble_names(char **, const char *, const char *); int kex_new(struct ssh *, char *[PROPOSAL_MAX], struct kex **); int kex_setup(struct ssh *, char *[PROPOSAL_MAX]); diff --git a/match.c b/match.c index 3cf40306b..bb3e95f67 100644 --- a/match.c +++ b/match.c @@ -1,4 +1,4 @@ -/* $OpenBSD: match.c,v 1.37 2017/03/10 04:24:55 djm Exp $ */ +/* $OpenBSD: match.c,v 1.38 2018/07/04 13:49:31 djm Exp $ */ /* * Author: Tatu Ylonen * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland @@ -294,16 +294,20 @@ match_list(const char *client, const char *server, u_int *next) } /* - * Filters a comma-separated list of strings, excluding any entry matching - * the 'filter' pattern list. Caller must free returned string. + * Filter proposal using pattern-list filter. + * "blacklist" determines sense of filter: + * non-zero indicates that items matching filter should be excluded. + * zero indicates that only items matching filter should be included. + * returns NULL on allocation error, otherwise caller must free result. */ -char * -match_filter_list(const char *proposal, const char *filter) +static char * +filter_list(const char *proposal, const char *filter, int blacklist) { size_t len = strlen(proposal) + 1; char *fix_prop = malloc(len); char *orig_prop = strdup(proposal); char *cp, *tmp; + int r; if (fix_prop == NULL || orig_prop == NULL) { free(orig_prop); @@ -314,7 +318,8 @@ match_filter_list(const char *proposal, const char *filter) tmp = orig_prop; *fix_prop = '\0'; while ((cp = strsep(&tmp, ",")) != NULL) { - if (match_pattern_list(cp, filter, 0) != 1) { + r = match_pattern_list(cp, filter, 0); + if ((blacklist && r != 1) || (!blacklist && r == 1)) { if (*fix_prop != '\0') strlcat(fix_prop, ",", len); strlcat(fix_prop, cp, len); @@ -324,3 +329,22 @@ match_filter_list(const char *proposal, const char *filter) return fix_prop; } +/* + * Filters a comma-separated list of strings, excluding any entry matching + * the 'filter' pattern list. Caller must free returned string. + */ +char * +match_filter_blacklist(const char *proposal, const char *filter) +{ + return filter_list(proposal, filter, 1); +} + +/* + * Filters a comma-separated list of strings, including only entries matching + * the 'filter' pattern list. Caller must free returned string. + */ +char * +match_filter_whitelist(const char *proposal, const char *filter) +{ + return filter_list(proposal, filter, 0); +} diff --git a/match.h b/match.h index 937ba0412..852b1a5cb 100644 --- a/match.h +++ b/match.h @@ -1,4 +1,4 @@ -/* $OpenBSD: match.h,v 1.17 2017/02/03 23:01:19 djm Exp $ */ +/* $OpenBSD: match.h,v 1.18 2018/07/04 13:49:31 djm Exp $ */ /* * Author: Tatu Ylonen @@ -20,7 +20,8 @@ int match_hostname(const char *, const char *); int match_host_and_ip(const char *, const char *, const char *); int match_user(const char *, const char *, const char *, const char *); char *match_list(const char *, const char *, u_int *); -char *match_filter_list(const char *, const char *); +char *match_filter_blacklist(const char *, const char *); +char *match_filter_whitelist(const char *, const char *); /* addrmatch.c */ int addr_match_list(const char *, const char *); diff --git a/readconf.c b/readconf.c index 8d2029547..2bc27075f 100644 --- a/readconf.c +++ b/readconf.c @@ -1,4 +1,4 @@ -/* $OpenBSD: readconf.c,v 1.291 2018/06/10 23:45:41 djm Exp $ */ +/* $OpenBSD: readconf.c,v 1.292 2018/07/04 13:49:31 djm Exp $ */ /* * Author: Tatu Ylonen * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland @@ -1936,6 +1936,8 @@ fill_default_options_for_canonicalization(Options *options) void fill_default_options(Options * options) { + char *all_cipher, *all_mac, *all_kex, *all_key; + if (options->forward_agent == -1) options->forward_agent = 0; if (options->forward_x11 == -1) @@ -2082,14 +2084,27 @@ fill_default_options(Options * options) options->fingerprint_hash = SSH_FP_HASH_DEFAULT; if (options->update_hostkeys == -1) options->update_hostkeys = 0; - if (kex_assemble_names(KEX_CLIENT_ENCRYPT, &options->ciphers) != 0 || - kex_assemble_names(KEX_CLIENT_MAC, &options->macs) != 0 || - kex_assemble_names(KEX_CLIENT_KEX, &options->kex_algorithms) != 0 || - kex_assemble_names(KEX_DEFAULT_PK_ALG, - &options->hostbased_key_types) != 0 || - kex_assemble_names(KEX_DEFAULT_PK_ALG, - &options->pubkey_key_types) != 0) + + /* Expand KEX name lists */ + all_cipher = cipher_alg_list(',', 0); + all_mac = mac_alg_list(','); + all_kex = kex_alg_list(','); + all_key = sshkey_alg_list(0, 0, 1, ','); + if (kex_assemble_names(&options->ciphers, + KEX_CLIENT_ENCRYPT, all_cipher) != 0 || + kex_assemble_names(&options->macs, + KEX_CLIENT_MAC, all_mac) != 0 || + kex_assemble_names(&options->kex_algorithms, + KEX_CLIENT_KEX, all_kex) != 0 || + kex_assemble_names(&options->hostbased_key_types, + KEX_DEFAULT_PK_ALG, all_key) != 0 || + kex_assemble_names(&options->pubkey_key_types, + KEX_DEFAULT_PK_ALG, all_key) != 0) fatal("%s: kex_assemble_names failed", __func__); + free(all_cipher); + free(all_mac); + free(all_kex); + free(all_key); #define CLEAR_ON_NONE(v) \ do { \ @@ -2537,11 +2552,14 @@ void dump_client_config(Options *o, const char *host) { int i; - char buf[8]; + char buf[8], *all_key; /* This is normally prepared in ssh_kex2 */ - if (kex_assemble_names(KEX_DEFAULT_PK_ALG, &o->hostkeyalgorithms) != 0) + all_key = sshkey_alg_list(0, 0, 1, ','); + if (kex_assemble_names( &o->hostkeyalgorithms, + KEX_DEFAULT_PK_ALG, all_key) != 0) fatal("%s: kex_assemble_names failed", __func__); + free(all_key); /* Most interesting options first: user, host, port */ dump_cfg_string(oUser, o->user); diff --git a/servconf.c b/servconf.c index a41fdc26a..a54219f01 100644 --- a/servconf.c +++ b/servconf.c @@ -1,5 +1,5 @@ -/* $OpenBSD: servconf.c,v 1.334 2018/07/03 10:59:35 djm Exp $ */ +/* $OpenBSD: servconf.c,v 1.335 2018/07/04 13:49:31 djm Exp $ */ /* * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland * All rights reserved @@ -190,15 +190,29 @@ option_clear_or_none(const char *o) static void assemble_algorithms(ServerOptions *o) { - if (kex_assemble_names(KEX_SERVER_ENCRYPT, &o->ciphers) != 0 || - kex_assemble_names(KEX_SERVER_MAC, &o->macs) != 0 || - kex_assemble_names(KEX_SERVER_KEX, &o->kex_algorithms) != 0 || - kex_assemble_names(KEX_DEFAULT_PK_ALG, - &o->hostkeyalgorithms) != 0 || - kex_assemble_names(KEX_DEFAULT_PK_ALG, - &o->hostbased_key_types) != 0 || - kex_assemble_names(KEX_DEFAULT_PK_ALG, &o->pubkey_key_types) != 0) + char *all_cipher, *all_mac, *all_kex, *all_key; + + all_cipher = cipher_alg_list(',', 0); + all_mac = mac_alg_list(','); + all_kex = kex_alg_list(','); + all_key = sshkey_alg_list(0, 0, 1, ','); + if (kex_assemble_names(&o->ciphers, + KEX_SERVER_ENCRYPT, all_cipher) != 0 || + kex_assemble_names(&o->macs, + KEX_SERVER_MAC, all_mac) != 0 || + kex_assemble_names(&o->kex_algorithms, + KEX_SERVER_KEX, all_kex) != 0 || + kex_assemble_names(&o->hostkeyalgorithms, + KEX_DEFAULT_PK_ALG, all_key) != 0 || + kex_assemble_names(&o->hostbased_key_types, + KEX_DEFAULT_PK_ALG, all_key) != 0 || + kex_assemble_names(&o->pubkey_key_types, + KEX_DEFAULT_PK_ALG, all_key) != 0) fatal("kex_assemble_names failed"); + free(all_cipher); + free(all_mac); + free(all_kex); + free(all_key); } static void diff --git a/ssh_config.5 b/ssh_config.5 index eff9c5e61..df94d60db 100644 --- a/ssh_config.5 +++ b/ssh_config.5 @@ -33,8 +33,8 @@ .\" (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF .\" THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. .\" -.\" $OpenBSD: ssh_config.5,v 1.278 2018/07/03 11:39:54 djm Exp $ -.Dd $Mdocdate: July 3 2018 $ +.\" $OpenBSD: ssh_config.5,v 1.279 2018/07/04 13:49:31 djm Exp $ +.Dd $Mdocdate: July 4 2018 $ .Dt SSH_CONFIG 5 .Os .Sh NAME @@ -757,7 +757,7 @@ or (the default). .It Cm HostbasedKeyTypes Specifies the key types that will be used for hostbased authentication -as a comma-separated pattern list. +as a comma-separated list of patterns. Alternately if the specified value begins with a .Sq + character, then the specified key types will be appended to the default set @@ -1242,7 +1242,7 @@ The default is .Cm no . .It Cm PubkeyAcceptedKeyTypes Specifies the key types that will be used for public key authentication -as a comma-separated pattern list. +as a comma-separated list of patterns. Alternately if the specified value begins with a .Sq + character, then the key types after it will be appended to the default diff --git a/sshconnect2.c b/sshconnect2.c index db95cb214..f3ccd53a9 100644 --- a/sshconnect2.c +++ b/sshconnect2.c @@ -1,4 +1,4 @@ -/* $OpenBSD: sshconnect2.c,v 1.274 2018/07/03 13:20:25 djm Exp $ */ +/* $OpenBSD: sshconnect2.c,v 1.275 2018/07/04 13:49:31 djm Exp $ */ /* * Copyright (c) 2000 Markus Friedl. All rights reserved. * Copyright (c) 2008 Damien Miller. All rights reserved. @@ -158,7 +158,7 @@ void ssh_kex2(char *host, struct sockaddr *hostaddr, u_short port) { char *myproposal[PROPOSAL_MAX] = { KEX_CLIENT }; - char *s; + char *s, *all_key; struct kex *kex; int r; @@ -178,9 +178,11 @@ ssh_kex2(char *host, struct sockaddr *hostaddr, u_short port) myproposal[PROPOSAL_MAC_ALGS_CTOS] = myproposal[PROPOSAL_MAC_ALGS_STOC] = options.macs; if (options.hostkeyalgorithms != NULL) { - if (kex_assemble_names(KEX_DEFAULT_PK_ALG, - &options.hostkeyalgorithms) != 0) + all_key = sshkey_alg_list(0, 0, 1, ','); + if (kex_assemble_names(&options.hostkeyalgorithms, + KEX_DEFAULT_PK_ALG, all_key) != 0) fatal("%s: kex_assemble_namelist", __func__); + free(all_key); myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS] = compat_pkalg_proposal(options.hostkeyalgorithms); } else { diff --git a/sshd_config.5 b/sshd_config.5 index cc019ec7d..aa888796e 100644 --- a/sshd_config.5 +++ b/sshd_config.5 @@ -33,8 +33,8 @@ .\" (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF .\" THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. .\" -.\" $OpenBSD: sshd_config.5,v 1.279 2018/07/03 11:39:54 djm Exp $ -.Dd $Mdocdate: July 3 2018 $ +.\" $OpenBSD: sshd_config.5,v 1.280 2018/07/04 13:49:31 djm Exp $ +.Dd $Mdocdate: July 4 2018 $ .Dt SSHD_CONFIG 5 .Os .Sh NAME @@ -659,7 +659,7 @@ The default is .Cm yes . .It Cm HostbasedAcceptedKeyTypes Specifies the key types that will be accepted for hostbased authentication -as a comma-separated pattern list. +as a list of comma-separated patterns. Alternately if the specified value begins with a .Sq + character, then the specified key types will be appended to the default set @@ -1386,7 +1386,7 @@ The default is .Cm yes . .It Cm PubkeyAcceptedKeyTypes Specifies the key types that will be accepted for public key authentication -as a comma-separated pattern list. +as a list of comma-separated patterns. Alternately if the specified value begins with a .Sq + character, then the specified key types will be appended to the default set -- cgit v1.2.3 From 95db395d2e56a6f868193aead6cadb2493f036c6 Mon Sep 17 00:00:00 2001 From: "sf@openbsd.org" Date: Fri, 6 Jul 2018 09:05:01 +0000 Subject: upstream: Remove leftovers from pre-authentication compression Support for this has been removed in 2016. COMP_DELAYED will be renamed in a later commit. ok markus@ OpenBSD-Commit-ID: 6a99616c832627157113fcb0cf5a752daf2e6b58 --- kex.c | 4 +--- kex.h | 5 ++--- monitor_wrap.c | 4 +--- packet.c | 7 +++---- sshconnect2.c | 4 ++-- 5 files changed, 9 insertions(+), 15 deletions(-) (limited to 'kex.h') diff --git a/kex.c b/kex.c index 2fd052e96..0c444e186 100644 --- a/kex.c +++ b/kex.c @@ -1,4 +1,4 @@ -/* $OpenBSD: kex.c,v 1.138 2018/07/04 13:49:31 djm Exp $ */ +/* $OpenBSD: kex.c,v 1.139 2018/07/06 09:05:01 sf Exp $ */ /* * Copyright (c) 2000, 2001 Markus Friedl. All rights reserved. * @@ -742,8 +742,6 @@ choose_comp(struct sshcomp *comp, char *client, char *server) return SSH_ERR_NO_COMPRESS_ALG_MATCH; if (strcmp(name, "zlib@openssh.com") == 0) { comp->type = COMP_DELAYED; - } else if (strcmp(name, "zlib") == 0) { - comp->type = COMP_ZLIB; } else if (strcmp(name, "none") == 0) { comp->type = COMP_NONE; } else { diff --git a/kex.h b/kex.h index 3ffae2df0..676c32abd 100644 --- a/kex.h +++ b/kex.h @@ -1,4 +1,4 @@ -/* $OpenBSD: kex.h,v 1.85 2018/07/04 13:49:31 djm Exp $ */ +/* $OpenBSD: kex.h,v 1.86 2018/07/06 09:05:01 sf Exp $ */ /* * Copyright (c) 2000, 2001 Markus Friedl. All rights reserved. @@ -64,8 +64,7 @@ #define KEX_CURVE25519_SHA256_OLD "curve25519-sha256@libssh.org" #define COMP_NONE 0 -#define COMP_ZLIB 1 -#define COMP_DELAYED 2 +#define COMP_DELAYED 1 #define CURVE25519_SIZE 32 diff --git a/monitor_wrap.c b/monitor_wrap.c index b1f489f79..e280fd2ad 100644 --- a/monitor_wrap.c +++ b/monitor_wrap.c @@ -1,4 +1,4 @@ -/* $OpenBSD: monitor_wrap.c,v 1.99 2018/03/03 03:15:51 djm Exp $ */ +/* $OpenBSD: monitor_wrap.c,v 1.100 2018/07/06 09:05:01 sf Exp $ */ /* * Copyright 2002 Niels Provos * Copyright 2002 Markus Friedl @@ -84,8 +84,6 @@ #include "ssherr.h" /* Imports */ -extern z_stream incoming_stream; -extern z_stream outgoing_stream; extern struct monitor *pmonitor; extern Buffer loginmsg; extern ServerOptions options; diff --git a/packet.c b/packet.c index 4da9f52b6..a39a340f3 100644 --- a/packet.c +++ b/packet.c @@ -1,4 +1,4 @@ -/* $OpenBSD: packet.c,v 1.272 2018/07/06 09:03:02 sf Exp $ */ +/* $OpenBSD: packet.c,v 1.273 2018/07/06 09:05:01 sf Exp $ */ /* * Author: Tatu Ylonen * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland @@ -879,9 +879,8 @@ ssh_set_newkeys(struct ssh *ssh, int mode) /* explicit_bzero(enc->iv, enc->block_size); explicit_bzero(enc->key, enc->key_len); explicit_bzero(mac->key, mac->key_len); */ - if ((comp->type == COMP_ZLIB || - (comp->type == COMP_DELAYED && - state->after_authentication)) && comp->enabled == 0) { + if (comp->type == COMP_DELAYED && state->after_authentication + && comp->enabled == 0) { if ((r = ssh_packet_init_compression(ssh)) < 0) return r; if (mode == MODE_OUT) { diff --git a/sshconnect2.c b/sshconnect2.c index f3ccd53a9..183484e08 100644 --- a/sshconnect2.c +++ b/sshconnect2.c @@ -1,4 +1,4 @@ -/* $OpenBSD: sshconnect2.c,v 1.275 2018/07/04 13:49:31 djm Exp $ */ +/* $OpenBSD: sshconnect2.c,v 1.276 2018/07/06 09:05:01 sf Exp $ */ /* * Copyright (c) 2000 Markus Friedl. All rights reserved. * Copyright (c) 2008 Damien Miller. All rights reserved. @@ -174,7 +174,7 @@ ssh_kex2(char *host, struct sockaddr *hostaddr, u_short port) compat_cipher_proposal(options.ciphers); myproposal[PROPOSAL_COMP_ALGS_CTOS] = myproposal[PROPOSAL_COMP_ALGS_STOC] = options.compression ? - "zlib@openssh.com,zlib,none" : "none,zlib@openssh.com,zlib"; + "zlib@openssh.com,none" : "none,zlib@openssh.com"; myproposal[PROPOSAL_MAC_ALGS_CTOS] = myproposal[PROPOSAL_MAC_ALGS_STOC] = options.macs; if (options.hostkeyalgorithms != NULL) { -- cgit v1.2.3 From ab39267fa1243d02b6c330615539fc4b21e17dc4 Mon Sep 17 00:00:00 2001 From: "sf@openbsd.org" Date: Fri, 6 Jul 2018 09:06:14 +0000 Subject: upstream: Rename COMP_DELAYED to COMP_ZLIB Only delayed compression is supported nowadays. ok markus@ OpenBSD-Commit-ID: 5b1dbaf3d9a4085aaa10fec0b7a4364396561821 --- kex.c | 4 ++-- kex.h | 4 ++-- packet.c | 8 ++++---- servconf.c | 8 ++++---- 4 files changed, 12 insertions(+), 12 deletions(-) (limited to 'kex.h') diff --git a/kex.c b/kex.c index 0c444e186..b111c4a54 100644 --- a/kex.c +++ b/kex.c @@ -1,4 +1,4 @@ -/* $OpenBSD: kex.c,v 1.139 2018/07/06 09:05:01 sf Exp $ */ +/* $OpenBSD: kex.c,v 1.140 2018/07/06 09:06:14 sf Exp $ */ /* * Copyright (c) 2000, 2001 Markus Friedl. All rights reserved. * @@ -741,7 +741,7 @@ choose_comp(struct sshcomp *comp, char *client, char *server) if (name == NULL) return SSH_ERR_NO_COMPRESS_ALG_MATCH; if (strcmp(name, "zlib@openssh.com") == 0) { - comp->type = COMP_DELAYED; + comp->type = COMP_ZLIB; } else if (strcmp(name, "none") == 0) { comp->type = COMP_NONE; } else { diff --git a/kex.h b/kex.h index 676c32abd..b57f985ef 100644 --- a/kex.h +++ b/kex.h @@ -1,4 +1,4 @@ -/* $OpenBSD: kex.h,v 1.86 2018/07/06 09:05:01 sf Exp $ */ +/* $OpenBSD: kex.h,v 1.87 2018/07/06 09:06:14 sf Exp $ */ /* * Copyright (c) 2000, 2001 Markus Friedl. All rights reserved. @@ -64,7 +64,7 @@ #define KEX_CURVE25519_SHA256_OLD "curve25519-sha256@libssh.org" #define COMP_NONE 0 -#define COMP_DELAYED 1 +#define COMP_ZLIB 1 #define CURVE25519_SIZE 32 diff --git a/packet.c b/packet.c index a39a340f3..2e87e520f 100644 --- a/packet.c +++ b/packet.c @@ -1,4 +1,4 @@ -/* $OpenBSD: packet.c,v 1.273 2018/07/06 09:05:01 sf Exp $ */ +/* $OpenBSD: packet.c,v 1.274 2018/07/06 09:06:14 sf Exp $ */ /* * Author: Tatu Ylonen * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland @@ -879,7 +879,7 @@ ssh_set_newkeys(struct ssh *ssh, int mode) /* explicit_bzero(enc->iv, enc->block_size); explicit_bzero(enc->key, enc->key_len); explicit_bzero(mac->key, mac->key_len); */ - if (comp->type == COMP_DELAYED && state->after_authentication + if (comp->type == COMP_ZLIB && state->after_authentication && comp->enabled == 0) { if ((r = ssh_packet_init_compression(ssh)) < 0) return r; @@ -970,7 +970,7 @@ ssh_packet_enable_delayed_compress(struct ssh *ssh) /* * Remember that we are past the authentication step, so rekeying - * with COMP_DELAYED will turn on compression immediately. + * with COMP_ZLIB will turn on compression immediately. */ state->after_authentication = 1; for (mode = 0; mode < MODE_MAX; mode++) { @@ -978,7 +978,7 @@ ssh_packet_enable_delayed_compress(struct ssh *ssh) if (state->newkeys[mode] == NULL) continue; comp = &state->newkeys[mode]->comp; - if (comp && !comp->enabled && comp->type == COMP_DELAYED) { + if (comp && !comp->enabled && comp->type == COMP_ZLIB) { if ((r = ssh_packet_init_compression(ssh)) != 0) return r; if (mode == MODE_OUT) { diff --git a/servconf.c b/servconf.c index a54219f01..f5272b0f9 100644 --- a/servconf.c +++ b/servconf.c @@ -1,5 +1,5 @@ -/* $OpenBSD: servconf.c,v 1.335 2018/07/04 13:49:31 djm Exp $ */ +/* $OpenBSD: servconf.c,v 1.336 2018/07/06 09:06:14 sf Exp $ */ /* * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland * All rights reserved @@ -349,7 +349,7 @@ fill_default_server_options(ServerOptions *options) options->permit_user_env_whitelist = NULL; } if (options->compression == -1) - options->compression = COMP_DELAYED; + options->compression = COMP_ZLIB; if (options->rekey_limit == -1) options->rekey_limit = 0; if (options->rekey_interval == -1) @@ -1170,8 +1170,8 @@ static const struct multistate multistate_permitrootlogin[] = { { NULL, -1 } }; static const struct multistate multistate_compression[] = { - { "yes", COMP_DELAYED }, - { "delayed", COMP_DELAYED }, + { "yes", COMP_ZLIB }, + { "delayed", COMP_ZLIB }, { "no", COMP_NONE }, { NULL, -1 } }; -- cgit v1.2.3 From 168b46f405d6736960ba7930389eecb9b6710b7e Mon Sep 17 00:00:00 2001 From: "sf@openbsd.org" Date: Mon, 9 Jul 2018 13:37:10 +0000 Subject: upstream: Revert previous two commits It turns out we still support pre-auth compression on the client. Therefore revert the previous two commits: date: 2018/07/06 09:06:14; author: sf; commitid: yZVYKIRtUZWD9CmE; Rename COMP_DELAYED to COMP_ZLIB Only delayed compression is supported nowadays. ok markus@ date: 2018/07/06 09:05:01; author: sf; commitid: rEGuT5UgI9f6kddP; Remove leftovers from pre-authentication compression Support for this has been removed in 2016. COMP_DELAYED will be renamed in a later commit. ok markus@ OpenBSD-Commit-ID: cdfef526357e4e1483c86cf599491b2dafb77772 --- kex.c | 4 +++- kex.h | 3 ++- monitor_wrap.c | 4 +++- packet.c | 11 ++++++----- servconf.c | 8 ++++---- sshconnect2.c | 4 ++-- 6 files changed, 20 insertions(+), 14 deletions(-) (limited to 'kex.h') diff --git a/kex.c b/kex.c index b111c4a54..25f9f66f6 100644 --- a/kex.c +++ b/kex.c @@ -1,4 +1,4 @@ -/* $OpenBSD: kex.c,v 1.140 2018/07/06 09:06:14 sf Exp $ */ +/* $OpenBSD: kex.c,v 1.141 2018/07/09 13:37:10 sf Exp $ */ /* * Copyright (c) 2000, 2001 Markus Friedl. All rights reserved. * @@ -741,6 +741,8 @@ choose_comp(struct sshcomp *comp, char *client, char *server) if (name == NULL) return SSH_ERR_NO_COMPRESS_ALG_MATCH; if (strcmp(name, "zlib@openssh.com") == 0) { + comp->type = COMP_DELAYED; + } else if (strcmp(name, "zlib") == 0) { comp->type = COMP_ZLIB; } else if (strcmp(name, "none") == 0) { comp->type = COMP_NONE; diff --git a/kex.h b/kex.h index b57f985ef..e3816047a 100644 --- a/kex.h +++ b/kex.h @@ -1,4 +1,4 @@ -/* $OpenBSD: kex.h,v 1.87 2018/07/06 09:06:14 sf Exp $ */ +/* $OpenBSD: kex.h,v 1.88 2018/07/09 13:37:10 sf Exp $ */ /* * Copyright (c) 2000, 2001 Markus Friedl. All rights reserved. @@ -65,6 +65,7 @@ #define COMP_NONE 0 #define COMP_ZLIB 1 +#define COMP_DELAYED 2 #define CURVE25519_SIZE 32 diff --git a/monitor_wrap.c b/monitor_wrap.c index e280fd2ad..012ab01a9 100644 --- a/monitor_wrap.c +++ b/monitor_wrap.c @@ -1,4 +1,4 @@ -/* $OpenBSD: monitor_wrap.c,v 1.100 2018/07/06 09:05:01 sf Exp $ */ +/* $OpenBSD: monitor_wrap.c,v 1.101 2018/07/09 13:37:10 sf Exp $ */ /* * Copyright 2002 Niels Provos * Copyright 2002 Markus Friedl @@ -84,6 +84,8 @@ #include "ssherr.h" /* Imports */ +extern z_stream incoming_stream; +extern z_stream outgoing_stream; extern struct monitor *pmonitor; extern Buffer loginmsg; extern ServerOptions options; diff --git a/packet.c b/packet.c index 2e87e520f..4d91792e0 100644 --- a/packet.c +++ b/packet.c @@ -1,4 +1,4 @@ -/* $OpenBSD: packet.c,v 1.274 2018/07/06 09:06:14 sf Exp $ */ +/* $OpenBSD: packet.c,v 1.275 2018/07/09 13:37:10 sf Exp $ */ /* * Author: Tatu Ylonen * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland @@ -879,8 +879,9 @@ ssh_set_newkeys(struct ssh *ssh, int mode) /* explicit_bzero(enc->iv, enc->block_size); explicit_bzero(enc->key, enc->key_len); explicit_bzero(mac->key, mac->key_len); */ - if (comp->type == COMP_ZLIB && state->after_authentication - && comp->enabled == 0) { + if ((comp->type == COMP_ZLIB || + (comp->type == COMP_DELAYED && + state->after_authentication)) && comp->enabled == 0) { if ((r = ssh_packet_init_compression(ssh)) < 0) return r; if (mode == MODE_OUT) { @@ -970,7 +971,7 @@ ssh_packet_enable_delayed_compress(struct ssh *ssh) /* * Remember that we are past the authentication step, so rekeying - * with COMP_ZLIB will turn on compression immediately. + * with COMP_DELAYED will turn on compression immediately. */ state->after_authentication = 1; for (mode = 0; mode < MODE_MAX; mode++) { @@ -978,7 +979,7 @@ ssh_packet_enable_delayed_compress(struct ssh *ssh) if (state->newkeys[mode] == NULL) continue; comp = &state->newkeys[mode]->comp; - if (comp && !comp->enabled && comp->type == COMP_ZLIB) { + if (comp && !comp->enabled && comp->type == COMP_DELAYED) { if ((r = ssh_packet_init_compression(ssh)) != 0) return r; if (mode == MODE_OUT) { diff --git a/servconf.c b/servconf.c index f5272b0f9..97c268e3c 100644 --- a/servconf.c +++ b/servconf.c @@ -1,5 +1,5 @@ -/* $OpenBSD: servconf.c,v 1.336 2018/07/06 09:06:14 sf Exp $ */ +/* $OpenBSD: servconf.c,v 1.337 2018/07/09 13:37:10 sf Exp $ */ /* * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland * All rights reserved @@ -349,7 +349,7 @@ fill_default_server_options(ServerOptions *options) options->permit_user_env_whitelist = NULL; } if (options->compression == -1) - options->compression = COMP_ZLIB; + options->compression = COMP_DELAYED; if (options->rekey_limit == -1) options->rekey_limit = 0; if (options->rekey_interval == -1) @@ -1170,8 +1170,8 @@ static const struct multistate multistate_permitrootlogin[] = { { NULL, -1 } }; static const struct multistate multistate_compression[] = { - { "yes", COMP_ZLIB }, - { "delayed", COMP_ZLIB }, + { "yes", COMP_DELAYED }, + { "delayed", COMP_DELAYED }, { "no", COMP_NONE }, { NULL, -1 } }; diff --git a/sshconnect2.c b/sshconnect2.c index 183484e08..4bc0a7034 100644 --- a/sshconnect2.c +++ b/sshconnect2.c @@ -1,4 +1,4 @@ -/* $OpenBSD: sshconnect2.c,v 1.276 2018/07/06 09:05:01 sf Exp $ */ +/* $OpenBSD: sshconnect2.c,v 1.277 2018/07/09 13:37:10 sf Exp $ */ /* * Copyright (c) 2000 Markus Friedl. All rights reserved. * Copyright (c) 2008 Damien Miller. All rights reserved. @@ -174,7 +174,7 @@ ssh_kex2(char *host, struct sockaddr *hostaddr, u_short port) compat_cipher_proposal(options.ciphers); myproposal[PROPOSAL_COMP_ALGS_CTOS] = myproposal[PROPOSAL_COMP_ALGS_STOC] = options.compression ? - "zlib@openssh.com,none" : "none,zlib@openssh.com"; + "zlib@openssh.com,zlib,none" : "none,zlib@openssh.com,zlib"; myproposal[PROPOSAL_MAC_ALGS_CTOS] = myproposal[PROPOSAL_MAC_ALGS_STOC] = options.macs; if (options.hostkeyalgorithms != NULL) { -- cgit v1.2.3 From cb30cd47041edb03476be1c8ef7bc1f4b69d1555 Mon Sep 17 00:00:00 2001 From: "markus@openbsd.org" Date: Mon, 9 Jul 2018 21:56:06 +0000 Subject: upstream: remove legacy buffer API emulation layer; ok djm@ OpenBSD-Commit-ID: 2dd5dc17cbc23195be4299fa93be2707a0e08ad9 --- Makefile.in | 4 +- bufaux.c | 259 ------------------------------------------------------------ bufbn.c | 69 ---------------- bufec.c | 74 ----------------- buffer.c | 118 --------------------------- buffer.h | 95 ---------------------- kex.h | 3 +- sshbuf.c | 22 +----- sshbuf.h | 11 +-- 9 files changed, 6 insertions(+), 649 deletions(-) delete mode 100644 bufaux.c delete mode 100644 bufbn.c delete mode 100644 bufec.c delete mode 100644 buffer.c delete mode 100644 buffer.h (limited to 'kex.h') diff --git a/Makefile.in b/Makefile.in index 2cd485538..277418cfe 100644 --- a/Makefile.in +++ b/Makefile.in @@ -84,7 +84,7 @@ LIBOPENSSH_OBJS=\ ${XMSS_OBJS} LIBSSH_OBJS=${LIBOPENSSH_OBJS} \ - authfd.o authfile.o bufaux.o bufbn.o bufec.o buffer.o \ + authfd.o authfile.o \ canohost.o channels.o cipher.o cipher-aes.o cipher-aesctr.o \ cipher-ctr.o cleanup.o \ compat.o crc32.o fatal.o hostfile.o \ @@ -175,7 +175,7 @@ sshd$(EXEEXT): libssh.a $(LIBCOMPAT) $(SSHDOBJS) $(LD) -o $@ $(SSHDOBJS) $(LDFLAGS) -lssh -lopenbsd-compat $(SSHDLIBS) $(LIBS) $(GSSLIBS) $(K5LIBS) scp$(EXEEXT): $(LIBCOMPAT) libssh.a scp.o progressmeter.o - $(LD) -o $@ scp.o progressmeter.o bufaux.o $(LDFLAGS) -lssh -lopenbsd-compat $(LIBS) + $(LD) -o $@ scp.o progressmeter.o $(LDFLAGS) -lssh -lopenbsd-compat $(LIBS) ssh-add$(EXEEXT): $(LIBCOMPAT) libssh.a ssh-add.o $(LD) -o $@ ssh-add.o $(LDFLAGS) -lssh -lopenbsd-compat $(LIBS) diff --git a/bufaux.c b/bufaux.c deleted file mode 100644 index 3976896a9..000000000 --- a/bufaux.c +++ /dev/null @@ -1,259 +0,0 @@ -/* $OpenBSD: bufaux.c,v 1.60 2014/04/30 05:29:56 djm Exp $ */ -/* - * Copyright (c) 2012 Damien Miller - * - * Permission to use, copy, modify, and distribute this software for any - * purpose with or without fee is hereby granted, provided that the above - * copyright notice and this permission notice appear in all copies. - * - * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES - * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR - * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES - * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN - * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF - * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - */ - -/* Emulation wrappers for legacy OpenSSH buffer API atop sshbuf */ - -#include "includes.h" - -#include - -#include "buffer.h" -#include "log.h" -#include "ssherr.h" - -int -buffer_get_short_ret(u_short *v, Buffer *buffer) -{ - int ret; - - if ((ret = sshbuf_get_u16(buffer, v)) != 0) { - error("%s: %s", __func__, ssh_err(ret)); - return -1; - } - return 0; -} - -u_short -buffer_get_short(Buffer *buffer) -{ - u_short ret; - - if (buffer_get_short_ret(&ret, buffer) == -1) - fatal("%s: buffer error", __func__); - - return (ret); -} - -int -buffer_get_int_ret(u_int *v, Buffer *buffer) -{ - int ret; - - if ((ret = sshbuf_get_u32(buffer, v)) != 0) { - error("%s: %s", __func__, ssh_err(ret)); - return -1; - } - return 0; -} - -u_int -buffer_get_int(Buffer *buffer) -{ - u_int ret; - - if (buffer_get_int_ret(&ret, buffer) == -1) - fatal("%s: buffer error", __func__); - - return (ret); -} - -int -buffer_get_int64_ret(u_int64_t *v, Buffer *buffer) -{ - int ret; - - if ((ret = sshbuf_get_u64(buffer, v)) != 0) { - error("%s: %s", __func__, ssh_err(ret)); - return -1; - } - return 0; -} - -u_int64_t -buffer_get_int64(Buffer *buffer) -{ - u_int64_t ret; - - if (buffer_get_int64_ret(&ret, buffer) == -1) - fatal("%s: buffer error", __func__); - - return (ret); -} - -void -buffer_put_short(Buffer *buffer, u_short value) -{ - int ret; - - if ((ret = sshbuf_put_u16(buffer, value)) != 0) - fatal("%s: %s", __func__, ssh_err(ret)); -} - -void -buffer_put_int(Buffer *buffer, u_int value) -{ - int ret; - - if ((ret = sshbuf_put_u32(buffer, value)) != 0) - fatal("%s: %s", __func__, ssh_err(ret)); -} - -void -buffer_put_int64(Buffer *buffer, u_int64_t value) -{ - int ret; - - if ((ret = sshbuf_put_u64(buffer, value)) != 0) - fatal("%s: %s", __func__, ssh_err(ret)); -} - -void * -buffer_get_string_ret(Buffer *buffer, u_int *length_ptr) -{ - size_t len; - int ret; - u_char *value; - - if ((ret = sshbuf_get_string(buffer, &value, &len)) != 0) { - error("%s: %s", __func__, ssh_err(ret)); - return NULL; - } - if (length_ptr != NULL) - *length_ptr = len; /* Safe: sshbuf never stores len > 2^31 */ - return value; -} - -void * -buffer_get_string(Buffer *buffer, u_int *length_ptr) -{ - void *ret; - - if ((ret = buffer_get_string_ret(buffer, length_ptr)) == NULL) - fatal("%s: buffer error", __func__); - return (ret); -} - -char * -buffer_get_cstring_ret(Buffer *buffer, u_int *length_ptr) -{ - size_t len; - int ret; - char *value; - - if ((ret = sshbuf_get_cstring(buffer, &value, &len)) != 0) { - error("%s: %s", __func__, ssh_err(ret)); - return NULL; - } - if (length_ptr != NULL) - *length_ptr = len; /* Safe: sshbuf never stores len > 2^31 */ - return value; -} - -char * -buffer_get_cstring(Buffer *buffer, u_int *length_ptr) -{ - char *ret; - - if ((ret = buffer_get_cstring_ret(buffer, length_ptr)) == NULL) - fatal("%s: buffer error", __func__); - return ret; -} - -const void * -buffer_get_string_ptr_ret(Buffer *buffer, u_int *length_ptr) -{ - size_t len; - int ret; - const u_char *value; - - if ((ret = sshbuf_get_string_direct(buffer, &value, &len)) != 0) { - error("%s: %s", __func__, ssh_err(ret)); - return NULL; - } - if (length_ptr != NULL) - *length_ptr = len; /* Safe: sshbuf never stores len > 2^31 */ - return value; -} - -const void * -buffer_get_string_ptr(Buffer *buffer, u_int *length_ptr) -{ - const void *ret; - - if ((ret = buffer_get_string_ptr_ret(buffer, length_ptr)) == NULL) - fatal("%s: buffer error", __func__); - return (ret); -} - -void -buffer_put_string(Buffer *buffer, const void *buf, u_int len) -{ - int ret; - - if ((ret = sshbuf_put_string(buffer, buf, len)) != 0) - fatal("%s: %s", __func__, ssh_err(ret)); -} - -void -buffer_put_cstring(Buffer *buffer, const char *s) -{ - int ret; - - if ((ret = sshbuf_put_cstring(buffer, s)) != 0) - fatal("%s: %s", __func__, ssh_err(ret)); -} - -int -buffer_get_char_ret(char *v, Buffer *buffer) -{ - int ret; - - if ((ret = sshbuf_get_u8(buffer, (u_char *)v)) != 0) { - error("%s: %s", __func__, ssh_err(ret)); - return -1; - } - return 0; -} - -int -buffer_get_char(Buffer *buffer) -{ - char ch; - - if (buffer_get_char_ret(&ch, buffer) == -1) - fatal("%s: buffer error", __func__); - return (u_char) ch; -} - -void -buffer_put_char(Buffer *buffer, int value) -{ - int ret; - - if ((ret = sshbuf_put_u8(buffer, value)) != 0) - fatal("%s: %s", __func__, ssh_err(ret)); -} - -void -buffer_put_bignum2_from_string(Buffer *buffer, const u_char *s, u_int l) -{ - int ret; - - if ((ret = sshbuf_put_bignum2_bytes(buffer, s, l)) != 0) - fatal("%s: %s", __func__, ssh_err(ret)); -} - diff --git a/bufbn.c b/bufbn.c deleted file mode 100644 index 98f9466bc..000000000 --- a/bufbn.c +++ /dev/null @@ -1,69 +0,0 @@ -/* $OpenBSD: bufbn.c,v 1.13 2017/04/30 23:23:54 djm Exp $ */ - -/* - * Copyright (c) 2012 Damien Miller - * - * Permission to use, copy, modify, and distribute this software for any - * purpose with or without fee is hereby granted, provided that the above - * copyright notice and this permission notice appear in all copies. - * - * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES - * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR - * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES - * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN - * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF - * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - */ - -/* Emulation wrappers for legacy OpenSSH buffer API atop sshbuf */ - -#include "includes.h" - -#ifdef WITH_OPENSSL - -#include - -#include "buffer.h" -#include "log.h" -#include "ssherr.h" - -int -buffer_put_bignum2_ret(Buffer *buffer, const BIGNUM *value) -{ - int ret; - - if ((ret = sshbuf_put_bignum2(buffer, value)) != 0) { - error("%s: %s", __func__, ssh_err(ret)); - return -1; - } - return 0; -} - -void -buffer_put_bignum2(Buffer *buffer, const BIGNUM *value) -{ - if (buffer_put_bignum2_ret(buffer, value) == -1) - fatal("%s: buffer error", __func__); -} - -int -buffer_get_bignum2_ret(Buffer *buffer, BIGNUM *value) -{ - int ret; - - if ((ret = sshbuf_get_bignum2(buffer, value)) != 0) { - error("%s: %s", __func__, ssh_err(ret)); - return -1; - } - return 0; -} - -void -buffer_get_bignum2(Buffer *buffer, BIGNUM *value) -{ - if (buffer_get_bignum2_ret(buffer, value) == -1) - fatal("%s: buffer error", __func__); -} - -#endif /* WITH_OPENSSL */ diff --git a/bufec.c b/bufec.c deleted file mode 100644 index 749ce9d4c..000000000 --- a/bufec.c +++ /dev/null @@ -1,74 +0,0 @@ -/* $OpenBSD: bufec.c,v 1.4 2014/04/30 05:29:56 djm Exp $ */ - -/* - * Copyright (c) 2012 Damien Miller - * - * Permission to use, copy, modify, and distribute this software for any - * purpose with or without fee is hereby granted, provided that the above - * copyright notice and this permission notice appear in all copies. - * - * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES - * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR - * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES - * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN - * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF - * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - */ - -/* Emulation wrappers for legacy OpenSSH buffer API atop sshbuf */ - -#include "includes.h" - -#include - -#include "buffer.h" -#include "log.h" -#include "ssherr.h" - -#ifdef OPENSSL_HAS_ECC - -int -buffer_put_ecpoint_ret(Buffer *buffer, const EC_GROUP *curve, - const EC_POINT *point) -{ - int ret; - - if ((ret = sshbuf_put_ec(buffer, point, curve)) != 0) { - error("%s: %s", __func__, ssh_err(ret)); - return -1; - } - return 0; -} - -void -buffer_put_ecpoint(Buffer *buffer, const EC_GROUP *curve, - const EC_POINT *point) -{ - if (buffer_put_ecpoint_ret(buffer, curve, point) == -1) - fatal("%s: buffer error", __func__); -} - -int -buffer_get_ecpoint_ret(Buffer *buffer, const EC_GROUP *curve, - EC_POINT *point) -{ - int ret; - - if ((ret = sshbuf_get_ec(buffer, point, curve)) != 0) { - error("%s: %s", __func__, ssh_err(ret)); - return -1; - } - return 0; -} - -void -buffer_get_ecpoint(Buffer *buffer, const EC_GROUP *curve, - EC_POINT *point) -{ - if (buffer_get_ecpoint_ret(buffer, curve, point) == -1) - fatal("%s: buffer error", __func__); -} - -#endif /* OPENSSL_HAS_ECC */ - diff --git a/buffer.c b/buffer.c deleted file mode 100644 index c5f708ab2..000000000 --- a/buffer.c +++ /dev/null @@ -1,118 +0,0 @@ -/* $OpenBSD: buffer.c,v 1.36 2014/04/30 05:29:56 djm Exp $ */ - -/* - * Copyright (c) 2012 Damien Miller - * - * Permission to use, copy, modify, and distribute this software for any - * purpose with or without fee is hereby granted, provided that the above - * copyright notice and this permission notice appear in all copies. - * - * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES - * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR - * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES - * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN - * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF - * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - */ - -/* Emulation wrappers for legacy OpenSSH buffer API atop sshbuf */ - -#include "includes.h" - -#include - -#include "buffer.h" -#include "log.h" -#include "ssherr.h" - -void -buffer_append(Buffer *buffer, const void *data, u_int len) -{ - int ret; - - if ((ret = sshbuf_put(buffer, data, len)) != 0) - fatal("%s: %s", __func__, ssh_err(ret)); -} - -void * -buffer_append_space(Buffer *buffer, u_int len) -{ - int ret; - u_char *p; - - if ((ret = sshbuf_reserve(buffer, len, &p)) != 0) - fatal("%s: %s", __func__, ssh_err(ret)); - return p; -} - -int -buffer_check_alloc(Buffer *buffer, u_int len) -{ - int ret = sshbuf_check_reserve(buffer, len); - - if (ret == 0) - return 1; - if (ret == SSH_ERR_NO_BUFFER_SPACE) - return 0; - fatal("%s: %s", __func__, ssh_err(ret)); -} - -int -buffer_get_ret(Buffer *buffer, void *buf, u_int len) -{ - int ret; - - if ((ret = sshbuf_get(buffer, buf, len)) != 0) { - error("%s: %s", __func__, ssh_err(ret)); - return -1; - } - return 0; -} - -void -buffer_get(Buffer *buffer, void *buf, u_int len) -{ - if (buffer_get_ret(buffer, buf, len) == -1) - fatal("%s: buffer error", __func__); -} - -int -buffer_consume_ret(Buffer *buffer, u_int bytes) -{ - int ret = sshbuf_consume(buffer, bytes); - - if (ret == 0) - return 0; - if (ret == SSH_ERR_MESSAGE_INCOMPLETE) - return -1; - fatal("%s: %s", __func__, ssh_err(ret)); -} - -void -buffer_consume(Buffer *buffer, u_int bytes) -{ - if (buffer_consume_ret(buffer, bytes) == -1) - fatal("%s: buffer error", __func__); -} - -int -buffer_consume_end_ret(Buffer *buffer, u_int bytes) -{ - int ret = sshbuf_consume_end(buffer, bytes); - - if (ret == 0) - return 0; - if (ret == SSH_ERR_MESSAGE_INCOMPLETE) - return -1; - fatal("%s: %s", __func__, ssh_err(ret)); -} - -void -buffer_consume_end(Buffer *buffer, u_int bytes) -{ - if (buffer_consume_end_ret(buffer, bytes) == -1) - fatal("%s: buffer error", __func__); -} - - diff --git a/buffer.h b/buffer.h deleted file mode 100644 index 56174394c..000000000 --- a/buffer.h +++ /dev/null @@ -1,95 +0,0 @@ -/* $OpenBSD: buffer.h,v 1.26 2017/04/30 23:23:54 djm Exp $ */ - -/* - * Copyright (c) 2012 Damien Miller - * - * Permission to use, copy, modify, and distribute this software for any - * purpose with or without fee is hereby granted, provided that the above - * copyright notice and this permission notice appear in all copies. - * - * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES - * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR - * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES - * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN - * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF - * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - */ - -/* Emulation wrappers for legacy OpenSSH buffer API atop sshbuf */ - -#ifndef BUFFER_H -#define BUFFER_H - -#include "sshbuf.h" - -typedef struct sshbuf Buffer; - -#define buffer_init(b) sshbuf_init(b) -#define buffer_clear(b) sshbuf_reset(b) -#define buffer_free(b) sshbuf_free(b) -#define buffer_dump(b) sshbuf_dump(b, stderr) - -/* XXX cast is safe: sshbuf never stores more than len 2^31 */ -#define buffer_len(b) ((u_int) sshbuf_len(b)) -#define buffer_ptr(b) sshbuf_mutable_ptr(b) - -void buffer_append(Buffer *, const void *, u_int); -void *buffer_append_space(Buffer *, u_int); -int buffer_check_alloc(Buffer *, u_int); -void buffer_get(Buffer *, void *, u_int); - -void buffer_consume(Buffer *, u_int); -void buffer_consume_end(Buffer *, u_int); - - -int buffer_get_ret(Buffer *, void *, u_int); -int buffer_consume_ret(Buffer *, u_int); -int buffer_consume_end_ret(Buffer *, u_int); - -#include -#include -void buffer_put_bignum2(Buffer *, const BIGNUM *); -void buffer_get_bignum2(Buffer *, BIGNUM *); -void buffer_put_bignum2_from_string(Buffer *, const u_char *, u_int); - -u_short buffer_get_short(Buffer *); -void buffer_put_short(Buffer *, u_short); - -u_int buffer_get_int(Buffer *); -void buffer_put_int(Buffer *, u_int); - -u_int64_t buffer_get_int64(Buffer *); -void buffer_put_int64(Buffer *, u_int64_t); - -int buffer_get_char(Buffer *); -void buffer_put_char(Buffer *, int); - -void *buffer_get_string(Buffer *, u_int *); -const void *buffer_get_string_ptr(Buffer *, u_int *); -void buffer_put_string(Buffer *, const void *, u_int); -char *buffer_get_cstring(Buffer *, u_int *); -void buffer_put_cstring(Buffer *, const char *); - -#define buffer_skip_string(b) (void)buffer_get_string_ptr(b, NULL); - -int buffer_put_bignum2_ret(Buffer *, const BIGNUM *); -int buffer_get_bignum2_ret(Buffer *, BIGNUM *); -int buffer_get_short_ret(u_short *, Buffer *); -int buffer_get_int_ret(u_int *, Buffer *); -int buffer_get_int64_ret(u_int64_t *, Buffer *); -void *buffer_get_string_ret(Buffer *, u_int *); -char *buffer_get_cstring_ret(Buffer *, u_int *); -const void *buffer_get_string_ptr_ret(Buffer *, u_int *); -int buffer_get_char_ret(char *, Buffer *); - -#ifdef OPENSSL_HAS_ECC -#include -int buffer_put_ecpoint_ret(Buffer *, const EC_GROUP *, const EC_POINT *); -void buffer_put_ecpoint(Buffer *, const EC_GROUP *, const EC_POINT *); -int buffer_get_ecpoint_ret(Buffer *, const EC_GROUP *, EC_POINT *); -void buffer_get_ecpoint(Buffer *, const EC_GROUP *, EC_POINT *); -#endif - -#endif /* BUFFER_H */ - diff --git a/kex.h b/kex.h index e3816047a..209008189 100644 --- a/kex.h +++ b/kex.h @@ -1,4 +1,4 @@ -/* $OpenBSD: kex.h,v 1.88 2018/07/09 13:37:10 sf Exp $ */ +/* $OpenBSD: kex.h,v 1.89 2018/07/09 21:56:06 markus Exp $ */ /* * Copyright (c) 2000, 2001 Markus Friedl. All rights reserved. @@ -27,7 +27,6 @@ #define KEX_H #include "mac.h" -#include "buffer.h" /* XXX for typedef */ #include "key.h" /* XXX for typedef */ #ifdef WITH_LEAKMALLOC diff --git a/sshbuf.c b/sshbuf.c index de783a363..20ddf9eb6 100644 --- a/sshbuf.c +++ b/sshbuf.c @@ -1,4 +1,4 @@ -/* $OpenBSD: sshbuf.c,v 1.11 2017/06/01 06:58:25 djm Exp $ */ +/* $OpenBSD: sshbuf.c,v 1.12 2018/07/09 21:56:06 markus Exp $ */ /* * Copyright (c) 2011 Damien Miller * @@ -36,7 +36,6 @@ sshbuf_check_sanity(const struct sshbuf *buf) (!buf->readonly && buf->d != buf->cd) || buf->refcount < 1 || buf->refcount > SSHBUF_REFS_MAX || buf->cd == NULL || - (buf->dont_free && (buf->readonly || buf->parent != NULL)) || buf->max_size > SSHBUF_SIZE_MAX || buf->alloc > buf->max_size || buf->size > buf->alloc || @@ -131,24 +130,9 @@ sshbuf_fromb(struct sshbuf *buf) return ret; } -void -sshbuf_init(struct sshbuf *ret) -{ - explicit_bzero(ret, sizeof(*ret)); - ret->alloc = SSHBUF_SIZE_INIT; - ret->max_size = SSHBUF_SIZE_MAX; - ret->readonly = 0; - ret->dont_free = 1; - ret->refcount = 1; - if ((ret->cd = ret->d = calloc(1, ret->alloc)) == NULL) - ret->alloc = 0; -} - void sshbuf_free(struct sshbuf *buf) { - int dont_free = 0; - if (buf == NULL) return; /* @@ -173,14 +157,12 @@ sshbuf_free(struct sshbuf *buf) buf->refcount--; if (buf->refcount > 0) return; - dont_free = buf->dont_free; if (!buf->readonly) { explicit_bzero(buf->d, buf->alloc); free(buf->d); } explicit_bzero(buf, sizeof(*buf)); - if (!dont_free) - free(buf); + free(buf); } void diff --git a/sshbuf.h b/sshbuf.h index 25b4e69aa..a43598cac 100644 --- a/sshbuf.h +++ b/sshbuf.h @@ -1,4 +1,4 @@ -/* $OpenBSD: sshbuf.h,v 1.10 2018/04/10 00:10:49 djm Exp $ */ +/* $OpenBSD: sshbuf.h,v 1.11 2018/07/09 21:56:06 markus Exp $ */ /* * Copyright (c) 2011 Damien Miller * @@ -50,15 +50,6 @@ struct sshbuf { struct sshbuf *parent; /* If child, pointer to parent */ }; -#ifndef SSHBUF_NO_DEPREACTED -/* - * NB. Please do not use sshbuf_init() in new code. Please use sshbuf_new() - * instead. sshbuf_init() is deprecated and will go away soon (it is - * only included to allow compat with buffer_* in OpenSSH) - */ -void sshbuf_init(struct sshbuf *buf); -#endif - /* * Create a new sshbuf buffer. * Returns pointer to buffer on success, or NULL on allocation failure. -- cgit v1.2.3 From 984bacfaacbbe31c35191b828fb5b5b2f0362c36 Mon Sep 17 00:00:00 2001 From: "sf@openbsd.org" Date: Tue, 10 Jul 2018 09:36:58 +0000 Subject: upstream: re-remove some pre-auth compression bits This time, make sure to not remove things that are necessary for pre-auth compression on the client. Add a comment that pre-auth compression is still supported in the client. ok markus@ OpenBSD-Commit-ID: 282c6fec7201f18a5c333bbb68d9339734d2f784 --- kex.h | 3 ++- monitor_wrap.c | 4 +--- 2 files changed, 3 insertions(+), 4 deletions(-) (limited to 'kex.h') diff --git a/kex.h b/kex.h index 209008189..d36e4d150 100644 --- a/kex.h +++ b/kex.h @@ -1,4 +1,4 @@ -/* $OpenBSD: kex.h,v 1.89 2018/07/09 21:56:06 markus Exp $ */ +/* $OpenBSD: kex.h,v 1.90 2018/07/10 09:36:58 sf Exp $ */ /* * Copyright (c) 2000, 2001 Markus Friedl. All rights reserved. @@ -63,6 +63,7 @@ #define KEX_CURVE25519_SHA256_OLD "curve25519-sha256@libssh.org" #define COMP_NONE 0 +/* pre-auth compression (COMP_ZLIB) is only supported in the client */ #define COMP_ZLIB 1 #define COMP_DELAYED 2 diff --git a/monitor_wrap.c b/monitor_wrap.c index e970da2e3..f291ac085 100644 --- a/monitor_wrap.c +++ b/monitor_wrap.c @@ -1,4 +1,4 @@ -/* $OpenBSD: monitor_wrap.c,v 1.104 2018/07/10 09:13:30 djm Exp $ */ +/* $OpenBSD: monitor_wrap.c,v 1.105 2018/07/10 09:36:58 sf Exp $ */ /* * Copyright 2002 Niels Provos * Copyright 2002 Markus Friedl @@ -84,8 +84,6 @@ #include "ssherr.h" /* Imports */ -extern z_stream incoming_stream; -extern z_stream outgoing_stream; extern struct monitor *pmonitor; extern struct sshbuf *loginmsg; extern ServerOptions options; -- cgit v1.2.3 From 5467fbcb09528ecdcb914f4f2452216c24796790 Mon Sep 17 00:00:00 2001 From: "markus@openbsd.org" Date: Wed, 11 Jul 2018 18:53:29 +0000 Subject: upstream: remove legacy key emulation layer; ok djm@ OpenBSD-Commit-ID: 2b1f9619259e222bbd4fe9a8d3a0973eafb9dd8d --- .depend | 65 +++++++------ Makefile.in | 2 +- auth2.c | 4 +- channels.c | 4 +- clientloop.c | 4 +- kex.h | 3 +- key.c | 236 ---------------------------------------------- key.h | 69 -------------- loginrec.c | 2 +- monitor.c | 15 +-- monitor_wrap.c | 17 ++-- monitor_wrap.h | 6 +- mux.c | 4 +- openbsd-compat/port-aix.c | 2 +- platform.c | 2 +- servconf.c | 4 +- serverloop.c | 4 +- session.c | 4 +- ssh.c | 145 +++++++++++++++------------- sshconnect.c | 13 ++- sshconnect2.c | 12 +-- sshd.c | 69 ++++++++------ 22 files changed, 197 insertions(+), 489 deletions(-) delete mode 100644 key.c delete mode 100644 key.h (limited to 'kex.h') diff --git a/.depend b/.depend index 02ec8027b..1de442236 100644 --- a/.depend +++ b/.depend @@ -25,23 +25,23 @@ auth2-none.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-co auth2-passwd.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h ssherr.h log.h sshkey.h hostfile.h auth.h auth-pam.h audit.h loginrec.h monitor_wrap.h misc.h servconf.h auth2-pubkey.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h ssh.h ssh2.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h sshbuf.h log.h misc.h servconf.h compat.h sshkey.h hostfile.h auth.h auth-pam.h audit.h loginrec.h pathnames.h uidswap.h auth2-pubkey.o: auth-options.h canohost.h monitor_wrap.h authfile.h match.h ssherr.h channels.h session.h -auth2.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h atomicio.h xmalloc.h ssh2.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h log.h sshbuf.h misc.h servconf.h compat.h key.h sshkey.h hostfile.h auth.h auth-pam.h audit.h loginrec.h pathnames.h ssherr.h +auth2.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h atomicio.h xmalloc.h ssh2.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h log.h sshbuf.h misc.h servconf.h compat.h sshkey.h hostfile.h auth.h auth-pam.h audit.h loginrec.h pathnames.h ssherr.h auth2.o: monitor_wrap.h digest.h authfd.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h ssh.h sshbuf.h sshkey.h authfd.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h compat.h log.h atomicio.h misc.h ssherr.h authfile.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h ssh.h log.h authfile.h misc.h atomicio.h sshkey.h sshbuf.h ssherr.h krl.h bitmap.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h bitmap.h canohost.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h log.h canohost.h misc.h chacha.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h chacha.h -channels.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h ssh.h ssh2.h ssherr.h sshbuf.h packet.h dispatch.h opacket.h log.h misc.h channels.h compat.h canohost.h key.h sshkey.h authfd.h pathnames.h match.h +channels.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h ssh.h ssh2.h ssherr.h sshbuf.h packet.h dispatch.h opacket.h log.h misc.h channels.h compat.h canohost.h sshkey.h authfd.h pathnames.h match.h cipher-aes.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/openssl-compat.h cipher-aesctr.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h cipher-aesctr.h rijndael.h cipher-chachapoly.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h log.h sshbuf.h ssherr.h cipher-chachapoly.h chacha.h poly1305.h cipher-ctr.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h cipher.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h misc.h sshbuf.h ssherr.h digest.h openbsd-compat/openssl-compat.h cleanup.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h log.h -clientloop.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h ssh.h ssh2.h packet.h dispatch.h opacket.h sshbuf.h compat.h channels.h key.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h kex.h mac.h +clientloop.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h ssh.h ssh2.h packet.h dispatch.h opacket.h sshbuf.h compat.h channels.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h kex.h mac.h clientloop.o: myproposal.h log.h misc.h readconf.h clientloop.h sshconnect.h authfd.h atomicio.h sshpty.h match.h msg.h ssherr.h hostfile.h -compat.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h compat.h log.h match.h kex.h mac.h key.h sshkey.h +compat.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h compat.h log.h match.h kex.h mac.h crc32.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h crc32.h dh.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h digest-libc.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ssherr.h sshbuf.h digest.h @@ -60,11 +60,11 @@ gss-serv.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-comp hash.o: crypto_api.h includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h digest.h log.h ssherr.h hmac.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h sshbuf.h digest.h hmac.h hostfile.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h match.h sshkey.h hostfile.h log.h misc.h ssherr.h digest.h hmac.h -kex.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ssh2.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h compat.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h sshkey.h kex.h mac.h key.h log.h match.h misc.h monitor.h ssherr.h -kex.o: sshbuf.h digest.h -kexc25519.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h sshbuf.h ssh2.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h kex.h mac.h key.h log.h digest.h ssherr.h -kexc25519c.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h kex.h mac.h key.h log.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h ssh2.h sshbuf.h digest.h ssherr.h -kexc25519s.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h digest.h kex.h mac.h key.h log.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h ssh2.h sshbuf.h ssherr.h +kex.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ssh2.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h compat.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h sshkey.h kex.h mac.h log.h match.h misc.h monitor.h ssherr.h sshbuf.h +kex.o: digest.h +kexc25519.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h sshbuf.h ssh2.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h kex.h mac.h log.h digest.h ssherr.h +kexc25519c.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h kex.h mac.h log.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h ssh2.h sshbuf.h digest.h ssherr.h +kexc25519s.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h digest.h kex.h mac.h log.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h ssh2.h sshbuf.h ssherr.h kexdh.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h kexdhc.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h kexdhs.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h @@ -74,35 +74,34 @@ kexecdhs.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-comp kexgex.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h kexgexc.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h kexgexs.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h -key.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h key.h sshkey.h compat.h ssherr.h log.h authfile.h krl.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ./openbsd-compat/sys-tree.h openbsd-compat/sys-queue.h sshbuf.h ssherr.h sshkey.h authfile.h misc.h log.h digest.h bitmap.h krl.h log.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h log.h -loginrec.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h key.h sshkey.h hostfile.h ssh.h loginrec.h log.h atomicio.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h canohost.h auth.h auth-pam.h audit.h sshbuf.h ssherr.h +loginrec.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h hostfile.h ssh.h loginrec.h log.h atomicio.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h canohost.h auth.h auth-pam.h audit.h sshbuf.h ssherr.h logintest.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h loginrec.h mac.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h digest.h hmac.h umac.h mac.h misc.h ssherr.h sshbuf.h openbsd-compat/openssl-compat.h match.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h match.h misc.h md5crypt.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h misc.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h misc.h log.h ssh.h sshbuf.h ssherr.h uidswap.h moduli.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h -monitor.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ./openbsd-compat/sys-tree.h openbsd-compat/sys-queue.h atomicio.h xmalloc.h ssh.h key.h sshkey.h sshbuf.h hostfile.h auth.h auth-pam.h audit.h loginrec.h cipher.h cipher-chachapoly.h chacha.h poly1305.h -monitor.o: cipher-aesctr.h rijndael.h kex.h mac.h dh.h packet.h dispatch.h opacket.h auth-options.h sshpty.h channels.h session.h sshlogin.h canohost.h log.h misc.h servconf.h monitor.h monitor_wrap.h monitor_fdpass.h compat.h ssh2.h authfd.h match.h ssherr.h +monitor.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ./openbsd-compat/sys-tree.h openbsd-compat/sys-queue.h atomicio.h xmalloc.h ssh.h sshkey.h sshbuf.h hostfile.h auth.h auth-pam.h audit.h loginrec.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h +monitor.o: rijndael.h kex.h mac.h dh.h packet.h dispatch.h opacket.h auth-options.h sshpty.h channels.h session.h sshlogin.h canohost.h log.h misc.h servconf.h monitor.h monitor_wrap.h monitor_fdpass.h compat.h ssh2.h authfd.h match.h ssherr.h monitor_fdpass.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h log.h monitor_fdpass.h -monitor_wrap.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h ssh.h sshbuf.h key.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h kex.h mac.h hostfile.h auth.h auth-pam.h audit.h loginrec.h +monitor_wrap.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h ssh.h sshbuf.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h kex.h mac.h hostfile.h auth.h auth-pam.h audit.h loginrec.h monitor_wrap.o: auth-options.h packet.h dispatch.h opacket.h log.h monitor.h monitor_wrap.h atomicio.h monitor_fdpass.h misc.h channels.h session.h servconf.h ssherr.h msg.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h sshbuf.h ssherr.h log.h atomicio.h msg.h misc.h -mux.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h log.h ssh.h ssh2.h pathnames.h misc.h match.h sshbuf.h channels.h msg.h packet.h dispatch.h opacket.h monitor_fdpass.h sshpty.h key.h sshkey.h readconf.h clientloop.h ssherr.h +mux.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h log.h ssh.h ssh2.h pathnames.h misc.h match.h sshbuf.h channels.h msg.h packet.h dispatch.h opacket.h monitor_fdpass.h sshpty.h sshkey.h readconf.h clientloop.h ssherr.h nchan.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h ssh2.h sshbuf.h ssherr.h packet.h dispatch.h opacket.h channels.h compat.h log.h opacket.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ssherr.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h log.h -packet.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h crc32.h compat.h ssh2.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h sshkey.h kex.h mac.h key.h digest.h log.h canohost.h misc.h channels.h ssh.h +packet.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h crc32.h compat.h ssh2.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h sshkey.h kex.h mac.h digest.h log.h canohost.h misc.h channels.h ssh.h packet.o: packet.h dispatch.h opacket.h ssherr.h sshbuf.h platform-misc.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h platform-pledge.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h platform-tracing.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h log.h -platform.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h log.h misc.h servconf.h key.h sshkey.h hostfile.h auth.h auth-pam.h audit.h loginrec.h +platform.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h log.h misc.h servconf.h hostfile.h auth.h auth-pam.h audit.h loginrec.h poly1305.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h poly1305.h progressmeter.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h progressmeter.h atomicio.h misc.h -readconf.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/glob.h xmalloc.h ssh.h compat.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h pathnames.h log.h sshkey.h misc.h readconf.h match.h kex.h mac.h key.h uidswap.h -readconf.o: myproposal.h digest.h +readconf.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/glob.h xmalloc.h ssh.h compat.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h pathnames.h log.h sshkey.h misc.h readconf.h match.h kex.h mac.h uidswap.h myproposal.h +readconf.o: digest.h readpass.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h misc.h pathnames.h log.h ssh.h uidswap.h rijndael.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h rijndael.h sandbox-capsicum.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h @@ -115,11 +114,11 @@ sandbox-solaris.o: includes.h config.h defines.h platform.h openbsd-compat/openb sandbox-systrace.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h sc25519.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h sc25519.h crypto_api.h scp.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h ssh.h atomicio.h pathnames.h log.h misc.h progressmeter.h utf8.h -servconf.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h ssh.h log.h sshbuf.h misc.h servconf.h compat.h pathnames.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h key.h sshkey.h kex.h mac.h match.h -servconf.o: channels.h groupaccess.h canohost.h packet.h dispatch.h opacket.h ssherr.h hostfile.h auth.h auth-pam.h audit.h loginrec.h myproposal.h digest.h -serverloop.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h packet.h dispatch.h opacket.h sshbuf.h log.h misc.h servconf.h canohost.h sshpty.h channels.h compat.h ssh2.h key.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h +servconf.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h ssh.h log.h sshbuf.h misc.h servconf.h compat.h pathnames.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h sshkey.h kex.h mac.h match.h channels.h +servconf.o: groupaccess.h canohost.h packet.h dispatch.h opacket.h ssherr.h hostfile.h auth.h auth-pam.h audit.h loginrec.h myproposal.h digest.h +serverloop.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h packet.h dispatch.h opacket.h sshbuf.h log.h misc.h servconf.h canohost.h sshpty.h channels.h compat.h ssh2.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h serverloop.o: cipher-aesctr.h rijndael.h kex.h mac.h hostfile.h auth.h auth-pam.h audit.h loginrec.h session.h auth-options.h serverloop.h ssherr.h -session.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h ssh.h ssh2.h sshpty.h packet.h dispatch.h opacket.h sshbuf.h ssherr.h match.h uidswap.h compat.h channels.h key.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h +session.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h ssh.h ssh2.h sshpty.h packet.h dispatch.h opacket.h sshbuf.h ssherr.h match.h uidswap.h compat.h channels.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h session.o: cipher-aesctr.h rijndael.h hostfile.h auth.h auth-pam.h audit.h loginrec.h auth-options.h authfd.h pathnames.h log.h misc.h servconf.h sshlogin.h serverloop.h canohost.h session.h kex.h mac.h monitor_wrap.h sftp.h atomicio.h sftp-client.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h ssherr.h sshbuf.h log.h atomicio.h progressmeter.h misc.h utf8.h sftp.h sftp-common.h sftp-client.h openbsd-compat/glob.h sftp-common.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h ssherr.h sshbuf.h log.h misc.h sftp.h sftp-common.h @@ -133,8 +132,8 @@ ssh-dss.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compa ssh-ecdsa.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ssh-ed25519.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h crypto_api.h log.h sshbuf.h sshkey.h ssherr.h ssh.h ssh-keygen.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h sshkey.h authfile.h uuencode.h sshbuf.h pathnames.h log.h misc.h match.h hostfile.h dns.h ssh.h ssh2.h ssherr.h ssh-pkcs11.h atomicio.h krl.h digest.h utf8.h authfd.h -ssh-keyscan.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h ssh.h sshbuf.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h kex.h mac.h key.h compat.h myproposal.h packet.h dispatch.h opacket.h -ssh-keyscan.o: log.h atomicio.h misc.h hostfile.h ssherr.h ssh_api.h ssh2.h dns.h +ssh-keyscan.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h ssh.h sshbuf.h sshkey.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h kex.h mac.h compat.h myproposal.h packet.h dispatch.h opacket.h log.h +ssh-keyscan.o: atomicio.h misc.h hostfile.h ssherr.h ssh_api.h ssh2.h dns.h ssh-keysign.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h log.h sshkey.h ssh.h ssh2.h misc.h sshbuf.h authfile.h msg.h canohost.h pathnames.h readconf.h uidswap.h ssherr.h ssh-pkcs11-client.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ssh-pkcs11-helper.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h sshbuf.h log.h misc.h sshkey.h authfd.h ssh-pkcs11.h ssherr.h @@ -142,19 +141,19 @@ ssh-pkcs11.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-co ssh-rsa.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ssh-xmss.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ssh.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/openssl-compat.h openbsd-compat/sys-queue.h xmalloc.h ssh.h ssh2.h canohost.h compat.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h digest.h packet.h dispatch.h opacket.h -ssh.o: sshbuf.h channels.h key.h sshkey.h authfd.h authfile.h pathnames.h clientloop.h log.h misc.h readconf.h sshconnect.h kex.h mac.h sshpty.h match.h msg.h uidswap.h version.h ssherr.h myproposal.h utf8.h -ssh_api.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ssh_api.h openbsd-compat/sys-queue.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h sshkey.h kex.h mac.h key.h ssh.h ssh2.h packet.h dispatch.h opacket.h compat.h log.h authfile.h -ssh_api.o: misc.h version.h myproposal.h ssherr.h sshbuf.h +ssh.o: sshbuf.h channels.h sshkey.h authfd.h authfile.h pathnames.h clientloop.h log.h misc.h readconf.h sshconnect.h kex.h mac.h sshpty.h match.h msg.h uidswap.h version.h ssherr.h myproposal.h utf8.h +ssh_api.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ssh_api.h openbsd-compat/sys-queue.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h sshkey.h kex.h mac.h ssh.h ssh2.h packet.h dispatch.h opacket.h compat.h log.h authfile.h misc.h +ssh_api.o: version.h myproposal.h ssherr.h sshbuf.h sshbuf-getput-basic.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ssherr.h sshbuf.h sshbuf-getput-crypto.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ssherr.h sshbuf.h sshbuf-misc.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ssherr.h sshbuf.h sshbuf.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ssherr.h sshbuf.h misc.h -sshconnect.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h key.h sshkey.h hostfile.h ssh.h sshbuf.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h uidswap.h compat.h sshconnect.h log.h misc.h readconf.h atomicio.h dns.h monitor_fdpass.h ssh2.h -sshconnect.o: version.h authfile.h ssherr.h authfd.h -sshconnect2.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h ssh.h ssh2.h sshbuf.h packet.h dispatch.h opacket.h compat.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h sshkey.h kex.h mac.h key.h -sshconnect2.o: myproposal.h sshconnect.h authfile.h dh.h authfd.h log.h misc.h readconf.h match.h canohost.h msg.h pathnames.h uidswap.h hostfile.h ssherr.h utf8.h +sshconnect.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h xmalloc.h hostfile.h ssh.h sshbuf.h packet.h openbsd-compat/sys-queue.h dispatch.h opacket.h uidswap.h compat.h sshkey.h sshconnect.h log.h misc.h readconf.h atomicio.h dns.h monitor_fdpass.h ssh2.h version.h +sshconnect.o: authfile.h ssherr.h authfd.h +sshconnect2.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h openbsd-compat/sys-queue.h xmalloc.h ssh.h ssh2.h sshbuf.h packet.h dispatch.h opacket.h compat.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h sshkey.h kex.h mac.h myproposal.h +sshconnect2.o: sshconnect.h authfile.h dh.h authfd.h log.h misc.h readconf.h match.h canohost.h msg.h pathnames.h uidswap.h hostfile.h ssherr.h utf8.h sshd.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h ./openbsd-compat/sys-tree.h openbsd-compat/sys-queue.h xmalloc.h ssh.h ssh2.h sshpty.h packet.h dispatch.h opacket.h log.h sshbuf.h misc.h match.h servconf.h uidswap.h compat.h cipher.h cipher-chachapoly.h chacha.h -sshd.o: poly1305.h cipher-aesctr.h rijndael.h digest.h key.h sshkey.h kex.h mac.h myproposal.h authfile.h pathnames.h atomicio.h canohost.h hostfile.h auth.h auth-pam.h audit.h loginrec.h authfd.h msg.h channels.h session.h monitor.h monitor_wrap.h ssh-sandbox.h auth-options.h version.h ssherr.h +sshd.o: poly1305.h cipher-aesctr.h rijndael.h digest.h sshkey.h kex.h mac.h myproposal.h authfile.h pathnames.h atomicio.h canohost.h hostfile.h auth.h auth-pam.h audit.h loginrec.h authfd.h msg.h channels.h session.h monitor.h monitor_wrap.h ssh-sandbox.h auth-options.h version.h ssherr.h ssherr.o: ssherr.h sshkey-xmss.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h sshkey.o: includes.h config.h defines.h platform.h openbsd-compat/openbsd-compat.h openbsd-compat/base64.h openbsd-compat/sigact.h openbsd-compat/readpassphrase.h openbsd-compat/vis.h openbsd-compat/getrrsetbyname.h openbsd-compat/sha1.h openbsd-compat/sha2.h openbsd-compat/rmd160.h openbsd-compat/md5.h openbsd-compat/blf.h openbsd-compat/getopt.h openbsd-compat/bsd-misc.h openbsd-compat/bsd-setres_id.h openbsd-compat/bsd-signal.h openbsd-compat/bsd-statvfs.h openbsd-compat/bsd-waitpid.h openbsd-compat/bsd-poll.h openbsd-compat/fake-rfc2553.h openbsd-compat/bsd-cygwin_util.h openbsd-compat/port-aix.h openbsd-compat/port-irix.h openbsd-compat/port-linux.h openbsd-compat/port-solaris.h openbsd-compat/port-net.h openbsd-compat/port-uw.h openbsd-compat/bsd-nextstep.h entropy.h crypto_api.h ssh2.h ssherr.h misc.h sshbuf.h cipher.h cipher-chachapoly.h chacha.h poly1305.h cipher-aesctr.h rijndael.h digest.h sshkey.h sshkey-xmss.h match.h xmss_fast.h diff --git a/Makefile.in b/Makefile.in index 277418cfe..5548ab7b9 100644 --- a/Makefile.in +++ b/Makefile.in @@ -90,7 +90,7 @@ LIBSSH_OBJS=${LIBOPENSSH_OBJS} \ compat.o crc32.o fatal.o hostfile.o \ log.o match.o moduli.o nchan.o packet.o opacket.o \ readpass.o ttymodes.o xmalloc.o addrmatch.o \ - atomicio.o key.o dispatch.o mac.o uidswap.o uuencode.o misc.o utf8.o \ + atomicio.o dispatch.o mac.o uidswap.o uuencode.o misc.o utf8.o \ monitor_fdpass.o rijndael.o ssh-dss.o ssh-ecdsa.o ssh-rsa.o dh.o \ msg.o progressmeter.o dns.o entropy.o gss-genr.o umac.o umac128.o \ ssh-pkcs11.o smult_curve25519_ref.o \ diff --git a/auth2.c b/auth2.c index a6e82f7a3..ab8795895 100644 --- a/auth2.c +++ b/auth2.c @@ -1,4 +1,4 @@ -/* $OpenBSD: auth2.c,v 1.148 2018/07/09 21:35:50 markus Exp $ */ +/* $OpenBSD: auth2.c,v 1.149 2018/07/11 18:53:29 markus Exp $ */ /* * Copyright (c) 2000 Markus Friedl. All rights reserved. * @@ -45,7 +45,7 @@ #include "misc.h" #include "servconf.h" #include "compat.h" -#include "key.h" +#include "sshkey.h" #include "hostfile.h" #include "auth.h" #include "dispatch.h" diff --git a/channels.c b/channels.c index 83778b465..1de63c216 100644 --- a/channels.c +++ b/channels.c @@ -1,4 +1,4 @@ -/* $OpenBSD: channels.c,v 1.382 2018/06/25 22:28:33 djm Exp $ */ +/* $OpenBSD: channels.c,v 1.383 2018/07/11 18:53:29 markus Exp $ */ /* * Author: Tatu Ylonen * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland @@ -79,7 +79,7 @@ #include "channels.h" #include "compat.h" #include "canohost.h" -#include "key.h" +#include "sshkey.h" #include "authfd.h" #include "pathnames.h" #include "match.h" diff --git a/clientloop.c b/clientloop.c index 7262a856f..ad35cb7ba 100644 --- a/clientloop.c +++ b/clientloop.c @@ -1,4 +1,4 @@ -/* $OpenBSD: clientloop.c,v 1.316 2018/07/09 21:20:26 markus Exp $ */ +/* $OpenBSD: clientloop.c,v 1.317 2018/07/11 18:53:29 markus Exp $ */ /* * Author: Tatu Ylonen * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland @@ -95,7 +95,7 @@ #include "compat.h" #include "channels.h" #include "dispatch.h" -#include "key.h" +#include "sshkey.h" #include "cipher.h" #include "kex.h" #include "myproposal.h" diff --git a/kex.h b/kex.h index d36e4d150..56a85fd1e 100644 --- a/kex.h +++ b/kex.h @@ -1,4 +1,4 @@ -/* $OpenBSD: kex.h,v 1.90 2018/07/10 09:36:58 sf Exp $ */ +/* $OpenBSD: kex.h,v 1.91 2018/07/11 18:53:29 markus Exp $ */ /* * Copyright (c) 2000, 2001 Markus Friedl. All rights reserved. @@ -27,7 +27,6 @@ #define KEX_H #include "mac.h" -#include "key.h" /* XXX for typedef */ #ifdef WITH_LEAKMALLOC #include "leakmalloc.h" diff --git a/key.c b/key.c deleted file mode 100644 index a05fdd3c0..000000000 --- a/key.c +++ /dev/null @@ -1,236 +0,0 @@ -/* $OpenBSD: key.c,v 1.132 2017/12/18 02:25:15 djm Exp $ */ -/* - * placed in the public domain - */ - -#include "includes.h" - -#include -#include -#include -#include -#include - -#define SSH_KEY_NO_DEFINE -#include "key.h" - -#include "compat.h" -#include "sshkey.h" -#include "ssherr.h" -#include "log.h" -#include "authfile.h" - -static void -fatal_on_fatal_errors(int r, const char *func, int extra_fatal) -{ - if (r == SSH_ERR_INTERNAL_ERROR || - r == SSH_ERR_ALLOC_FAIL || - (extra_fatal != 0 && r == extra_fatal)) - fatal("%s: %s", func, ssh_err(r)); -} - -Key * -key_from_blob(const u_char *blob, u_int blen) -{ - int r; - Key *ret = NULL; - - if ((r = sshkey_from_blob(blob, blen, &ret)) != 0) { - fatal_on_fatal_errors(r, __func__, 0); - error("%s: %s", __func__, ssh_err(r)); - return NULL; - } - return ret; -} - -int -key_to_blob(const Key *key, u_char **blobp, u_int *lenp) -{ - u_char *blob; - size_t blen; - int r; - - if (blobp != NULL) - *blobp = NULL; - if (lenp != NULL) - *lenp = 0; - if ((r = sshkey_to_blob(key, &blob, &blen)) != 0) { - fatal_on_fatal_errors(r, __func__, 0); - error("%s: %s", __func__, ssh_err(r)); - return 0; - } - if (blen > INT_MAX) - fatal("%s: giant len %zu", __func__, blen); - if (blobp != NULL) - *blobp = blob; - if (lenp != NULL) - *lenp = blen; - return blen; -} - -int -key_sign(const Key *key, u_char **sigp, u_int *lenp, - const u_char *data, u_int datalen, const char *alg) -{ - int r; - u_char *sig; - size_t siglen; - - if (sigp != NULL) - *sigp = NULL; - if (lenp != NULL) - *lenp = 0; - if ((r = sshkey_sign(key, &sig, &siglen, - data, datalen, alg, datafellows)) != 0) { - fatal_on_fatal_errors(r, __func__, 0); - error("%s: %s", __func__, ssh_err(r)); - return -1; - } - if (siglen > INT_MAX) - fatal("%s: giant len %zu", __func__, siglen); - if (sigp != NULL) - *sigp = sig; - if (lenp != NULL) - *lenp = siglen; - return 0; -} - -Key * -key_demote(const Key *k) -{ - int r; - Key *ret = NULL; - - if ((r = sshkey_demote(k, &ret)) != 0) - fatal("%s: %s", __func__, ssh_err(r)); - return ret; -} - -int -key_drop_cert(Key *k) -{ - int r; - - if ((r = sshkey_drop_cert(k)) != 0) { - fatal_on_fatal_errors(r, __func__, 0); - error("%s: %s", __func__, ssh_err(r)); - return -1; - } - return 0; -} - -int -key_cert_check_authority(const Key *k, int want_host, int require_principal, - const char *name, const char **reason) -{ - int r; - - if ((r = sshkey_cert_check_authority(k, want_host, require_principal, - name, reason)) != 0) { - fatal_on_fatal_errors(r, __func__, 0); - error("%s: %s", __func__, ssh_err(r)); - return -1; - } - return 0; -} - -/* authfile.c */ - -Key * -key_load_cert(const char *filename) -{ - int r; - Key *ret = NULL; - - if ((r = sshkey_load_cert(filename, &ret)) != 0) { - fatal_on_fatal_errors(r, __func__, SSH_ERR_LIBCRYPTO_ERROR); - /* Old authfile.c ignored all file errors. */ - if (r == SSH_ERR_SYSTEM_ERROR) - debug("%s: %s", __func__, ssh_err(r)); - else - error("%s: %s", __func__, ssh_err(r)); - return NULL; - } - return ret; - -} - -Key * -key_load_public(const char *filename, char **commentp) -{ - int r; - Key *ret = NULL; - - if ((r = sshkey_load_public(filename, &ret, commentp)) != 0) { - fatal_on_fatal_errors(r, __func__, SSH_ERR_LIBCRYPTO_ERROR); - /* Old authfile.c ignored all file errors. */ - if (r == SSH_ERR_SYSTEM_ERROR) - debug("%s: %s", __func__, ssh_err(r)); - else - error("%s: %s", __func__, ssh_err(r)); - return NULL; - } - return ret; -} - -Key * -key_load_private(const char *path, const char *passphrase, - char **commentp) -{ - int r; - Key *ret = NULL; - - if ((r = sshkey_load_private(path, passphrase, &ret, commentp)) != 0) { - fatal_on_fatal_errors(r, __func__, SSH_ERR_LIBCRYPTO_ERROR); - /* Old authfile.c ignored all file errors. */ - if (r == SSH_ERR_SYSTEM_ERROR || - r == SSH_ERR_KEY_WRONG_PASSPHRASE) - debug("%s: %s", __func__, ssh_err(r)); - else - error("%s: %s", __func__, ssh_err(r)); - return NULL; - } - return ret; -} - -Key * -key_load_private_cert(int type, const char *filename, const char *passphrase, - int *perm_ok) -{ - int r; - Key *ret = NULL; - - if ((r = sshkey_load_private_cert(type, filename, passphrase, - &ret, perm_ok)) != 0) { - fatal_on_fatal_errors(r, __func__, SSH_ERR_LIBCRYPTO_ERROR); - /* Old authfile.c ignored all file errors. */ - if (r == SSH_ERR_SYSTEM_ERROR || - r == SSH_ERR_KEY_WRONG_PASSPHRASE) - debug("%s: %s", __func__, ssh_err(r)); - else - error("%s: %s", __func__, ssh_err(r)); - return NULL; - } - return ret; -} - -Key * -key_load_private_type(int type, const char *filename, const char *passphrase, - char **commentp, int *perm_ok) -{ - int r; - Key *ret = NULL; - - if ((r = sshkey_load_private_type(type, filename, passphrase, - &ret, commentp, perm_ok)) != 0) { - fatal_on_fatal_errors(r, __func__, SSH_ERR_LIBCRYPTO_ERROR); - /* Old authfile.c ignored all file errors. */ - if (r == SSH_ERR_SYSTEM_ERROR || - (r == SSH_ERR_KEY_WRONG_PASSPHRASE)) - debug("%s: %s", __func__, ssh_err(r)); - else - error("%s: %s", __func__, ssh_err(r)); - return NULL; - } - return ret; -} diff --git a/key.h b/key.h deleted file mode 100644 index fd59cbf54..000000000 --- a/key.h +++ /dev/null @@ -1,69 +0,0 @@ -/* $OpenBSD: key.h,v 1.52 2017/12/18 02:25:15 djm Exp $ */ - -/* - * Copyright (c) 2000, 2001 Markus Friedl. All rights reserved. - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions - * are met: - * 1. Redistributions of source code must retain the above copyright - * notice, this list of conditions and the following disclaimer. - * 2. Redistributions in binary form must reproduce the above copyright - * notice, this list of conditions and the following disclaimer in the - * documentation and/or other materials provided with the distribution. - * - * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR - * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES - * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. - * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, - * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT - * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, - * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY - * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT - * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF - * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. - */ -#ifndef KEY_H -#define KEY_H - -#include "sshkey.h" - -typedef struct sshkey Key; - -#define types sshkey_types -#define fp_type sshkey_fp_type -#define fp_rep sshkey_fp_rep - -#ifndef SSH_KEY_NO_DEFINE -#define key_free sshkey_free -#define key_equal_public sshkey_equal_public -#define key_equal sshkey_equal -#define key_type sshkey_type -#define key_ssh_name sshkey_ssh_name -#define key_ssh_name_plain sshkey_ssh_name_plain -#define key_type_from_name sshkey_type_from_name -#define key_is_cert sshkey_is_cert -#define key_type_plain sshkey_type_plain -#endif - -void key_free(Key *); -Key *key_demote(const Key *); - -int key_drop_cert(Key *); -int key_cert_check_authority(const Key *, int, int, const char *, - const char **); - -Key *key_from_blob(const u_char *, u_int); -int key_to_blob(const Key *, u_char **, u_int *); - -int key_sign(const Key *, u_char **, u_int *, const u_char *, u_int, - const char *); - -/* authfile.c */ -Key *key_load_cert(const char *); -Key *key_load_public(const char *, char **); -Key *key_load_private(const char *, const char *, char **); -Key *key_load_private_cert(int, const char *, const char *, int *); -Key *key_load_private_type(int, const char *, const char *, char **, int *); - -#endif diff --git a/loginrec.c b/loginrec.c index 8e9560f3e..9a427dec4 100644 --- a/loginrec.c +++ b/loginrec.c @@ -168,7 +168,7 @@ #include #include "xmalloc.h" -#include "key.h" +#include "sshkey.h" #include "hostfile.h" #include "ssh.h" #include "loginrec.h" diff --git a/monitor.c b/monitor.c index 56d136c29..f5d1b8a05 100644 --- a/monitor.c +++ b/monitor.c @@ -1,4 +1,4 @@ -/* $OpenBSD: monitor.c,v 1.184 2018/07/10 09:13:30 djm Exp $ */ +/* $OpenBSD: monitor.c,v 1.185 2018/07/11 18:53:29 markus Exp $ */ /* * Copyright 2002 Niels Provos * Copyright 2002 Markus Friedl @@ -68,7 +68,7 @@ #include "atomicio.h" #include "xmalloc.h" #include "ssh.h" -#include "key.h" +#include "sshkey.h" #include "sshbuf.h" #include "hostfile.h" #include "auth.h" @@ -630,14 +630,15 @@ mm_answer_sign(int sock, struct sshbuf *m) char *alg = NULL; size_t datlen, siglen, alglen; int r, is_proof = 0; - u_int keyid; + u_int keyid, compat; const char proof_req[] = "hostkeys-prove-00@openssh.com"; debug3("%s", __func__); if ((r = sshbuf_get_u32(m, &keyid)) != 0 || (r = sshbuf_get_string(m, &p, &datlen)) != 0 || - (r = sshbuf_get_cstring(m, &alg, &alglen)) != 0) + (r = sshbuf_get_cstring(m, &alg, &alglen)) != 0 || + (r = sshbuf_get_u32(m, &compat)) != 0) fatal("%s: buffer error: %s", __func__, ssh_err(r)); if (keyid > INT_MAX) fatal("%s: invalid key ID", __func__); @@ -687,13 +688,13 @@ mm_answer_sign(int sock, struct sshbuf *m) if ((key = get_hostkey_by_index(keyid)) != NULL) { if ((r = sshkey_sign(key, &signature, &siglen, p, datlen, alg, - datafellows)) != 0) + compat)) != 0) fatal("%s: sshkey_sign failed: %s", __func__, ssh_err(r)); } else if ((key = get_hostkey_public_by_index(keyid, ssh)) != NULL && auth_sock > 0) { if ((r = ssh_agent_sign(auth_sock, key, &signature, &siglen, - p, datlen, alg, datafellows)) != 0) { + p, datlen, alg, compat)) != 0) { fatal("%s: ssh_agent_sign failed: %s", __func__, ssh_err(r)); } @@ -1208,7 +1209,7 @@ mm_answer_keyallowed(int sock, struct sshbuf *m) if (key != NULL && authctxt->valid) { /* These should not make it past the privsep child */ - if (key_type_plain(key->type) == KEY_RSA && + if (sshkey_type_plain(key->type) == KEY_RSA && (datafellows & SSH_BUG_RSASIGMD5) != 0) fatal("%s: passed a SSH_BUG_RSASIGMD5 key", __func__); diff --git a/monitor_wrap.c b/monitor_wrap.c index ad4e8dce7..55b892b90 100644 --- a/monitor_wrap.c +++ b/monitor_wrap.c @@ -1,4 +1,4 @@ -/* $OpenBSD: monitor_wrap.c,v 1.105 2018/07/10 09:36:58 sf Exp $ */ +/* $OpenBSD: monitor_wrap.c,v 1.106 2018/07/11 18:53:29 markus Exp $ */ /* * Copyright 2002 Niels Provos * Copyright 2002 Markus Friedl @@ -51,7 +51,7 @@ #include "dh.h" #endif #include "sshbuf.h" -#include "key.h" +#include "sshkey.h" #include "cipher.h" #include "kex.h" #include "hostfile.h" @@ -225,12 +225,11 @@ mm_choose_dh(int min, int nbits, int max) #endif int -mm_key_sign(struct sshkey *key, u_char **sigp, u_int *lenp, - const u_char *data, u_int datalen, const char *hostkey_alg) +mm_sshkey_sign(struct sshkey *key, u_char **sigp, size_t *lenp, + const u_char *data, size_t datalen, const char *hostkey_alg, u_int compat) { struct kex *kex = *pmonitor->m_pkex; struct sshbuf *m; - size_t xxxlen; u_int ndx = kex->host_key_index(key, 0, active_state); int r; @@ -240,18 +239,16 @@ mm_key_sign(struct sshkey *key, u_char **sigp, u_int *lenp, fatal("%s: sshbuf_new failed", __func__); if ((r = sshbuf_put_u32(m, ndx)) != 0 || (r = sshbuf_put_string(m, data, datalen)) != 0 || - (r = sshbuf_put_cstring(m, hostkey_alg)) != 0) + (r = sshbuf_put_cstring(m, hostkey_alg)) != 0 || + (r = sshbuf_put_u32(m, compat)) != 0) fatal("%s: buffer error: %s", __func__, ssh_err(r)); mm_request_send(pmonitor->m_recvfd, MONITOR_REQ_SIGN, m); debug3("%s: waiting for MONITOR_ANS_SIGN", __func__); mm_request_receive_expect(pmonitor->m_recvfd, MONITOR_ANS_SIGN, m); - if ((r = sshbuf_get_string(m, sigp, &xxxlen)) != 0) + if ((r = sshbuf_get_string(m, sigp, lenp)) != 0) fatal("%s: buffer error: %s", __func__, ssh_err(r)); - if (xxxlen > 0xffffffff) - fatal("%s: bad length %zu", __func__, xxxlen); - *lenp = xxxlen; /* XXX fix API: size_t vs u_int */ sshbuf_free(m); return (0); diff --git a/monitor_wrap.h b/monitor_wrap.h index 762332704..a3ac17d1d 100644 --- a/monitor_wrap.h +++ b/monitor_wrap.h @@ -1,4 +1,4 @@ -/* $OpenBSD: monitor_wrap.h,v 1.37 2018/03/03 03:15:51 djm Exp $ */ +/* $OpenBSD: monitor_wrap.h,v 1.38 2018/07/11 18:53:29 markus Exp $ */ /* * Copyright 2002 Niels Provos @@ -41,8 +41,8 @@ struct sshauthopt; void mm_log_handler(LogLevel, const char *, void *); int mm_is_monitor(void); DH *mm_choose_dh(int, int, int); -int mm_key_sign(struct sshkey *, u_char **, u_int *, const u_char *, u_int, - const char *); +int mm_sshkey_sign(struct sshkey *, u_char **, size_t *, const u_char *, size_t, + const char *, u_int compat); void mm_inform_authserv(char *, char *); struct passwd *mm_getpwnamallow(const char *); char *mm_auth2_read_banner(void); diff --git a/mux.c b/mux.c index 95d74b62e..6394e3e18 100644 --- a/mux.c +++ b/mux.c @@ -1,4 +1,4 @@ -/* $OpenBSD: mux.c,v 1.73 2018/07/09 21:18:10 markus Exp $ */ +/* $OpenBSD: mux.c,v 1.74 2018/07/11 18:53:29 markus Exp $ */ /* * Copyright (c) 2002-2008 Damien Miller * @@ -76,7 +76,7 @@ #include "packet.h" #include "monitor_fdpass.h" #include "sshpty.h" -#include "key.h" +#include "sshkey.h" #include "readconf.h" #include "clientloop.h" #include "ssherr.h" diff --git a/openbsd-compat/port-aix.c b/openbsd-compat/port-aix.c index f3a84aec8..eabb52493 100644 --- a/openbsd-compat/port-aix.c +++ b/openbsd-compat/port-aix.c @@ -29,7 +29,7 @@ #include "xmalloc.h" #include "sshbuf.h" #include "ssherr.h" -#include "key.h" +#include "sshkey.h" #include "hostfile.h" #include "auth.h" #include "ssh.h" diff --git a/platform.c b/platform.c index 4a156ab2f..41acc9370 100644 --- a/platform.c +++ b/platform.c @@ -22,7 +22,7 @@ #include "log.h" #include "misc.h" #include "servconf.h" -#include "key.h" +#include "sshkey.h" #include "hostfile.h" #include "auth.h" #include "auth-pam.h" diff --git a/servconf.c b/servconf.c index 7ca67ce6b..aafefde93 100644 --- a/servconf.c +++ b/servconf.c @@ -1,5 +1,5 @@ -/* $OpenBSD: servconf.c,v 1.338 2018/07/09 21:29:36 markus Exp $ */ +/* $OpenBSD: servconf.c,v 1.339 2018/07/11 18:53:29 markus Exp $ */ /* * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland * All rights reserved @@ -51,7 +51,7 @@ #include "compat.h" #include "pathnames.h" #include "cipher.h" -#include "key.h" +#include "sshkey.h" #include "kex.h" #include "mac.h" #include "match.h" diff --git a/serverloop.c b/serverloop.c index f1b676f82..cf18e387e 100644 --- a/serverloop.c +++ b/serverloop.c @@ -1,4 +1,4 @@ -/* $OpenBSD: serverloop.c,v 1.207 2018/07/09 21:29:36 markus Exp $ */ +/* $OpenBSD: serverloop.c,v 1.208 2018/07/11 18:53:29 markus Exp $ */ /* * Author: Tatu Ylonen * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland @@ -67,7 +67,7 @@ #include "channels.h" #include "compat.h" #include "ssh2.h" -#include "key.h" +#include "sshkey.h" #include "cipher.h" #include "kex.h" #include "hostfile.h" diff --git a/session.c b/session.c index 4c6e964a1..2906e7b8b 100644 --- a/session.c +++ b/session.c @@ -1,4 +1,4 @@ -/* $OpenBSD: session.c,v 1.303 2018/07/09 21:26:02 markus Exp $ */ +/* $OpenBSD: session.c,v 1.304 2018/07/11 18:53:29 markus Exp $ */ /* * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland * All rights reserved @@ -75,7 +75,7 @@ #include "uidswap.h" #include "compat.h" #include "channels.h" -#include "key.h" +#include "sshkey.h" #include "cipher.h" #ifdef GSSAPI #include "ssh-gss.h" diff --git a/ssh.c b/ssh.c index 914167789..da6b7ba91 100644 --- a/ssh.c +++ b/ssh.c @@ -1,4 +1,4 @@ -/* $OpenBSD: ssh.c,v 1.482 2018/07/09 21:03:30 markus Exp $ */ +/* $OpenBSD: ssh.c,v 1.483 2018/07/11 18:53:29 markus Exp $ */ /* * Author: Tatu Ylonen * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland @@ -89,7 +89,7 @@ #include "packet.h" #include "sshbuf.h" #include "channels.h" -#include "key.h" +#include "sshkey.h" #include "authfd.h" #include "authfile.h" #include "pathnames.h" @@ -503,6 +503,30 @@ resolve_canonicalize(char **hostp, int port) return NULL; } +/* + * Check the result of hostkey loading, ignoring some errors and + * fatal()ing for others. + */ +static void +check_load(int r, const char *path, const char *message) +{ + switch (r) { + case 0: + break; + case SSH_ERR_INTERNAL_ERROR: + case SSH_ERR_ALLOC_FAIL: + fatal("load %s \"%s\": %s", message, path, ssh_err(r)); + case SSH_ERR_SYSTEM_ERROR: + /* Ignore missing files */ + if (errno == ENOENT) + break; + /* FALLTHROUGH */ + default: + error("load %s \"%s\": %s", message, path, ssh_err(r)); + break; + } +} + /* * Read per-user configuration file. Ignore the system wide config * file if the user specifies a config file on the command line. @@ -1388,7 +1412,7 @@ main(int ac, char **av) /* * If we successfully made the connection, load the host private key - * in case we will need it later for combined rsa-rhosts + * in case we will need it later for hostbased * authentication. This must be done before releasing extra * privileges, because the file is only readable by root. * If we cannot access the private keys, load the public keys @@ -1400,35 +1424,32 @@ main(int ac, char **av) if (options.hostbased_authentication) { sensitive_data.nkeys = 11; sensitive_data.keys = xcalloc(sensitive_data.nkeys, - sizeof(struct sshkey)); /* XXX */ - for (i = 0; i < sensitive_data.nkeys; i++) - sensitive_data.keys[i] = NULL; + sizeof(struct sshkey)); + + /* XXX check errors? */ +#define L_KEY(t,p,o) \ + check_load(sshkey_load_private_type(t, p, "", \ + &(sensitive_data.keys[o]), NULL, NULL), p, "key") +#define L_KEYCERT(t,p,o) \ + check_load(sshkey_load_private_cert(t, p, "", \ + &(sensitive_data.keys[o]), NULL), p, "cert and key") +#define L_PUBKEY(p,o) \ + check_load(sshkey_load_public(p, &(sensitive_data.keys[o]), NULL), \ + p, "pubkey") +#define L_CERT(p,o) \ + check_load(sshkey_load_cert(p, &(sensitive_data.keys[o])), p, "cert") PRIV_START; -#ifdef OPENSSL_HAS_ECC - sensitive_data.keys[1] = key_load_private_cert(KEY_ECDSA, - _PATH_HOST_ECDSA_KEY_FILE, "", NULL); -#endif - sensitive_data.keys[2] = key_load_private_cert(KEY_ED25519, - _PATH_HOST_ED25519_KEY_FILE, "", NULL); - sensitive_data.keys[3] = key_load_private_cert(KEY_RSA, - _PATH_HOST_RSA_KEY_FILE, "", NULL); - sensitive_data.keys[4] = key_load_private_cert(KEY_DSA, - _PATH_HOST_DSA_KEY_FILE, "", NULL); -#ifdef OPENSSL_HAS_ECC - sensitive_data.keys[5] = key_load_private_type(KEY_ECDSA, - _PATH_HOST_ECDSA_KEY_FILE, "", NULL, NULL); -#endif - sensitive_data.keys[6] = key_load_private_type(KEY_ED25519, - _PATH_HOST_ED25519_KEY_FILE, "", NULL, NULL); - sensitive_data.keys[7] = key_load_private_type(KEY_RSA, - _PATH_HOST_RSA_KEY_FILE, "", NULL, NULL); - sensitive_data.keys[8] = key_load_private_type(KEY_DSA, - _PATH_HOST_DSA_KEY_FILE, "", NULL, NULL); - sensitive_data.keys[9] = key_load_private_cert(KEY_XMSS, - _PATH_HOST_XMSS_KEY_FILE, "", NULL); - sensitive_data.keys[10] = key_load_private_type(KEY_XMSS, - _PATH_HOST_XMSS_KEY_FILE, "", NULL, NULL); + L_KEYCERT(KEY_ECDSA, _PATH_HOST_ECDSA_KEY_FILE, 1); + L_KEYCERT(KEY_ED25519, _PATH_HOST_ED25519_KEY_FILE, 2); + L_KEYCERT(KEY_RSA, _PATH_HOST_RSA_KEY_FILE, 3); + L_KEYCERT(KEY_DSA, _PATH_HOST_DSA_KEY_FILE, 4); + L_KEY(KEY_ECDSA, _PATH_HOST_ECDSA_KEY_FILE, 5); + L_KEY(KEY_ED25519, _PATH_HOST_ED25519_KEY_FILE, 6); + L_KEY(KEY_RSA, _PATH_HOST_RSA_KEY_FILE, 7); + L_KEY(KEY_DSA, _PATH_HOST_DSA_KEY_FILE, 8); + L_KEYCERT(KEY_XMSS, _PATH_HOST_XMSS_KEY_FILE, 9); + L_KEY(KEY_XMSS, _PATH_HOST_XMSS_KEY_FILE, 10); PRIV_END; if (options.hostbased_authentication == 1 && @@ -1437,31 +1458,18 @@ main(int ac, char **av) sensitive_data.keys[6] == NULL && sensitive_data.keys[7] == NULL && sensitive_data.keys[8] == NULL && - sensitive_data.keys[9] == NULL) { -#ifdef OPENSSL_HAS_ECC - sensitive_data.keys[1] = key_load_cert( - _PATH_HOST_ECDSA_KEY_FILE); -#endif - sensitive_data.keys[2] = key_load_cert( - _PATH_HOST_ED25519_KEY_FILE); - sensitive_data.keys[3] = key_load_cert( - _PATH_HOST_RSA_KEY_FILE); - sensitive_data.keys[4] = key_load_cert( - _PATH_HOST_DSA_KEY_FILE); -#ifdef OPENSSL_HAS_ECC - sensitive_data.keys[5] = key_load_public( - _PATH_HOST_ECDSA_KEY_FILE, NULL); -#endif - sensitive_data.keys[6] = key_load_public( - _PATH_HOST_ED25519_KEY_FILE, NULL); - sensitive_data.keys[7] = key_load_public( - _PATH_HOST_RSA_KEY_FILE, NULL); - sensitive_data.keys[8] = key_load_public( - _PATH_HOST_DSA_KEY_FILE, NULL); - sensitive_data.keys[9] = key_load_cert( - _PATH_HOST_XMSS_KEY_FILE); - sensitive_data.keys[10] = key_load_public( - _PATH_HOST_XMSS_KEY_FILE, NULL); + sensitive_data.keys[9] == NULL && + sensitive_data.keys[10] == NULL) { + L_CERT(_PATH_HOST_ECDSA_KEY_FILE, 1); + L_CERT(_PATH_HOST_ED25519_KEY_FILE, 2); + L_CERT(_PATH_HOST_RSA_KEY_FILE, 3); + L_CERT(_PATH_HOST_DSA_KEY_FILE, 4); + L_PUBKEY(_PATH_HOST_ECDSA_KEY_FILE, 5); + L_PUBKEY(_PATH_HOST_ED25519_KEY_FILE, 6); + L_PUBKEY(_PATH_HOST_RSA_KEY_FILE, 7); + L_PUBKEY(_PATH_HOST_DSA_KEY_FILE, 8); + L_CERT(_PATH_HOST_XMSS_KEY_FILE, 9); + L_PUBKEY(_PATH_HOST_XMSS_KEY_FILE, 10); sensitive_data.external_keysign = 1; } } @@ -1546,7 +1554,7 @@ main(int ac, char **av) if (sensitive_data.keys[i] != NULL) { /* Destroys contents safely */ debug3("clear hostkey %d", i); - key_free(sensitive_data.keys[i]); + sshkey_free(sensitive_data.keys[i]); sensitive_data.keys[i] = NULL; } } @@ -1556,7 +1564,7 @@ main(int ac, char **av) free(options.identity_files[i]); options.identity_files[i] = NULL; if (options.identity_keys[i]) { - key_free(options.identity_keys[i]); + sshkey_free(options.identity_keys[i]); options.identity_keys[i] = NULL; } } @@ -2050,7 +2058,7 @@ load_public_identity_files(struct passwd *pw) &keys)) > 0) { for (i = 0; i < nkeys; i++) { if (n_ids >= SSH_MAX_IDENTITY_FILES) { - key_free(keys[i]); + sshkey_free(keys[i]); continue; } identity_keys[n_ids] = keys[i]; @@ -2076,7 +2084,8 @@ load_public_identity_files(struct passwd *pw) "u", pw->pw_name, "l", thishost, "h", host, "r", options.user, (char *)NULL); free(cp); - public = key_load_public(filename, NULL); + check_load(sshkey_load_public(filename, &public, NULL), + filename, "pubkey"); debug("identity file %s type %d", filename, public ? public->type : -1); free(options.identity_files[i]); @@ -2093,17 +2102,18 @@ load_public_identity_files(struct passwd *pw) if (options.num_certificate_files != 0) continue; xasprintf(&cp, "%s-cert", filename); - public = key_load_public(cp, NULL); + check_load(sshkey_load_public(cp, &public, NULL), + filename, "pubkey"); debug("identity file %s type %d", cp, public ? public->type : -1); if (public == NULL) { free(cp); continue; } - if (!key_is_cert(public)) { + if (!sshkey_is_cert(public)) { debug("%s: key %s type %s is not a certificate", - __func__, cp, key_type(public)); - key_free(public); + __func__, cp, sshkey_type(public)); + sshkey_free(public); free(cp); continue; } @@ -2128,7 +2138,8 @@ load_public_identity_files(struct passwd *pw) (char *)NULL); free(cp); - public = key_load_public(filename, NULL); + check_load(sshkey_load_public(filename, &public, NULL), + filename, "certificate"); debug("certificate file %s type %d", filename, public ? public->type : -1); free(options.certificate_files[i]); @@ -2137,10 +2148,10 @@ load_public_identity_files(struct passwd *pw) free(filename); continue; } - if (!key_is_cert(public)) { + if (!sshkey_is_cert(public)) { debug("%s: key %s type %s is not a certificate", - __func__, filename, key_type(public)); - key_free(public); + __func__, filename, sshkey_type(public)); + sshkey_free(public); free(filename); continue; } diff --git a/sshconnect.c b/sshconnect.c index afe294660..2eaf020e0 100644 --- a/sshconnect.c +++ b/sshconnect.c @@ -1,4 +1,4 @@ -/* $OpenBSD: sshconnect.c,v 1.299 2018/07/09 21:03:30 markus Exp $ */ +/* $OpenBSD: sshconnect.c,v 1.300 2018/07/11 18:53:29 markus Exp $ */ /* * Author: Tatu Ylonen * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland @@ -49,14 +49,13 @@ #endif #include "xmalloc.h" -#include "key.h" #include "hostfile.h" #include "ssh.h" #include "sshbuf.h" #include "packet.h" #include "uidswap.h" #include "compat.h" -#include "key.h" +#include "sshkey.h" #include "sshconnect.h" #include "hostfile.h" #include "log.h" @@ -767,7 +766,7 @@ check_host_cert(const char *host, const struct sshkey *host_key) { const char *reason; - if (key_cert_check_authority(host_key, 1, 0, host, &reason) != 0) { + if (sshkey_cert_check_authority(host_key, 1, 0, host, &reason) != 0) { error("%s", reason); return 0; } @@ -1496,9 +1495,9 @@ show_other_keys(struct hostkeys *hostkeys, struct sshkey *key) logit("WARNING: %s key found for host %s\n" "in %s:%lu\n" "%s key fingerprint %s.", - key_type(found->key), + sshkey_type(found->key), found->host, found->file, found->line, - key_type(found->key), fp); + sshkey_type(found->key), fp); if (options.visual_host_key) logit("%s", ra); free(ra); @@ -1525,7 +1524,7 @@ warn_changed_key(struct sshkey *host_key) error("Someone could be eavesdropping on you right now (man-in-the-middle attack)!"); error("It is also possible that a host key has just been changed."); error("The fingerprint for the %s key sent by the remote host is\n%s.", - key_type(host_key), fp); + sshkey_type(host_key), fp); error("Please contact your system administrator."); free(fp); diff --git a/sshconnect2.c b/sshconnect2.c index 2194e3a8d..9874b4485 100644 --- a/sshconnect2.c +++ b/sshconnect2.c @@ -1,4 +1,4 @@ -/* $OpenBSD: sshconnect2.c,v 1.278 2018/07/09 21:03:30 markus Exp $ */ +/* $OpenBSD: sshconnect2.c,v 1.279 2018/07/11 18:53:29 markus Exp $ */ /* * Copyright (c) 2000 Markus Friedl. All rights reserved. * Copyright (c) 2008 Damien Miller. All rights reserved. @@ -1061,7 +1061,7 @@ key_sig_algorithm(struct ssh *ssh, const struct sshkey *key) if (ssh == NULL || ssh->kex->server_sig_algs == NULL || (key->type != KEY_RSA && key->type != KEY_RSA_CERT)) { /* Filter base key signature alg against our configuration */ - return match_list(key_ssh_name(key), + return match_list(sshkey_ssh_name(key), options.pubkey_key_types, NULL); } @@ -1610,10 +1610,10 @@ try_identity(Identity *id) { if (!id->key) return (0); - if (key_type_plain(id->key->type) == KEY_RSA && + if (sshkey_type_plain(id->key->type) == KEY_RSA && (datafellows & SSH_BUG_RSASIGMD5) != 0) { debug("Skipped %s key %s for RSA/MD5 server", - key_type(id->key), id->filename); + sshkey_type(id->key), id->filename); return (0); } return 1; @@ -1979,7 +1979,7 @@ userauth_hostbased(Authctxt *authctxt) (r = sshbuf_put_cstring(b, authctxt->server_user)) != 0 || (r = sshbuf_put_cstring(b, authctxt->service)) != 0 || (r = sshbuf_put_cstring(b, authctxt->method->name)) != 0 || - (r = sshbuf_put_cstring(b, key_ssh_name(private))) != 0 || + (r = sshbuf_put_cstring(b, sshkey_ssh_name(private))) != 0 || (r = sshbuf_put_string(b, keyblob, keylen)) != 0 || (r = sshbuf_put_cstring(b, chost)) != 0 || (r = sshbuf_put_cstring(b, authctxt->local_user)) != 0) { @@ -2005,7 +2005,7 @@ userauth_hostbased(Authctxt *authctxt) (r = sshpkt_put_cstring(ssh, authctxt->server_user)) != 0 || (r = sshpkt_put_cstring(ssh, authctxt->service)) != 0 || (r = sshpkt_put_cstring(ssh, authctxt->method->name)) != 0 || - (r = sshpkt_put_cstring(ssh, key_ssh_name(private))) != 0 || + (r = sshpkt_put_cstring(ssh, sshkey_ssh_name(private))) != 0 || (r = sshpkt_put_string(ssh, keyblob, keylen)) != 0 || (r = sshpkt_put_cstring(ssh, chost)) != 0 || (r = sshpkt_put_cstring(ssh, authctxt->local_user)) != 0 || diff --git a/sshd.c b/sshd.c index ef1dbd170..d7d6f2b26 100644 --- a/sshd.c +++ b/sshd.c @@ -1,4 +1,4 @@ -/* $OpenBSD: sshd.c,v 1.511 2018/07/09 21:29:36 markus Exp $ */ +/* $OpenBSD: sshd.c,v 1.512 2018/07/11 18:53:29 markus Exp $ */ /* * Author: Tatu Ylonen * Copyright (c) 1995 Tatu Ylonen , Espoo, Finland @@ -99,7 +99,7 @@ #include "compat.h" #include "cipher.h" #include "digest.h" -#include "key.h" +#include "sshkey.h" #include "kex.h" #include "myproposal.h" #include "authfile.h" @@ -473,11 +473,11 @@ destroy_sensitive_data(void) for (i = 0; i < options.num_host_key_files; i++) { if (sensitive_data.host_keys[i]) { - key_free(sensitive_data.host_keys[i]); + sshkey_free(sensitive_data.host_keys[i]); sensitive_data.host_keys[i] = NULL; } if (sensitive_data.host_certificates[i]) { - key_free(sensitive_data.host_certificates[i]); + sshkey_free(sensitive_data.host_certificates[i]); sensitive_data.host_certificates[i] = NULL; } } @@ -489,11 +489,16 @@ demote_sensitive_data(void) { struct sshkey *tmp; u_int i; + int r; for (i = 0; i < options.num_host_key_files; i++) { if (sensitive_data.host_keys[i]) { - tmp = key_demote(sensitive_data.host_keys[i]); - key_free(sensitive_data.host_keys[i]); + if ((r = sshkey_demote(sensitive_data.host_keys[i], + &tmp)) != 0) + fatal("could not demote host %s key: %s", + sshkey_type(sensitive_data.host_keys[i]), + ssh_err(r)); + sshkey_free(sensitive_data.host_keys[i]); sensitive_data.host_keys[i] = tmp; } /* Certs do not need demotion */ @@ -814,7 +819,7 @@ get_hostkey_index(struct sshkey *key, int compare, struct ssh *ssh) u_int i; for (i = 0; i < options.num_host_key_files; i++) { - if (key_is_cert(key)) { + if (sshkey_is_cert(key)) { if (key == sensitive_data.host_certificates[i] || (compare && sensitive_data.host_certificates[i] && sshkey_equal(key, @@ -1758,11 +1763,18 @@ main(int ac, char **av) for (i = 0; i < options.num_host_key_files; i++) { if (options.host_key_files[i] == NULL) continue; - key = key_load_private(options.host_key_files[i], "", NULL); - pubkey = key_load_public(options.host_key_files[i], NULL); - + if ((r = sshkey_load_private(options.host_key_files[i], "", + &key, NULL)) != 0 && r != SSH_ERR_SYSTEM_ERROR) + error("Error loading host key \"%s\": %s", + options.host_key_files[i], ssh_err(r)); + if ((r = sshkey_load_public(options.host_key_files[i], + &pubkey, NULL)) != 0 && r != SSH_ERR_SYSTEM_ERROR) + error("Error loading host key \"%s\": %s", + options.host_key_files[i], ssh_err(r)); if (pubkey == NULL && key != NULL) - pubkey = key_demote(key); + if ((r = sshkey_demote(key, &pubkey)) != 0) + fatal("Could not demote key: \"%s\": %s", + options.host_key_files[i], ssh_err(r)); sensitive_data.host_keys[i] = key; sensitive_data.host_pubkeys[i] = pubkey; @@ -1816,21 +1828,21 @@ main(int ac, char **av) for (i = 0; i < options.num_host_cert_files; i++) { if (options.host_cert_files[i] == NULL) continue; - key = key_load_public(options.host_cert_files[i], NULL); - if (key == NULL) { - error("Could not load host certificate: %s", - options.host_cert_files[i]); + if ((r = sshkey_load_public(options.host_cert_files[i], + &key, NULL)) != 0) { + error("Could not load host certificate \"%s\": %s", + options.host_cert_files[i], ssh_err(r)); continue; } - if (!key_is_cert(key)) { + if (!sshkey_is_cert(key)) { error("Certificate file is not a certificate: %s", options.host_cert_files[i]); - key_free(key); + sshkey_free(key); continue; } /* Find matching private key */ for (j = 0; j < options.num_host_key_files; j++) { - if (key_equal_public(key, + if (sshkey_equal_public(key, sensitive_data.host_keys[j])) { sensitive_data.host_certificates[j] = key; break; @@ -1839,12 +1851,12 @@ main(int ac, char **av) if (j >= options.num_host_key_files) { error("No matching private key for certificate: %s", options.host_cert_files[i]); - key_free(key); + sshkey_free(key); continue; } sensitive_data.host_certificates[j] = key; debug("host certificate: #%u type %d %s", j, key->type, - key_type(key)); + sshkey_type(key)); } if (privsep_chroot) { @@ -2225,26 +2237,21 @@ main(int ac, char **av) int sshd_hostkey_sign(struct sshkey *privkey, struct sshkey *pubkey, - u_char **signature, size_t *slen, const u_char *data, size_t dlen, + u_char **signature, size_t *slenp, const u_char *data, size_t dlen, const char *alg, u_int flag) { int r; - u_int xxx_slen, xxx_dlen = dlen; if (privkey) { - if (PRIVSEP(key_sign(privkey, signature, &xxx_slen, data, xxx_dlen, - alg) < 0)) + if (PRIVSEP(sshkey_sign(privkey, signature, slenp, data, dlen, + alg, datafellows)) < 0) fatal("%s: key_sign failed", __func__); - if (slen) - *slen = xxx_slen; } else if (use_privsep) { - if (mm_key_sign(pubkey, signature, &xxx_slen, data, xxx_dlen, - alg) < 0) + if (mm_sshkey_sign(pubkey, signature, slenp, data, dlen, + alg, datafellows) < 0) fatal("%s: pubkey_sign failed", __func__); - if (slen) - *slen = xxx_slen; } else { - if ((r = ssh_agent_sign(auth_sock, pubkey, signature, slen, + if ((r = ssh_agent_sign(auth_sock, pubkey, signature, slenp, data, dlen, alg, datafellows)) != 0) fatal("%s: ssh_agent_sign failed: %s", __func__, ssh_err(r)); -- cgit v1.2.3 From eef1447ddb559c03725a23d4aa6d03f40e8b0049 Mon Sep 17 00:00:00 2001 From: Damien Miller Date: Thu, 12 Jul 2018 14:49:26 +1000 Subject: repair !WITH_OPENSSL build --- kex.h | 2 ++ 1 file changed, 2 insertions(+) (limited to 'kex.h') diff --git a/kex.h b/kex.h index 56a85fd1e..593de1208 100644 --- a/kex.h +++ b/kex.h @@ -41,6 +41,8 @@ # define EC_POINT void # endif /* OPENSSL_HAS_ECC */ #else /* WITH_OPENSSL */ +# define DH void +# define BIGNUM void # define EC_KEY void # define EC_GROUP void # define EC_POINT void -- cgit v1.2.3 From e6c7c11ac2576ac62334616bd4408bf64140bba7 Mon Sep 17 00:00:00 2001 From: Simon Wilkinson Date: Sun, 9 Feb 2014 16:09:48 +0000 Subject: GSSAPI key exchange support This patch has been rejected upstream: "None of the OpenSSH developers are in favour of adding this, and this situation has not changed for several years. This is not a slight on Simon's patch, which is of fine quality, but just that a) we don't trust GSSAPI implementations that much and b) we don't like adding new KEX since they are pre-auth attack surface. This one is particularly scary, since it requires hooks out to typically root-owned system resources." However, quite a lot of people rely on this in Debian, and it's better to have it merged into the main openssh package rather than having separate -krb5 packages (as we used to have). It seems to have a generally good security history. Bug: https://bugzilla.mindrot.org/show_bug.cgi?id=1242 Last-Updated: 2018-08-24 Patch-Name: gssapi.patch --- ChangeLog.gssapi | 113 +++++++++++++++++++ Makefile.in | 3 +- auth-krb5.c | 17 ++- auth.c | 96 +--------------- auth2-gss.c | 54 ++++++++- auth2.c | 2 + canohost.c | 93 +++++++++++++++ canohost.h | 3 + clientloop.c | 15 ++- config.h.in | 6 + configure.ac | 24 ++++ gss-genr.c | 277 ++++++++++++++++++++++++++++++++++++++++++++- gss-serv-krb5.c | 85 ++++++++++++-- gss-serv.c | 184 +++++++++++++++++++++++++++--- kex.c | 19 ++++ kex.h | 14 +++ kexgssc.c | 338 +++++++++++++++++++++++++++++++++++++++++++++++++++++++ kexgsss.c | 295 ++++++++++++++++++++++++++++++++++++++++++++++++ monitor.c | 122 ++++++++++++++++++-- monitor.h | 3 + monitor_wrap.c | 53 ++++++++- monitor_wrap.h | 4 +- readconf.c | 43 +++++++ readconf.h | 5 + servconf.c | 26 +++++ servconf.h | 2 + ssh-gss.h | 41 ++++++- ssh_config | 2 + ssh_config.5 | 32 ++++++ sshconnect2.c | 133 +++++++++++++++++++++- sshd.c | 112 +++++++++++++++++- sshd_config | 2 + sshd_config.5 | 10 ++ sshkey.c | 3 +- sshkey.h | 1 + 35 files changed, 2087 insertions(+), 145 deletions(-) create mode 100644 ChangeLog.gssapi create mode 100644 kexgssc.c create mode 100644 kexgsss.c (limited to 'kex.h') diff --git a/ChangeLog.gssapi b/ChangeLog.gssapi new file mode 100644 index 000000000..f117a336a --- /dev/null +++ b/ChangeLog.gssapi @@ -0,0 +1,113 @@ +20110101 + - Finally update for OpenSSH 5.6p1 + - Add GSSAPIServerIdentity option from Jim Basney + +20100308 + - [ Makefile.in, key.c, key.h ] + Updates for OpenSSH 5.4p1 + - [ servconf.c ] + Include GSSAPI options in the sshd -T configuration dump, and flag + some older configuration options as being unsupported. Thanks to Colin + Watson. + - + +20100124 + - [ sshconnect2.c ] + Adapt to deal with additional element in Authmethod structure. Thanks to + Colin Watson + +20090615 + - [ gss-genr.c gss-serv.c kexgssc.c kexgsss.c monitor.c sshconnect2.c + sshd.c ] + Fix issues identified by Greg Hudson following a code review + Check return value of gss_indicate_mechs + Protect GSSAPI calls in monitor, so they can only be used if enabled + Check return values of bignum functions in key exchange + Use BN_clear_free to clear other side's DH value + Make ssh_gssapi_id_kex more robust + Only configure kex table pointers if GSSAPI is enabled + Don't leak mechanism list, or gss mechanism list + Cast data.length before printing + If serverkey isn't provided, use an empty string, rather than NULL + +20090201 + - [ gss-genr.c gss-serv.c kex.h kexgssc.c readconf.c readconf.h ssh-gss.h + ssh_config.5 sshconnet2.c ] + Add support for the GSSAPIClientIdentity option, which allows the user + to specify which GSSAPI identity to use to contact a given server + +20080404 + - [ gss-serv.c ] + Add code to actually implement GSSAPIStrictAcceptCheck, which had somehow + been omitted from a previous version of this patch. Reported by Borislav + Stoichkov + +20070317 + - [ gss-serv-krb5.c ] + Remove C99ism, where new_ccname was being declared in the middle of a + function + +20061220 + - [ servconf.c ] + Make default for GSSAPIStrictAcceptorCheck be Yes, to match previous, and + documented, behaviour. Reported by Dan Watson. + +20060910 + - [ gss-genr.c kexgssc.c kexgsss.c kex.h monitor.c sshconnect2.c sshd.c + ssh-gss.h ] + add support for gss-group14-sha1 key exchange mechanisms + - [ gss-serv.c servconf.c servconf.h sshd_config sshd_config.5 ] + Add GSSAPIStrictAcceptorCheck option to allow the disabling of + acceptor principal checking on multi-homed machines. + + - [ sshd_config ssh_config ] + Add settings for GSSAPIKeyExchange and GSSAPITrustDNS to the sample + configuration files + - [ kexgss.c kegsss.c sshconnect2.c sshd.c ] + Code cleanup. Replace strlen/xmalloc/snprintf sequences with xasprintf() + Limit length of error messages displayed by client + +20060909 + - [ gss-genr.c gss-serv.c ] + move ssh_gssapi_acquire_cred() and ssh_gssapi_server_ctx to be server + only, where they belong + + +20060829 + - [ gss-serv-krb5.c ] + Fix CCAPI credentials cache name when creating KRB5CCNAME environment + variable + +20060828 + - [ gss-genr.c ] + Avoid Heimdal context freeing problem + + +20060818 + - [ gss-genr.c ssh-gss.h sshconnect2.c ] + Make sure that SPENGO is disabled + + +20060421 + - [ gssgenr.c, sshconnect2.c ] + a few type changes (signed versus unsigned, int versus size_t) to + fix compiler errors/warnings + (from jbasney AT ncsa.uiuc.edu) + - [ kexgssc.c, sshconnect2.c ] + fix uninitialized variable warnings + (from jbasney AT ncsa.uiuc.edu) + - [ gssgenr.c ] + pass oid to gss_display_status (helpful when using GSSAPI mechglue) + (from jbasney AT ncsa.uiuc.edu) + + - [ gss-serv-krb5.c ] + #ifdef HAVE_GSSAPI_KRB5 should be #ifdef HAVE_GSSAPI_KRB5_H + (from jbasney AT ncsa.uiuc.edu) + + - [ readconf.c, readconf.h, ssh_config.5, sshconnect2.c + add client-side GssapiKeyExchange option + (from jbasney AT ncsa.uiuc.edu) + - [ sshconnect2.c ] + add support for GssapiTrustDns option for gssapi-with-mic + (from jbasney AT ncsa.uiuc.edu) + diff --git a/Makefile.in b/Makefile.in index 2385c62a8..6175c6063 100644 --- a/Makefile.in +++ b/Makefile.in @@ -100,6 +100,7 @@ LIBSSH_OBJS=${LIBOPENSSH_OBJS} \ kex.o kexdh.o kexgex.o kexecdh.o kexc25519.o \ kexdhc.o kexgexc.o kexecdhc.o kexc25519c.o \ kexdhs.o kexgexs.o kexecdhs.o kexc25519s.o \ + kexgssc.o \ platform-pledge.o platform-tracing.o platform-misc.o SSHOBJS= ssh.o readconf.o clientloop.o sshtty.o \ @@ -113,7 +114,7 @@ SSHDOBJS=sshd.o auth-rhosts.o auth-passwd.o \ auth-bsdauth.o auth2-hostbased.o auth2-kbdint.o \ auth2-none.o auth2-passwd.o auth2-pubkey.o \ monitor.o monitor_wrap.o auth-krb5.o \ - auth2-gss.o gss-serv.o gss-serv-krb5.o \ + auth2-gss.o gss-serv.o gss-serv-krb5.o kexgsss.o \ loginrec.o auth-pam.o auth-shadow.o auth-sia.o md5crypt.o \ sftp-server.o sftp-common.o \ sandbox-null.o sandbox-rlimit.o sandbox-systrace.o sandbox-darwin.o \ diff --git a/auth-krb5.c b/auth-krb5.c index 3096f1c8e..204752e1b 100644 --- a/auth-krb5.c +++ b/auth-krb5.c @@ -182,8 +182,13 @@ auth_krb5_password(Authctxt *authctxt, const char *password) len = strlen(authctxt->krb5_ticket_file) + 6; authctxt->krb5_ccname = xmalloc(len); +#ifdef USE_CCAPI + snprintf(authctxt->krb5_ccname, len, "API:%s", + authctxt->krb5_ticket_file); +#else snprintf(authctxt->krb5_ccname, len, "FILE:%s", authctxt->krb5_ticket_file); +#endif #ifdef USE_PAM if (options.use_pam) @@ -240,15 +245,22 @@ krb5_cleanup_proc(Authctxt *authctxt) #ifndef HEIMDAL krb5_error_code ssh_krb5_cc_gen(krb5_context ctx, krb5_ccache *ccache) { - int tmpfd, ret, oerrno; + int ret, oerrno; char ccname[40]; mode_t old_umask; +#ifdef USE_CCAPI + char cctemplate[] = "API:krb5cc_%d"; +#else + char cctemplate[] = "FILE:/tmp/krb5cc_%d_XXXXXXXXXX"; + int tmpfd; +#endif ret = snprintf(ccname, sizeof(ccname), - "FILE:/tmp/krb5cc_%d_XXXXXXXXXX", geteuid()); + cctemplate, geteuid()); if (ret < 0 || (size_t)ret >= sizeof(ccname)) return ENOMEM; +#ifndef USE_CCAPI old_umask = umask(0177); tmpfd = mkstemp(ccname + strlen("FILE:")); oerrno = errno; @@ -265,6 +277,7 @@ ssh_krb5_cc_gen(krb5_context ctx, krb5_ccache *ccache) { return oerrno; } close(tmpfd); +#endif return (krb5_cc_resolve(ctx, ccname, ccache)); } diff --git a/auth.c b/auth.c index 9a3bc96f1..80eb78c48 100644 --- a/auth.c +++ b/auth.c @@ -395,7 +395,8 @@ auth_root_allowed(struct ssh *ssh, const char *method) case PERMIT_NO_PASSWD: if (strcmp(method, "publickey") == 0 || strcmp(method, "hostbased") == 0 || - strcmp(method, "gssapi-with-mic") == 0) + strcmp(method, "gssapi-with-mic") == 0 || + strcmp(method, "gssapi-keyex") == 0) return 1; break; case PERMIT_FORCED_ONLY: @@ -733,99 +734,6 @@ fakepw(void) return (&fake); } -/* - * Returns the remote DNS hostname as a string. The returned string must not - * be freed. NB. this will usually trigger a DNS query the first time it is - * called. - * This function does additional checks on the hostname to mitigate some - * attacks on legacy rhosts-style authentication. - * XXX is RhostsRSAAuthentication vulnerable to these? - * XXX Can we remove these checks? (or if not, remove RhostsRSAAuthentication?) - */ - -static char * -remote_hostname(struct ssh *ssh) -{ - struct sockaddr_storage from; - socklen_t fromlen; - struct addrinfo hints, *ai, *aitop; - char name[NI_MAXHOST], ntop2[NI_MAXHOST]; - const char *ntop = ssh_remote_ipaddr(ssh); - - /* Get IP address of client. */ - fromlen = sizeof(from); - memset(&from, 0, sizeof(from)); - if (getpeername(ssh_packet_get_connection_in(ssh), - (struct sockaddr *)&from, &fromlen) < 0) { - debug("getpeername failed: %.100s", strerror(errno)); - return strdup(ntop); - } - - ipv64_normalise_mapped(&from, &fromlen); - if (from.ss_family == AF_INET6) - fromlen = sizeof(struct sockaddr_in6); - - debug3("Trying to reverse map address %.100s.", ntop); - /* Map the IP address to a host name. */ - if (getnameinfo((struct sockaddr *)&from, fromlen, name, sizeof(name), - NULL, 0, NI_NAMEREQD) != 0) { - /* Host name not found. Use ip address. */ - return strdup(ntop); - } - - /* - * if reverse lookup result looks like a numeric hostname, - * someone is trying to trick us by PTR record like following: - * 1.1.1.10.in-addr.arpa. IN PTR 2.3.4.5 - */ - memset(&hints, 0, sizeof(hints)); - hints.ai_socktype = SOCK_DGRAM; /*dummy*/ - hints.ai_flags = AI_NUMERICHOST; - if (getaddrinfo(name, NULL, &hints, &ai) == 0) { - logit("Nasty PTR record \"%s\" is set up for %s, ignoring", - name, ntop); - freeaddrinfo(ai); - return strdup(ntop); - } - - /* Names are stored in lowercase. */ - lowercase(name); - - /* - * Map it back to an IP address and check that the given - * address actually is an address of this host. This is - * necessary because anyone with access to a name server can - * define arbitrary names for an IP address. Mapping from - * name to IP address can be trusted better (but can still be - * fooled if the intruder has access to the name server of - * the domain). - */ - memset(&hints, 0, sizeof(hints)); - hints.ai_family = from.ss_family; - hints.ai_socktype = SOCK_STREAM; - if (getaddrinfo(name, NULL, &hints, &aitop) != 0) { - logit("reverse mapping checking getaddrinfo for %.700s " - "[%s] failed.", name, ntop); - return strdup(ntop); - } - /* Look for the address from the list of addresses. */ - for (ai = aitop; ai; ai = ai->ai_next) { - if (getnameinfo(ai->ai_addr, ai->ai_addrlen, ntop2, - sizeof(ntop2), NULL, 0, NI_NUMERICHOST) == 0 && - (strcmp(ntop, ntop2) == 0)) - break; - } - freeaddrinfo(aitop); - /* If we reached the end of the list, the address was not there. */ - if (ai == NULL) { - /* Address not found for the host name. */ - logit("Address %.100s maps to %.600s, but this does not " - "map back to the address.", ntop, name); - return strdup(ntop); - } - return strdup(name); -} - /* * Return the canonical name of the host in the other side of the current * connection. The host name is cached, so it is efficient to call this diff --git a/auth2-gss.c b/auth2-gss.c index 9351e0428..1f12bb113 100644 --- a/auth2-gss.c +++ b/auth2-gss.c @@ -1,7 +1,7 @@ /* $OpenBSD: auth2-gss.c,v 1.29 2018/07/31 03:10:27 djm Exp $ */ /* - * Copyright (c) 2001-2003 Simon Wilkinson. All rights reserved. + * Copyright (c) 2001-2007 Simon Wilkinson. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -54,6 +54,46 @@ static int input_gssapi_mic(int type, u_int32_t plen, struct ssh *ssh); static int input_gssapi_exchange_complete(int type, u_int32_t plen, struct ssh *ssh); static int input_gssapi_errtok(int, u_int32_t, struct ssh *); +/* + * The 'gssapi_keyex' userauth mechanism. + */ +static int +userauth_gsskeyex(struct ssh *ssh) +{ + Authctxt *authctxt = ssh->authctxt; + int r, authenticated = 0; + struct sshbuf *b; + gss_buffer_desc mic, gssbuf; + u_char *p; + size_t len; + + if ((r = sshpkt_get_string(ssh, &p, &len)) != 0 || + (r = sshpkt_get_end(ssh)) != 0) + fatal("%s: %s", __func__, ssh_err(r)); + if ((b = sshbuf_new()) == NULL) + fatal("%s: sshbuf_new failed", __func__); + mic.value = p; + mic.length = len; + + ssh_gssapi_buildmic(b, authctxt->user, authctxt->service, + "gssapi-keyex"); + + if ((gssbuf.value = sshbuf_mutable_ptr(b)) == NULL) + fatal("%s: sshbuf_mutable_ptr failed", __func__); + gssbuf.length = sshbuf_len(b); + + /* gss_kex_context is NULL with privsep, so we can't check it here */ + if (!GSS_ERROR(PRIVSEP(ssh_gssapi_checkmic(gss_kex_context, + &gssbuf, &mic)))) + authenticated = PRIVSEP(ssh_gssapi_userok(authctxt->user, + authctxt->pw)); + + sshbuf_free(b); + free(mic.value); + + return (authenticated); +} + /* * We only support those mechanisms that we know about (ie ones that we know * how to check local user kuserok and the like) @@ -260,7 +300,8 @@ input_gssapi_exchange_complete(int type, u_int32_t plen, struct ssh *ssh) if ((r = sshpkt_get_end(ssh)) != 0) fatal("%s: %s", __func__, ssh_err(r)); - authenticated = PRIVSEP(ssh_gssapi_userok(authctxt->user)); + authenticated = PRIVSEP(ssh_gssapi_userok(authctxt->user, + authctxt->pw)); if ((!use_privsep || mm_is_monitor()) && (displayname = ssh_gssapi_displayname()) != NULL) @@ -306,7 +347,8 @@ input_gssapi_mic(int type, u_int32_t plen, struct ssh *ssh) gssbuf.length = sshbuf_len(b); if (!GSS_ERROR(PRIVSEP(ssh_gssapi_checkmic(gssctxt, &gssbuf, &mic)))) - authenticated = PRIVSEP(ssh_gssapi_userok(authctxt->user)); + authenticated = + PRIVSEP(ssh_gssapi_userok(authctxt->user, authctxt->pw)); else logit("GSSAPI MIC check failed"); @@ -326,6 +368,12 @@ input_gssapi_mic(int type, u_int32_t plen, struct ssh *ssh) return 0; } +Authmethod method_gsskeyex = { + "gssapi-keyex", + userauth_gsskeyex, + &options.gss_authentication +}; + Authmethod method_gssapi = { "gssapi-with-mic", userauth_gssapi, diff --git a/auth2.c b/auth2.c index ab8795895..96efe164c 100644 --- a/auth2.c +++ b/auth2.c @@ -74,6 +74,7 @@ extern Authmethod method_passwd; extern Authmethod method_kbdint; extern Authmethod method_hostbased; #ifdef GSSAPI +extern Authmethod method_gsskeyex; extern Authmethod method_gssapi; #endif @@ -81,6 +82,7 @@ Authmethod *authmethods[] = { &method_none, &method_pubkey, #ifdef GSSAPI + &method_gsskeyex, &method_gssapi, #endif &method_passwd, diff --git a/canohost.c b/canohost.c index f71a08568..404731d24 100644 --- a/canohost.c +++ b/canohost.c @@ -35,6 +35,99 @@ #include "canohost.h" #include "misc.h" +/* + * Returns the remote DNS hostname as a string. The returned string must not + * be freed. NB. this will usually trigger a DNS query the first time it is + * called. + * This function does additional checks on the hostname to mitigate some + * attacks on legacy rhosts-style authentication. + * XXX is RhostsRSAAuthentication vulnerable to these? + * XXX Can we remove these checks? (or if not, remove RhostsRSAAuthentication?) + */ + +char * +remote_hostname(struct ssh *ssh) +{ + struct sockaddr_storage from; + socklen_t fromlen; + struct addrinfo hints, *ai, *aitop; + char name[NI_MAXHOST], ntop2[NI_MAXHOST]; + const char *ntop = ssh_remote_ipaddr(ssh); + + /* Get IP address of client. */ + fromlen = sizeof(from); + memset(&from, 0, sizeof(from)); + if (getpeername(ssh_packet_get_connection_in(ssh), + (struct sockaddr *)&from, &fromlen) < 0) { + debug("getpeername failed: %.100s", strerror(errno)); + return strdup(ntop); + } + + ipv64_normalise_mapped(&from, &fromlen); + if (from.ss_family == AF_INET6) + fromlen = sizeof(struct sockaddr_in6); + + debug3("Trying to reverse map address %.100s.", ntop); + /* Map the IP address to a host name. */ + if (getnameinfo((struct sockaddr *)&from, fromlen, name, sizeof(name), + NULL, 0, NI_NAMEREQD) != 0) { + /* Host name not found. Use ip address. */ + return strdup(ntop); + } + + /* + * if reverse lookup result looks like a numeric hostname, + * someone is trying to trick us by PTR record like following: + * 1.1.1.10.in-addr.arpa. IN PTR 2.3.4.5 + */ + memset(&hints, 0, sizeof(hints)); + hints.ai_socktype = SOCK_DGRAM; /*dummy*/ + hints.ai_flags = AI_NUMERICHOST; + if (getaddrinfo(name, NULL, &hints, &ai) == 0) { + logit("Nasty PTR record \"%s\" is set up for %s, ignoring", + name, ntop); + freeaddrinfo(ai); + return strdup(ntop); + } + + /* Names are stored in lowercase. */ + lowercase(name); + + /* + * Map it back to an IP address and check that the given + * address actually is an address of this host. This is + * necessary because anyone with access to a name server can + * define arbitrary names for an IP address. Mapping from + * name to IP address can be trusted better (but can still be + * fooled if the intruder has access to the name server of + * the domain). + */ + memset(&hints, 0, sizeof(hints)); + hints.ai_family = from.ss_family; + hints.ai_socktype = SOCK_STREAM; + if (getaddrinfo(name, NULL, &hints, &aitop) != 0) { + logit("reverse mapping checking getaddrinfo for %.700s " + "[%s] failed.", name, ntop); + return strdup(ntop); + } + /* Look for the address from the list of addresses. */ + for (ai = aitop; ai; ai = ai->ai_next) { + if (getnameinfo(ai->ai_addr, ai->ai_addrlen, ntop2, + sizeof(ntop2), NULL, 0, NI_NUMERICHOST) == 0 && + (strcmp(ntop, ntop2) == 0)) + break; + } + freeaddrinfo(aitop); + /* If we reached the end of the list, the address was not there. */ + if (ai == NULL) { + /* Address not found for the host name. */ + logit("Address %.100s maps to %.600s, but this does not " + "map back to the address.", ntop, name); + return strdup(ntop); + } + return strdup(name); +} + void ipv64_normalise_mapped(struct sockaddr_storage *addr, socklen_t *len) { diff --git a/canohost.h b/canohost.h index 26d62855a..0cadc9f18 100644 --- a/canohost.h +++ b/canohost.h @@ -15,6 +15,9 @@ #ifndef _CANOHOST_H #define _CANOHOST_H +struct ssh; + +char *remote_hostname(struct ssh *); char *get_peer_ipaddr(int); int get_peer_port(int); char *get_local_ipaddr(int); diff --git a/clientloop.c b/clientloop.c index ad35cb7ba..e69c5141f 100644 --- a/clientloop.c +++ b/clientloop.c @@ -112,6 +112,10 @@ #include "ssherr.h" #include "hostfile.h" +#ifdef GSSAPI +#include "ssh-gss.h" +#endif + /* import options */ extern Options options; @@ -1357,9 +1361,18 @@ client_loop(struct ssh *ssh, int have_pty, int escape_char_arg, break; /* Do channel operations unless rekeying in progress. */ - if (!ssh_packet_is_rekeying(ssh)) + if (!ssh_packet_is_rekeying(ssh)) { channel_after_select(ssh, readset, writeset); +#ifdef GSSAPI + if (options.gss_renewal_rekey && + ssh_gssapi_credentials_updated(NULL)) { + debug("credentials updated - forcing rekey"); + need_rekeying = 1; + } +#endif + } + /* Buffer input from the connection. */ client_process_net_input(readset); diff --git a/config.h.in b/config.h.in index 7940b4c86..93295da07 100644 --- a/config.h.in +++ b/config.h.in @@ -1749,6 +1749,9 @@ /* Use btmp to log bad logins */ #undef USE_BTMP +/* platform uses an in-memory credentials cache */ +#undef USE_CCAPI + /* Use libedit for sftp */ #undef USE_LIBEDIT @@ -1764,6 +1767,9 @@ /* Use PIPES instead of a socketpair() */ #undef USE_PIPES +/* platform has the Security Authorization Session API */ +#undef USE_SECURITY_SESSION_API + /* Define if you have Solaris privileges */ #undef USE_SOLARIS_PRIVS diff --git a/configure.ac b/configure.ac index 83e530750..82428b241 100644 --- a/configure.ac +++ b/configure.ac @@ -673,6 +673,30 @@ main() { if (NSVersionOfRunTimeLibrary("System") >= (60 << 16)) [Use tunnel device compatibility to OpenBSD]) AC_DEFINE([SSH_TUN_PREPEND_AF], [1], [Prepend the address family to IP tunnel traffic]) + AC_MSG_CHECKING([if we have the Security Authorization Session API]) + AC_TRY_COMPILE([#include ], + [SessionCreate(0, 0);], + [ac_cv_use_security_session_api="yes" + AC_DEFINE([USE_SECURITY_SESSION_API], [1], + [platform has the Security Authorization Session API]) + LIBS="$LIBS -framework Security" + AC_MSG_RESULT([yes])], + [ac_cv_use_security_session_api="no" + AC_MSG_RESULT([no])]) + AC_MSG_CHECKING([if we have an in-memory credentials cache]) + AC_TRY_COMPILE( + [#include ], + [cc_context_t c; + (void) cc_initialize (&c, 0, NULL, NULL);], + [AC_DEFINE([USE_CCAPI], [1], + [platform uses an in-memory credentials cache]) + LIBS="$LIBS -framework Security" + AC_MSG_RESULT([yes]) + if test "x$ac_cv_use_security_session_api" = "xno"; then + AC_MSG_ERROR([*** Need a security framework to use the credentials cache API ***]) + fi], + [AC_MSG_RESULT([no])] + ) m4_pattern_allow([AU_IPv]) AC_CHECK_DECL([AU_IPv4], [], AC_DEFINE([AU_IPv4], [0], [System only supports IPv4 audit records]) diff --git a/gss-genr.c b/gss-genr.c index d56257b4a..285fc29a5 100644 --- a/gss-genr.c +++ b/gss-genr.c @@ -1,7 +1,7 @@ /* $OpenBSD: gss-genr.c,v 1.26 2018/07/10 09:13:30 djm Exp $ */ /* - * Copyright (c) 2001-2007 Simon Wilkinson. All rights reserved. + * Copyright (c) 2001-2009 Simon Wilkinson. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -41,12 +41,34 @@ #include "sshbuf.h" #include "log.h" #include "ssh2.h" +#include "cipher.h" +#include "kex.h" +#include #include "ssh-gss.h" extern u_char *session_id2; extern u_int session_id2_len; +typedef struct { + char *encoded; + gss_OID oid; +} ssh_gss_kex_mapping; + +/* + * XXX - It would be nice to find a more elegant way of handling the + * XXX passing of the key exchange context to the userauth routines + */ + +Gssctxt *gss_kex_context = NULL; + +static ssh_gss_kex_mapping *gss_enc2oid = NULL; + +int +ssh_gssapi_oid_table_ok(void) { + return (gss_enc2oid != NULL); +} + /* sshbuf_get for gss_buffer_desc */ int ssh_gssapi_get_buffer_desc(struct sshbuf *b, gss_buffer_desc *g) @@ -62,6 +84,141 @@ ssh_gssapi_get_buffer_desc(struct sshbuf *b, gss_buffer_desc *g) return 0; } +/* + * Return a list of the gss-group1-sha1 mechanisms supported by this program + * + * We test mechanisms to ensure that we can use them, to avoid starting + * a key exchange with a bad mechanism + */ + +char * +ssh_gssapi_client_mechanisms(const char *host, const char *client) { + gss_OID_set gss_supported; + OM_uint32 min_status; + + if (GSS_ERROR(gss_indicate_mechs(&min_status, &gss_supported))) + return NULL; + + return(ssh_gssapi_kex_mechs(gss_supported, ssh_gssapi_check_mechanism, + host, client)); +} + +char * +ssh_gssapi_kex_mechs(gss_OID_set gss_supported, ssh_gssapi_check_fn *check, + const char *host, const char *client) { + struct sshbuf *buf; + size_t i; + int r, oidpos, enclen; + char *mechs, *encoded; + u_char digest[EVP_MAX_MD_SIZE]; + char deroid[2]; + const EVP_MD *evp_md = EVP_md5(); + EVP_MD_CTX md; + + if (gss_enc2oid != NULL) { + for (i = 0; gss_enc2oid[i].encoded != NULL; i++) + free(gss_enc2oid[i].encoded); + free(gss_enc2oid); + } + + gss_enc2oid = xmalloc(sizeof(ssh_gss_kex_mapping) * + (gss_supported->count + 1)); + + if ((buf = sshbuf_new()) == NULL) + fatal("%s: sshbuf_new failed", __func__); + + oidpos = 0; + for (i = 0; i < gss_supported->count; i++) { + if (gss_supported->elements[i].length < 128 && + (*check)(NULL, &(gss_supported->elements[i]), host, client)) { + + deroid[0] = SSH_GSS_OIDTYPE; + deroid[1] = gss_supported->elements[i].length; + + EVP_DigestInit(&md, evp_md); + EVP_DigestUpdate(&md, deroid, 2); + EVP_DigestUpdate(&md, + gss_supported->elements[i].elements, + gss_supported->elements[i].length); + EVP_DigestFinal(&md, digest, NULL); + + encoded = xmalloc(EVP_MD_size(evp_md) * 2); + enclen = __b64_ntop(digest, EVP_MD_size(evp_md), + encoded, EVP_MD_size(evp_md) * 2); + + if (oidpos != 0) { + if ((r = sshbuf_put_u8(buf, ',')) != 0) + fatal("%s: buffer error: %s", + __func__, ssh_err(r)); + } + + if ((r = sshbuf_put(buf, KEX_GSS_GEX_SHA1_ID, + sizeof(KEX_GSS_GEX_SHA1_ID) - 1)) != 0 || + (r = sshbuf_put(buf, encoded, enclen)) != 0 || + (r = sshbuf_put_u8(buf, ',')) != 0 || + (r = sshbuf_put(buf, KEX_GSS_GRP1_SHA1_ID, + sizeof(KEX_GSS_GRP1_SHA1_ID) - 1)) != 0 || + (r = sshbuf_put(buf, encoded, enclen)) != 0 || + (r = sshbuf_put_u8(buf, ',')) != 0 || + (r = sshbuf_put(buf, KEX_GSS_GRP14_SHA1_ID, + sizeof(KEX_GSS_GRP14_SHA1_ID) - 1)) != 0 || + (r = sshbuf_put(buf, encoded, enclen)) != 0) + fatal("%s: buffer error: %s", + __func__, ssh_err(r)); + + gss_enc2oid[oidpos].oid = &(gss_supported->elements[i]); + gss_enc2oid[oidpos].encoded = encoded; + oidpos++; + } + } + gss_enc2oid[oidpos].oid = NULL; + gss_enc2oid[oidpos].encoded = NULL; + + if ((mechs = sshbuf_dup_string(buf)) == NULL) + fatal("%s: sshbuf_dup_string failed", __func__); + + if (strlen(mechs) == 0) { + free(mechs); + mechs = NULL; + } + + return (mechs); +} + +gss_OID +ssh_gssapi_id_kex(Gssctxt *ctx, char *name, int kex_type) { + int i = 0; + + switch (kex_type) { + case KEX_GSS_GRP1_SHA1: + if (strlen(name) < sizeof(KEX_GSS_GRP1_SHA1_ID)) + return GSS_C_NO_OID; + name += sizeof(KEX_GSS_GRP1_SHA1_ID) - 1; + break; + case KEX_GSS_GRP14_SHA1: + if (strlen(name) < sizeof(KEX_GSS_GRP14_SHA1_ID)) + return GSS_C_NO_OID; + name += sizeof(KEX_GSS_GRP14_SHA1_ID) - 1; + break; + case KEX_GSS_GEX_SHA1: + if (strlen(name) < sizeof(KEX_GSS_GEX_SHA1_ID)) + return GSS_C_NO_OID; + name += sizeof(KEX_GSS_GEX_SHA1_ID) - 1; + break; + default: + return GSS_C_NO_OID; + } + + while (gss_enc2oid[i].encoded != NULL && + strcmp(name, gss_enc2oid[i].encoded) != 0) + i++; + + if (gss_enc2oid[i].oid != NULL && ctx != NULL) + ssh_gssapi_set_oid(ctx, gss_enc2oid[i].oid); + + return gss_enc2oid[i].oid; +} + /* Check that the OID in a data stream matches that in the context */ int ssh_gssapi_check_oid(Gssctxt *ctx, void *data, size_t len) @@ -218,7 +375,7 @@ ssh_gssapi_init_ctx(Gssctxt *ctx, int deleg_creds, gss_buffer_desc *recv_tok, } ctx->major = gss_init_sec_context(&ctx->minor, - GSS_C_NO_CREDENTIAL, &ctx->context, ctx->name, ctx->oid, + ctx->client_creds, &ctx->context, ctx->name, ctx->oid, GSS_C_MUTUAL_FLAG | GSS_C_INTEG_FLAG | deleg_flag, 0, NULL, recv_tok, NULL, send_tok, flags, NULL); @@ -247,9 +404,43 @@ ssh_gssapi_import_name(Gssctxt *ctx, const char *host) return (ctx->major); } +OM_uint32 +ssh_gssapi_client_identity(Gssctxt *ctx, const char *name) +{ + gss_buffer_desc gssbuf; + gss_name_t gssname; + OM_uint32 status; + gss_OID_set oidset; + + gssbuf.value = (void *) name; + gssbuf.length = strlen(gssbuf.value); + + gss_create_empty_oid_set(&status, &oidset); + gss_add_oid_set_member(&status, ctx->oid, &oidset); + + ctx->major = gss_import_name(&ctx->minor, &gssbuf, + GSS_C_NT_USER_NAME, &gssname); + + if (!ctx->major) + ctx->major = gss_acquire_cred(&ctx->minor, + gssname, 0, oidset, GSS_C_INITIATE, + &ctx->client_creds, NULL, NULL); + + gss_release_name(&status, &gssname); + gss_release_oid_set(&status, &oidset); + + if (ctx->major) + ssh_gssapi_error(ctx); + + return(ctx->major); +} + OM_uint32 ssh_gssapi_sign(Gssctxt *ctx, gss_buffer_t buffer, gss_buffer_t hash) { + if (ctx == NULL) + return -1; + if ((ctx->major = gss_get_mic(&ctx->minor, ctx->context, GSS_C_QOP_DEFAULT, buffer, hash))) ssh_gssapi_error(ctx); @@ -257,6 +448,19 @@ ssh_gssapi_sign(Gssctxt *ctx, gss_buffer_t buffer, gss_buffer_t hash) return (ctx->major); } +/* Priviledged when used by server */ +OM_uint32 +ssh_gssapi_checkmic(Gssctxt *ctx, gss_buffer_t gssbuf, gss_buffer_t gssmic) +{ + if (ctx == NULL) + return -1; + + ctx->major = gss_verify_mic(&ctx->minor, ctx->context, + gssbuf, gssmic, NULL); + + return (ctx->major); +} + void ssh_gssapi_buildmic(struct sshbuf *b, const char *user, const char *service, const char *context) @@ -273,11 +477,16 @@ ssh_gssapi_buildmic(struct sshbuf *b, const char *user, const char *service, } int -ssh_gssapi_check_mechanism(Gssctxt **ctx, gss_OID oid, const char *host) +ssh_gssapi_check_mechanism(Gssctxt **ctx, gss_OID oid, const char *host, + const char *client) { gss_buffer_desc token = GSS_C_EMPTY_BUFFER; OM_uint32 major, minor; gss_OID_desc spnego_oid = {6, (void *)"\x2B\x06\x01\x05\x05\x02"}; + Gssctxt *intctx = NULL; + + if (ctx == NULL) + ctx = &intctx; /* RFC 4462 says we MUST NOT do SPNEGO */ if (oid->length == spnego_oid.length && @@ -287,6 +496,10 @@ ssh_gssapi_check_mechanism(Gssctxt **ctx, gss_OID oid, const char *host) ssh_gssapi_build_ctx(ctx); ssh_gssapi_set_oid(*ctx, oid); major = ssh_gssapi_import_name(*ctx, host); + + if (!GSS_ERROR(major) && client) + major = ssh_gssapi_client_identity(*ctx, client); + if (!GSS_ERROR(major)) { major = ssh_gssapi_init_ctx(*ctx, 0, GSS_C_NO_BUFFER, &token, NULL); @@ -296,10 +509,66 @@ ssh_gssapi_check_mechanism(Gssctxt **ctx, gss_OID oid, const char *host) GSS_C_NO_BUFFER); } - if (GSS_ERROR(major)) + if (GSS_ERROR(major) || intctx != NULL) ssh_gssapi_delete_ctx(ctx); return (!GSS_ERROR(major)); } +int +ssh_gssapi_credentials_updated(Gssctxt *ctxt) { + static gss_name_t saved_name = GSS_C_NO_NAME; + static OM_uint32 saved_lifetime = 0; + static gss_OID saved_mech = GSS_C_NO_OID; + static gss_name_t name; + static OM_uint32 last_call = 0; + OM_uint32 lifetime, now, major, minor; + int equal; + + now = time(NULL); + + if (ctxt) { + debug("Rekey has happened - updating saved versions"); + + if (saved_name != GSS_C_NO_NAME) + gss_release_name(&minor, &saved_name); + + major = gss_inquire_cred(&minor, GSS_C_NO_CREDENTIAL, + &saved_name, &saved_lifetime, NULL, NULL); + + if (!GSS_ERROR(major)) { + saved_mech = ctxt->oid; + saved_lifetime+= now; + } else { + /* Handle the error */ + } + return 0; + } + + if (now - last_call < 10) + return 0; + + last_call = now; + + if (saved_mech == GSS_C_NO_OID) + return 0; + + major = gss_inquire_cred(&minor, GSS_C_NO_CREDENTIAL, + &name, &lifetime, NULL, NULL); + if (major == GSS_S_CREDENTIALS_EXPIRED) + return 0; + else if (GSS_ERROR(major)) + return 0; + + major = gss_compare_name(&minor, saved_name, name, &equal); + gss_release_name(&minor, &name); + if (GSS_ERROR(major)) + return 0; + + if (equal && (saved_lifetime < lifetime + now - 10)) + return 1; + + return 0; +} + #endif /* GSSAPI */ diff --git a/gss-serv-krb5.c b/gss-serv-krb5.c index a151bc1e4..90f8692f5 100644 --- a/gss-serv-krb5.c +++ b/gss-serv-krb5.c @@ -1,7 +1,7 @@ /* $OpenBSD: gss-serv-krb5.c,v 1.9 2018/07/09 21:37:55 markus Exp $ */ /* - * Copyright (c) 2001-2003 Simon Wilkinson. All rights reserved. + * Copyright (c) 2001-2007 Simon Wilkinson. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -120,8 +120,8 @@ ssh_gssapi_krb5_storecreds(ssh_gssapi_client *client) krb5_error_code problem; krb5_principal princ; OM_uint32 maj_status, min_status; - int len; const char *errmsg; + const char *new_ccname; if (client->creds == NULL) { debug("No credentials stored"); @@ -180,11 +180,16 @@ ssh_gssapi_krb5_storecreds(ssh_gssapi_client *client) return; } - client->store.filename = xstrdup(krb5_cc_get_name(krb_context, ccache)); + new_ccname = krb5_cc_get_name(krb_context, ccache); + client->store.envvar = "KRB5CCNAME"; - len = strlen(client->store.filename) + 6; - client->store.envval = xmalloc(len); - snprintf(client->store.envval, len, "FILE:%s", client->store.filename); +#ifdef USE_CCAPI + xasprintf(&client->store.envval, "API:%s", new_ccname); + client->store.filename = NULL; +#else + xasprintf(&client->store.envval, "FILE:%s", new_ccname); + client->store.filename = xstrdup(new_ccname); +#endif #ifdef USE_PAM if (options.use_pam) @@ -196,6 +201,71 @@ ssh_gssapi_krb5_storecreds(ssh_gssapi_client *client) return; } +int +ssh_gssapi_krb5_updatecreds(ssh_gssapi_ccache *store, + ssh_gssapi_client *client) +{ + krb5_ccache ccache = NULL; + krb5_principal principal = NULL; + char *name = NULL; + krb5_error_code problem; + OM_uint32 maj_status, min_status; + + if ((problem = krb5_cc_resolve(krb_context, store->envval, &ccache))) { + logit("krb5_cc_resolve(): %.100s", + krb5_get_err_text(krb_context, problem)); + return 0; + } + + /* Find out who the principal in this cache is */ + if ((problem = krb5_cc_get_principal(krb_context, ccache, + &principal))) { + logit("krb5_cc_get_principal(): %.100s", + krb5_get_err_text(krb_context, problem)); + krb5_cc_close(krb_context, ccache); + return 0; + } + + if ((problem = krb5_unparse_name(krb_context, principal, &name))) { + logit("krb5_unparse_name(): %.100s", + krb5_get_err_text(krb_context, problem)); + krb5_free_principal(krb_context, principal); + krb5_cc_close(krb_context, ccache); + return 0; + } + + + if (strcmp(name,client->exportedname.value)!=0) { + debug("Name in local credentials cache differs. Not storing"); + krb5_free_principal(krb_context, principal); + krb5_cc_close(krb_context, ccache); + krb5_free_unparsed_name(krb_context, name); + return 0; + } + krb5_free_unparsed_name(krb_context, name); + + /* Name matches, so lets get on with it! */ + + if ((problem = krb5_cc_initialize(krb_context, ccache, principal))) { + logit("krb5_cc_initialize(): %.100s", + krb5_get_err_text(krb_context, problem)); + krb5_free_principal(krb_context, principal); + krb5_cc_close(krb_context, ccache); + return 0; + } + + krb5_free_principal(krb_context, principal); + + if ((maj_status = gss_krb5_copy_ccache(&min_status, client->creds, + ccache))) { + logit("gss_krb5_copy_ccache() failed. Sorry!"); + krb5_cc_close(krb_context, ccache); + return 0; + } + + return 1; +} + ssh_gssapi_mech gssapi_kerberos_mech = { "toWM5Slw5Ew8Mqkay+al2g==", "Kerberos", @@ -203,7 +273,8 @@ ssh_gssapi_mech gssapi_kerberos_mech = { NULL, &ssh_gssapi_krb5_userok, NULL, - &ssh_gssapi_krb5_storecreds + &ssh_gssapi_krb5_storecreds, + &ssh_gssapi_krb5_updatecreds }; #endif /* KRB5 */ diff --git a/gss-serv.c b/gss-serv.c index ab3a15f0f..6c087a1b1 100644 --- a/gss-serv.c +++ b/gss-serv.c @@ -1,7 +1,7 @@ /* $OpenBSD: gss-serv.c,v 1.31 2018/07/09 21:37:55 markus Exp $ */ /* - * Copyright (c) 2001-2003 Simon Wilkinson. All rights reserved. + * Copyright (c) 2001-2009 Simon Wilkinson. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -44,17 +44,22 @@ #include "session.h" #include "misc.h" #include "servconf.h" +#include "uidswap.h" #include "ssh-gss.h" +#include "monitor_wrap.h" + +extern ServerOptions options; extern ServerOptions options; static ssh_gssapi_client gssapi_client = { GSS_C_EMPTY_BUFFER, GSS_C_EMPTY_BUFFER, - GSS_C_NO_CREDENTIAL, NULL, {NULL, NULL, NULL, NULL}}; + GSS_C_NO_CREDENTIAL, GSS_C_NO_NAME, NULL, + {NULL, NULL, NULL, NULL, NULL}, 0, 0}; ssh_gssapi_mech gssapi_null_mech = - { NULL, NULL, {0, NULL}, NULL, NULL, NULL, NULL}; + { NULL, NULL, {0, NULL}, NULL, NULL, NULL, NULL, NULL}; #ifdef KRB5 extern ssh_gssapi_mech gssapi_kerberos_mech; @@ -140,6 +145,28 @@ ssh_gssapi_server_ctx(Gssctxt **ctx, gss_OID oid) return (ssh_gssapi_acquire_cred(*ctx)); } +/* Unprivileged */ +char * +ssh_gssapi_server_mechanisms(void) { + if (supported_oids == NULL) + ssh_gssapi_prepare_supported_oids(); + return (ssh_gssapi_kex_mechs(supported_oids, + &ssh_gssapi_server_check_mech, NULL, NULL)); +} + +/* Unprivileged */ +int +ssh_gssapi_server_check_mech(Gssctxt **dum, gss_OID oid, const char *data, + const char *dummy) { + Gssctxt *ctx = NULL; + int res; + + res = !GSS_ERROR(PRIVSEP(ssh_gssapi_server_ctx(&ctx, oid))); + ssh_gssapi_delete_ctx(&ctx); + + return (res); +} + /* Unprivileged */ void ssh_gssapi_supported_oids(gss_OID_set *oidset) @@ -150,7 +177,9 @@ ssh_gssapi_supported_oids(gss_OID_set *oidset) gss_OID_set supported; gss_create_empty_oid_set(&min_status, oidset); - gss_indicate_mechs(&min_status, &supported); + + if (GSS_ERROR(gss_indicate_mechs(&min_status, &supported))) + return; while (supported_mechs[i]->name != NULL) { if (GSS_ERROR(gss_test_oid_set_member(&min_status, @@ -276,8 +305,48 @@ OM_uint32 ssh_gssapi_getclient(Gssctxt *ctx, ssh_gssapi_client *client) { int i = 0; + int equal = 0; + gss_name_t new_name = GSS_C_NO_NAME; + gss_buffer_desc ename = GSS_C_EMPTY_BUFFER; + + if (options.gss_store_rekey && client->used && ctx->client_creds) { + if (client->mech->oid.length != ctx->oid->length || + (memcmp(client->mech->oid.elements, + ctx->oid->elements, ctx->oid->length) !=0)) { + debug("Rekeyed credentials have different mechanism"); + return GSS_S_COMPLETE; + } + + if ((ctx->major = gss_inquire_cred_by_mech(&ctx->minor, + ctx->client_creds, ctx->oid, &new_name, + NULL, NULL, NULL))) { + ssh_gssapi_error(ctx); + return (ctx->major); + } + + ctx->major = gss_compare_name(&ctx->minor, client->name, + new_name, &equal); + + if (GSS_ERROR(ctx->major)) { + ssh_gssapi_error(ctx); + return (ctx->major); + } + + if (!equal) { + debug("Rekeyed credentials have different name"); + return GSS_S_COMPLETE; + } - gss_buffer_desc ename; + debug("Marking rekeyed credentials for export"); + + gss_release_name(&ctx->minor, &client->name); + gss_release_cred(&ctx->minor, &client->creds); + client->name = new_name; + client->creds = ctx->client_creds; + ctx->client_creds = GSS_C_NO_CREDENTIAL; + client->updated = 1; + return GSS_S_COMPLETE; + } client->mech = NULL; @@ -292,6 +361,13 @@ ssh_gssapi_getclient(Gssctxt *ctx, ssh_gssapi_client *client) if (client->mech == NULL) return GSS_S_FAILURE; + if (ctx->client_creds && + (ctx->major = gss_inquire_cred_by_mech(&ctx->minor, + ctx->client_creds, ctx->oid, &client->name, NULL, NULL, NULL))) { + ssh_gssapi_error(ctx); + return (ctx->major); + } + if ((ctx->major = gss_display_name(&ctx->minor, ctx->client, &client->displayname, NULL))) { ssh_gssapi_error(ctx); @@ -309,6 +385,8 @@ ssh_gssapi_getclient(Gssctxt *ctx, ssh_gssapi_client *client) return (ctx->major); } + gss_release_buffer(&ctx->minor, &ename); + /* We can't copy this structure, so we just move the pointer to it */ client->creds = ctx->client_creds; ctx->client_creds = GSS_C_NO_CREDENTIAL; @@ -356,7 +434,7 @@ ssh_gssapi_do_child(char ***envp, u_int *envsizep) /* Privileged */ int -ssh_gssapi_userok(char *user) +ssh_gssapi_userok(char *user, struct passwd *pw) { OM_uint32 lmin; @@ -366,9 +444,11 @@ ssh_gssapi_userok(char *user) return 0; } if (gssapi_client.mech && gssapi_client.mech->userok) - if ((*gssapi_client.mech->userok)(&gssapi_client, user)) + if ((*gssapi_client.mech->userok)(&gssapi_client, user)) { + gssapi_client.used = 1; + gssapi_client.store.owner = pw; return 1; - else { + } else { /* Destroy delegated credentials if userok fails */ gss_release_buffer(&lmin, &gssapi_client.displayname); gss_release_buffer(&lmin, &gssapi_client.exportedname); @@ -382,14 +462,90 @@ ssh_gssapi_userok(char *user) return (0); } -/* Privileged */ -OM_uint32 -ssh_gssapi_checkmic(Gssctxt *ctx, gss_buffer_t gssbuf, gss_buffer_t gssmic) +/* These bits are only used for rekeying. The unpriviledged child is running + * as the user, the monitor is root. + * + * In the child, we want to : + * *) Ask the monitor to store our credentials into the store we specify + * *) If it succeeds, maybe do a PAM update + */ + +/* Stuff for PAM */ + +#ifdef USE_PAM +static int ssh_gssapi_simple_conv(int n, const struct pam_message **msg, + struct pam_response **resp, void *data) { - ctx->major = gss_verify_mic(&ctx->minor, ctx->context, - gssbuf, gssmic, NULL); + return (PAM_CONV_ERR); +} +#endif - return (ctx->major); +void +ssh_gssapi_rekey_creds(void) { + int ok; + int ret; +#ifdef USE_PAM + pam_handle_t *pamh = NULL; + struct pam_conv pamconv = {ssh_gssapi_simple_conv, NULL}; + char *envstr; +#endif + + if (gssapi_client.store.filename == NULL && + gssapi_client.store.envval == NULL && + gssapi_client.store.envvar == NULL) + return; + + ok = PRIVSEP(ssh_gssapi_update_creds(&gssapi_client.store)); + + if (!ok) + return; + + debug("Rekeyed credentials stored successfully"); + + /* Actually managing to play with the ssh pam stack from here will + * be next to impossible. In any case, we may want different options + * for rekeying. So, use our own :) + */ +#ifdef USE_PAM + if (!use_privsep) { + debug("Not even going to try and do PAM with privsep disabled"); + return; + } + + ret = pam_start("sshd-rekey", gssapi_client.store.owner->pw_name, + &pamconv, &pamh); + if (ret) + return; + + xasprintf(&envstr, "%s=%s", gssapi_client.store.envvar, + gssapi_client.store.envval); + + ret = pam_putenv(pamh, envstr); + if (!ret) + pam_setcred(pamh, PAM_REINITIALIZE_CRED); + pam_end(pamh, PAM_SUCCESS); +#endif +} + +int +ssh_gssapi_update_creds(ssh_gssapi_ccache *store) { + int ok = 0; + + /* Check we've got credentials to store */ + if (!gssapi_client.updated) + return 0; + + gssapi_client.updated = 0; + + temporarily_use_uid(gssapi_client.store.owner); + if (gssapi_client.mech && gssapi_client.mech->updatecreds) + ok = (*gssapi_client.mech->updatecreds)(store, &gssapi_client); + else + debug("No update function for this mechanism"); + + restore_uid(); + + return ok; } /* Privileged */ diff --git a/kex.c b/kex.c index 25f9f66f6..fb5bfaea5 100644 --- a/kex.c +++ b/kex.c @@ -54,6 +54,10 @@ #include "sshbuf.h" #include "digest.h" +#ifdef GSSAPI +#include "ssh-gss.h" +#endif + /* prototype */ static int kex_choose_conf(struct ssh *); static int kex_input_newkeys(int, u_int32_t, struct ssh *); @@ -105,6 +109,14 @@ static const struct kexalg kexalgs[] = { #endif /* HAVE_EVP_SHA256 || !WITH_OPENSSL */ { NULL, -1, -1, -1}, }; +static const struct kexalg kexalg_prefixes[] = { +#ifdef GSSAPI + { KEX_GSS_GEX_SHA1_ID, KEX_GSS_GEX_SHA1, 0, SSH_DIGEST_SHA1 }, + { KEX_GSS_GRP1_SHA1_ID, KEX_GSS_GRP1_SHA1, 0, SSH_DIGEST_SHA1 }, + { KEX_GSS_GRP14_SHA1_ID, KEX_GSS_GRP14_SHA1, 0, SSH_DIGEST_SHA1 }, +#endif + { NULL, -1, -1, -1 }, +}; char * kex_alg_list(char sep) @@ -137,6 +149,10 @@ kex_alg_by_name(const char *name) if (strcmp(k->name, name) == 0) return k; } + for (k = kexalg_prefixes; k->name != NULL; k++) { + if (strncmp(k->name, name, strlen(k->name)) == 0) + return k; + } return NULL; } @@ -653,6 +669,9 @@ kex_free(struct kex *kex) sshbuf_free(kex->peer); sshbuf_free(kex->my); free(kex->session_id); +#ifdef GSSAPI + free(kex->gss_host); +#endif /* GSSAPI */ free(kex->client_version_string); free(kex->server_version_string); free(kex->failed_choice); diff --git a/kex.h b/kex.h index 593de1208..4e5ead839 100644 --- a/kex.h +++ b/kex.h @@ -100,6 +100,9 @@ enum kex_exchange { KEX_DH_GEX_SHA256, KEX_ECDH_SHA2, KEX_C25519_SHA256, + KEX_GSS_GRP1_SHA1, + KEX_GSS_GRP14_SHA1, + KEX_GSS_GEX_SHA1, KEX_MAX }; @@ -148,6 +151,12 @@ struct kex { u_int flags; int hash_alg; int ec_nid; +#ifdef GSSAPI + int gss_deleg_creds; + int gss_trust_dns; + char *gss_host; + char *gss_client; +#endif char *client_version_string; char *server_version_string; char *failed_choice; @@ -198,6 +207,11 @@ int kexecdh_server(struct ssh *); int kexc25519_client(struct ssh *); int kexc25519_server(struct ssh *); +#ifdef GSSAPI +int kexgss_client(struct ssh *); +int kexgss_server(struct ssh *); +#endif + int kex_dh_hash(int, const char *, const char *, const u_char *, size_t, const u_char *, size_t, const u_char *, size_t, const BIGNUM *, const BIGNUM *, const BIGNUM *, u_char *, size_t *); diff --git a/kexgssc.c b/kexgssc.c new file mode 100644 index 000000000..953c0a248 --- /dev/null +++ b/kexgssc.c @@ -0,0 +1,338 @@ +/* + * Copyright (c) 2001-2009 Simon Wilkinson. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR `AS IS'' AND ANY EXPRESS OR + * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +#include "includes.h" + +#ifdef GSSAPI + +#include "includes.h" + +#include +#include + +#include + +#include "xmalloc.h" +#include "sshbuf.h" +#include "ssh2.h" +#include "sshkey.h" +#include "cipher.h" +#include "kex.h" +#include "log.h" +#include "packet.h" +#include "dh.h" +#include "digest.h" + +#include "ssh-gss.h" + +int +kexgss_client(struct ssh *ssh) { + gss_buffer_desc send_tok = GSS_C_EMPTY_BUFFER; + gss_buffer_desc recv_tok, gssbuf, msg_tok, *token_ptr; + Gssctxt *ctxt; + OM_uint32 maj_status, min_status, ret_flags; + u_int klen, kout, slen = 0, strlen; + DH *dh; + BIGNUM *dh_server_pub = NULL; + BIGNUM *shared_secret = NULL; + BIGNUM *p = NULL; + BIGNUM *g = NULL; + u_char *kbuf; + u_char *serverhostkey = NULL; + u_char *empty = ""; + char *msg; + int type = 0; + int first = 1; + int nbits = 0, min = DH_GRP_MIN, max = DH_GRP_MAX; + u_char hash[SSH_DIGEST_MAX_LENGTH]; + size_t hashlen; + + /* Initialise our GSSAPI world */ + ssh_gssapi_build_ctx(&ctxt); + if (ssh_gssapi_id_kex(ctxt, ssh->kex->name, ssh->kex->kex_type) + == GSS_C_NO_OID) + fatal("Couldn't identify host exchange"); + + if (ssh_gssapi_import_name(ctxt, ssh->kex->gss_host)) + fatal("Couldn't import hostname"); + + if (ssh->kex->gss_client && + ssh_gssapi_client_identity(ctxt, ssh->kex->gss_client)) + fatal("Couldn't acquire client credentials"); + + switch (ssh->kex->kex_type) { + case KEX_GSS_GRP1_SHA1: + dh = dh_new_group1(); + break; + case KEX_GSS_GRP14_SHA1: + dh = dh_new_group14(); + break; + case KEX_GSS_GEX_SHA1: + debug("Doing group exchange\n"); + nbits = dh_estimate(ssh->kex->we_need * 8); + packet_start(SSH2_MSG_KEXGSS_GROUPREQ); + packet_put_int(min); + packet_put_int(nbits); + packet_put_int(max); + + packet_send(); + + packet_read_expect(SSH2_MSG_KEXGSS_GROUP); + + if ((p = BN_new()) == NULL) + fatal("BN_new() failed"); + packet_get_bignum2(p); + if ((g = BN_new()) == NULL) + fatal("BN_new() failed"); + packet_get_bignum2(g); + packet_check_eom(); + + if (BN_num_bits(p) < min || BN_num_bits(p) > max) + fatal("GSSGRP_GEX group out of range: %d !< %d !< %d", + min, BN_num_bits(p), max); + + dh = dh_new_group(g, p); + break; + default: + fatal("%s: Unexpected KEX type %d", __func__, ssh->kex->kex_type); + } + + /* Step 1 - e is dh->pub_key */ + dh_gen_key(dh, ssh->kex->we_need * 8); + + /* This is f, we initialise it now to make life easier */ + dh_server_pub = BN_new(); + if (dh_server_pub == NULL) + fatal("dh_server_pub == NULL"); + + token_ptr = GSS_C_NO_BUFFER; + + do { + debug("Calling gss_init_sec_context"); + + maj_status = ssh_gssapi_init_ctx(ctxt, + ssh->kex->gss_deleg_creds, token_ptr, &send_tok, + &ret_flags); + + if (GSS_ERROR(maj_status)) { + if (send_tok.length != 0) { + packet_start(SSH2_MSG_KEXGSS_CONTINUE); + packet_put_string(send_tok.value, + send_tok.length); + } + fatal("gss_init_context failed"); + } + + /* If we've got an old receive buffer get rid of it */ + if (token_ptr != GSS_C_NO_BUFFER) + free(recv_tok.value); + + if (maj_status == GSS_S_COMPLETE) { + /* If mutual state flag is not true, kex fails */ + if (!(ret_flags & GSS_C_MUTUAL_FLAG)) + fatal("Mutual authentication failed"); + + /* If integ avail flag is not true kex fails */ + if (!(ret_flags & GSS_C_INTEG_FLAG)) + fatal("Integrity check failed"); + } + + /* + * If we have data to send, then the last message that we + * received cannot have been a 'complete'. + */ + if (send_tok.length != 0) { + if (first) { + packet_start(SSH2_MSG_KEXGSS_INIT); + packet_put_string(send_tok.value, + send_tok.length); + packet_put_bignum2(dh->pub_key); + first = 0; + } else { + packet_start(SSH2_MSG_KEXGSS_CONTINUE); + packet_put_string(send_tok.value, + send_tok.length); + } + packet_send(); + gss_release_buffer(&min_status, &send_tok); + + /* If we've sent them data, they should reply */ + do { + type = packet_read(); + if (type == SSH2_MSG_KEXGSS_HOSTKEY) { + debug("Received KEXGSS_HOSTKEY"); + if (serverhostkey) + fatal("Server host key received more than once"); + serverhostkey = + packet_get_string(&slen); + } + } while (type == SSH2_MSG_KEXGSS_HOSTKEY); + + switch (type) { + case SSH2_MSG_KEXGSS_CONTINUE: + debug("Received GSSAPI_CONTINUE"); + if (maj_status == GSS_S_COMPLETE) + fatal("GSSAPI Continue received from server when complete"); + recv_tok.value = packet_get_string(&strlen); + recv_tok.length = strlen; + break; + case SSH2_MSG_KEXGSS_COMPLETE: + debug("Received GSSAPI_COMPLETE"); + packet_get_bignum2(dh_server_pub); + msg_tok.value = packet_get_string(&strlen); + msg_tok.length = strlen; + + /* Is there a token included? */ + if (packet_get_char()) { + recv_tok.value= + packet_get_string(&strlen); + recv_tok.length = strlen; + /* If we're already complete - protocol error */ + if (maj_status == GSS_S_COMPLETE) + packet_disconnect("Protocol error: received token when complete"); + } else { + /* No token included */ + if (maj_status != GSS_S_COMPLETE) + packet_disconnect("Protocol error: did not receive final token"); + } + break; + case SSH2_MSG_KEXGSS_ERROR: + debug("Received Error"); + maj_status = packet_get_int(); + min_status = packet_get_int(); + msg = packet_get_string(NULL); + (void) packet_get_string_ptr(NULL); + fatal("GSSAPI Error: \n%.400s",msg); + default: + packet_disconnect("Protocol error: didn't expect packet type %d", + type); + } + token_ptr = &recv_tok; + } else { + /* No data, and not complete */ + if (maj_status != GSS_S_COMPLETE) + fatal("Not complete, and no token output"); + } + } while (maj_status & GSS_S_CONTINUE_NEEDED); + + /* + * We _must_ have received a COMPLETE message in reply from the + * server, which will have set dh_server_pub and msg_tok + */ + + if (type != SSH2_MSG_KEXGSS_COMPLETE) + fatal("Didn't receive a SSH2_MSG_KEXGSS_COMPLETE when I expected it"); + + /* Check f in range [1, p-1] */ + if (!dh_pub_is_valid(dh, dh_server_pub)) + packet_disconnect("bad server public DH value"); + + /* compute K=f^x mod p */ + klen = DH_size(dh); + kbuf = xmalloc(klen); + kout = DH_compute_key(kbuf, dh_server_pub, dh); + if (kout < 0) + fatal("DH_compute_key: failed"); + + shared_secret = BN_new(); + if (shared_secret == NULL) + fatal("kexgss_client: BN_new failed"); + + if (BN_bin2bn(kbuf, kout, shared_secret) == NULL) + fatal("kexdh_client: BN_bin2bn failed"); + + memset(kbuf, 0, klen); + free(kbuf); + + hashlen = sizeof(hash); + switch (ssh->kex->kex_type) { + case KEX_GSS_GRP1_SHA1: + case KEX_GSS_GRP14_SHA1: + kex_dh_hash( + ssh->kex->hash_alg, + ssh->kex->client_version_string, + ssh->kex->server_version_string, + sshbuf_ptr(ssh->kex->my), sshbuf_len(ssh->kex->my), + sshbuf_ptr(ssh->kex->peer), sshbuf_len(ssh->kex->peer), + (serverhostkey ? serverhostkey : empty), slen, + dh->pub_key, /* e */ + dh_server_pub, /* f */ + shared_secret, /* K */ + hash, &hashlen + ); + break; + case KEX_GSS_GEX_SHA1: + kexgex_hash( + ssh->kex->hash_alg, + ssh->kex->client_version_string, + ssh->kex->server_version_string, + sshbuf_ptr(ssh->kex->my), sshbuf_len(ssh->kex->my), + sshbuf_ptr(ssh->kex->peer), sshbuf_len(ssh->kex->peer), + (serverhostkey ? serverhostkey : empty), slen, + min, nbits, max, + dh->p, dh->g, + dh->pub_key, + dh_server_pub, + shared_secret, + hash, &hashlen + ); + break; + default: + fatal("%s: Unexpected KEX type %d", __func__, ssh->kex->kex_type); + } + + gssbuf.value = hash; + gssbuf.length = hashlen; + + /* Verify that the hash matches the MIC we just got. */ + if (GSS_ERROR(ssh_gssapi_checkmic(ctxt, &gssbuf, &msg_tok))) + packet_disconnect("Hash's MIC didn't verify"); + + free(msg_tok.value); + + DH_free(dh); + free(serverhostkey); + BN_clear_free(dh_server_pub); + + /* save session id */ + if (ssh->kex->session_id == NULL) { + ssh->kex->session_id_len = hashlen; + ssh->kex->session_id = xmalloc(ssh->kex->session_id_len); + memcpy(ssh->kex->session_id, hash, ssh->kex->session_id_len); + } + + if (ssh->kex->gss_deleg_creds) + ssh_gssapi_credentials_updated(ctxt); + + if (gss_kex_context == NULL) + gss_kex_context = ctxt; + else + ssh_gssapi_delete_ctx(&ctxt); + + kex_derive_keys_bn(ssh, hash, hashlen, shared_secret); + BN_clear_free(shared_secret); + return kex_send_newkeys(ssh); +} + +#endif /* GSSAPI */ diff --git a/kexgsss.c b/kexgsss.c new file mode 100644 index 000000000..31ec6a890 --- /dev/null +++ b/kexgsss.c @@ -0,0 +1,295 @@ +/* + * Copyright (c) 2001-2009 Simon Wilkinson. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR `AS IS'' AND ANY EXPRESS OR + * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +#include "includes.h" + +#ifdef GSSAPI + +#include + +#include +#include + +#include "xmalloc.h" +#include "sshbuf.h" +#include "ssh2.h" +#include "sshkey.h" +#include "cipher.h" +#include "kex.h" +#include "log.h" +#include "packet.h" +#include "dh.h" +#include "ssh-gss.h" +#include "monitor_wrap.h" +#include "misc.h" +#include "servconf.h" +#include "digest.h" + +extern ServerOptions options; + +int +kexgss_server(struct ssh *ssh) +{ + OM_uint32 maj_status, min_status; + + /* + * Some GSSAPI implementations use the input value of ret_flags (an + * output variable) as a means of triggering mechanism specific + * features. Initializing it to zero avoids inadvertently + * activating this non-standard behaviour. + */ + + OM_uint32 ret_flags = 0; + gss_buffer_desc gssbuf, recv_tok, msg_tok; + gss_buffer_desc send_tok = GSS_C_EMPTY_BUFFER; + Gssctxt *ctxt = NULL; + u_int slen, klen, kout; + u_char *kbuf; + DH *dh; + int min = -1, max = -1, nbits = -1; + BIGNUM *shared_secret = NULL; + BIGNUM *dh_client_pub = NULL; + int type = 0; + gss_OID oid; + char *mechs; + u_char hash[SSH_DIGEST_MAX_LENGTH]; + size_t hashlen; + + /* Initialise GSSAPI */ + + /* If we're rekeying, privsep means that some of the private structures + * in the GSSAPI code are no longer available. This kludges them back + * into life + */ + if (!ssh_gssapi_oid_table_ok()) { + mechs = ssh_gssapi_server_mechanisms(); + free(mechs); + } + + debug2("%s: Identifying %s", __func__, ssh->kex->name); + oid = ssh_gssapi_id_kex(NULL, ssh->kex->name, ssh->kex->kex_type); + if (oid == GSS_C_NO_OID) + fatal("Unknown gssapi mechanism"); + + debug2("%s: Acquiring credentials", __func__); + + if (GSS_ERROR(PRIVSEP(ssh_gssapi_server_ctx(&ctxt, oid)))) + fatal("Unable to acquire credentials for the server"); + + switch (ssh->kex->kex_type) { + case KEX_GSS_GRP1_SHA1: + dh = dh_new_group1(); + break; + case KEX_GSS_GRP14_SHA1: + dh = dh_new_group14(); + break; + case KEX_GSS_GEX_SHA1: + debug("Doing group exchange"); + packet_read_expect(SSH2_MSG_KEXGSS_GROUPREQ); + min = packet_get_int(); + nbits = packet_get_int(); + max = packet_get_int(); + packet_check_eom(); + if (max < min || nbits < min || max < nbits) + fatal("GSS_GEX, bad parameters: %d !< %d !< %d", + min, nbits, max); + dh = PRIVSEP(choose_dh(MAX(DH_GRP_MIN, min), + nbits, MIN(DH_GRP_MAX, max))); + if (dh == NULL) + packet_disconnect("Protocol error: no matching group found"); + + packet_start(SSH2_MSG_KEXGSS_GROUP); + packet_put_bignum2(dh->p); + packet_put_bignum2(dh->g); + packet_send(); + + packet_write_wait(); + break; + default: + fatal("%s: Unexpected KEX type %d", __func__, ssh->kex->kex_type); + } + + dh_gen_key(dh, ssh->kex->we_need * 8); + + do { + debug("Wait SSH2_MSG_GSSAPI_INIT"); + type = packet_read(); + switch(type) { + case SSH2_MSG_KEXGSS_INIT: + if (dh_client_pub != NULL) + fatal("Received KEXGSS_INIT after initialising"); + recv_tok.value = packet_get_string(&slen); + recv_tok.length = slen; + + if ((dh_client_pub = BN_new()) == NULL) + fatal("dh_client_pub == NULL"); + + packet_get_bignum2(dh_client_pub); + + /* Send SSH_MSG_KEXGSS_HOSTKEY here, if we want */ + break; + case SSH2_MSG_KEXGSS_CONTINUE: + recv_tok.value = packet_get_string(&slen); + recv_tok.length = slen; + break; + default: + packet_disconnect( + "Protocol error: didn't expect packet type %d", + type); + } + + maj_status = PRIVSEP(ssh_gssapi_accept_ctx(ctxt, &recv_tok, + &send_tok, &ret_flags)); + + free(recv_tok.value); + + if (maj_status != GSS_S_COMPLETE && send_tok.length == 0) + fatal("Zero length token output when incomplete"); + + if (dh_client_pub == NULL) + fatal("No client public key"); + + if (maj_status & GSS_S_CONTINUE_NEEDED) { + debug("Sending GSSAPI_CONTINUE"); + packet_start(SSH2_MSG_KEXGSS_CONTINUE); + packet_put_string(send_tok.value, send_tok.length); + packet_send(); + gss_release_buffer(&min_status, &send_tok); + } + } while (maj_status & GSS_S_CONTINUE_NEEDED); + + if (GSS_ERROR(maj_status)) { + if (send_tok.length > 0) { + packet_start(SSH2_MSG_KEXGSS_CONTINUE); + packet_put_string(send_tok.value, send_tok.length); + packet_send(); + } + fatal("accept_ctx died"); + } + + if (!(ret_flags & GSS_C_MUTUAL_FLAG)) + fatal("Mutual Authentication flag wasn't set"); + + if (!(ret_flags & GSS_C_INTEG_FLAG)) + fatal("Integrity flag wasn't set"); + + if (!dh_pub_is_valid(dh, dh_client_pub)) + packet_disconnect("bad client public DH value"); + + klen = DH_size(dh); + kbuf = xmalloc(klen); + kout = DH_compute_key(kbuf, dh_client_pub, dh); + if (kout < 0) + fatal("DH_compute_key: failed"); + + shared_secret = BN_new(); + if (shared_secret == NULL) + fatal("kexgss_server: BN_new failed"); + + if (BN_bin2bn(kbuf, kout, shared_secret) == NULL) + fatal("kexgss_server: BN_bin2bn failed"); + + memset(kbuf, 0, klen); + free(kbuf); + + hashlen = sizeof(hash); + switch (ssh->kex->kex_type) { + case KEX_GSS_GRP1_SHA1: + case KEX_GSS_GRP14_SHA1: + kex_dh_hash( + ssh->kex->hash_alg, + ssh->kex->client_version_string, ssh->kex->server_version_string, + sshbuf_ptr(ssh->kex->peer), sshbuf_len(ssh->kex->peer), + sshbuf_ptr(ssh->kex->my), sshbuf_len(ssh->kex->my), + NULL, 0, /* Change this if we start sending host keys */ + dh_client_pub, dh->pub_key, shared_secret, + hash, &hashlen + ); + break; + case KEX_GSS_GEX_SHA1: + kexgex_hash( + ssh->kex->hash_alg, + ssh->kex->client_version_string, ssh->kex->server_version_string, + sshbuf_ptr(ssh->kex->peer), sshbuf_len(ssh->kex->peer), + sshbuf_ptr(ssh->kex->my), sshbuf_len(ssh->kex->my), + NULL, 0, + min, nbits, max, + dh->p, dh->g, + dh_client_pub, + dh->pub_key, + shared_secret, + hash, &hashlen + ); + break; + default: + fatal("%s: Unexpected KEX type %d", __func__, ssh->kex->kex_type); + } + + BN_clear_free(dh_client_pub); + + if (ssh->kex->session_id == NULL) { + ssh->kex->session_id_len = hashlen; + ssh->kex->session_id = xmalloc(ssh->kex->session_id_len); + memcpy(ssh->kex->session_id, hash, ssh->kex->session_id_len); + } + + gssbuf.value = hash; + gssbuf.length = hashlen; + + if (GSS_ERROR(PRIVSEP(ssh_gssapi_sign(ctxt,&gssbuf,&msg_tok)))) + fatal("Couldn't get MIC"); + + packet_start(SSH2_MSG_KEXGSS_COMPLETE); + packet_put_bignum2(dh->pub_key); + packet_put_string(msg_tok.value,msg_tok.length); + + if (send_tok.length != 0) { + packet_put_char(1); /* true */ + packet_put_string(send_tok.value, send_tok.length); + } else { + packet_put_char(0); /* false */ + } + packet_send(); + + gss_release_buffer(&min_status, &send_tok); + gss_release_buffer(&min_status, &msg_tok); + + if (gss_kex_context == NULL) + gss_kex_context = ctxt; + else + ssh_gssapi_delete_ctx(&ctxt); + + DH_free(dh); + + kex_derive_keys_bn(ssh, hash, hashlen, shared_secret); + BN_clear_free(shared_secret); + kex_send_newkeys(ssh); + + /* If this was a rekey, then save out any delegated credentials we + * just exchanged. */ + if (options.gss_store_rekey) + ssh_gssapi_rekey_creds(); + return 0; +} +#endif /* GSSAPI */ diff --git a/monitor.c b/monitor.c index d4b4b0471..4e574a2ae 100644 --- a/monitor.c +++ b/monitor.c @@ -143,6 +143,8 @@ int mm_answer_gss_setup_ctx(int, struct sshbuf *); int mm_answer_gss_accept_ctx(int, struct sshbuf *); int mm_answer_gss_userok(int, struct sshbuf *); int mm_answer_gss_checkmic(int, struct sshbuf *); +int mm_answer_gss_sign(int, struct sshbuf *); +int mm_answer_gss_updatecreds(int, struct sshbuf *); #endif #ifdef SSH_AUDIT_EVENTS @@ -213,11 +215,18 @@ struct mon_table mon_dispatch_proto20[] = { {MONITOR_REQ_GSSSTEP, 0, mm_answer_gss_accept_ctx}, {MONITOR_REQ_GSSUSEROK, MON_ONCE|MON_AUTHDECIDE, mm_answer_gss_userok}, {MONITOR_REQ_GSSCHECKMIC, MON_ONCE, mm_answer_gss_checkmic}, + {MONITOR_REQ_GSSSIGN, MON_ONCE, mm_answer_gss_sign}, #endif {0, 0, NULL} }; struct mon_table mon_dispatch_postauth20[] = { +#ifdef GSSAPI + {MONITOR_REQ_GSSSETUP, 0, mm_answer_gss_setup_ctx}, + {MONITOR_REQ_GSSSTEP, 0, mm_answer_gss_accept_ctx}, + {MONITOR_REQ_GSSSIGN, 0, mm_answer_gss_sign}, + {MONITOR_REQ_GSSUPCREDS, 0, mm_answer_gss_updatecreds}, +#endif #ifdef WITH_OPENSSL {MONITOR_REQ_MODULI, 0, mm_answer_moduli}, #endif @@ -287,6 +296,10 @@ monitor_child_preauth(Authctxt *_authctxt, struct monitor *pmonitor) /* Permit requests for moduli and signatures */ monitor_permit(mon_dispatch, MONITOR_REQ_MODULI, 1); monitor_permit(mon_dispatch, MONITOR_REQ_SIGN, 1); +#ifdef GSSAPI + /* and for the GSSAPI key exchange */ + monitor_permit(mon_dispatch, MONITOR_REQ_GSSSETUP, 1); +#endif /* The first few requests do not require asynchronous access */ while (!authenticated) { @@ -399,6 +412,10 @@ monitor_child_postauth(struct monitor *pmonitor) monitor_permit(mon_dispatch, MONITOR_REQ_MODULI, 1); monitor_permit(mon_dispatch, MONITOR_REQ_SIGN, 1); monitor_permit(mon_dispatch, MONITOR_REQ_TERM, 1); +#ifdef GSSAPI + /* and for the GSSAPI key exchange */ + monitor_permit(mon_dispatch, MONITOR_REQ_GSSSETUP, 1); +#endif if (auth_opts->permit_pty_flag) { monitor_permit(mon_dispatch, MONITOR_REQ_PTY, 1); @@ -1662,6 +1679,13 @@ monitor_apply_keystate(struct monitor *pmonitor) # endif #endif /* WITH_OPENSSL */ kex->kex[KEX_C25519_SHA256] = kexc25519_server; +#ifdef GSSAPI + if (options.gss_keyex) { + kex->kex[KEX_GSS_GRP1_SHA1] = kexgss_server; + kex->kex[KEX_GSS_GRP14_SHA1] = kexgss_server; + kex->kex[KEX_GSS_GEX_SHA1] = kexgss_server; + } +#endif kex->load_host_public_key=&get_hostkey_public_by_type; kex->load_host_private_key=&get_hostkey_private_by_type; kex->host_key_index=&get_hostkey_index; @@ -1752,8 +1776,8 @@ mm_answer_gss_setup_ctx(int sock, struct sshbuf *m) u_char *p; int r; - if (!options.gss_authentication) - fatal("%s: GSSAPI authentication not enabled", __func__); + if (!options.gss_authentication && !options.gss_keyex) + fatal("%s: GSSAPI not enabled", __func__); if ((r = sshbuf_get_string(m, &p, &len)) != 0) fatal("%s: buffer error: %s", __func__, ssh_err(r)); @@ -1785,8 +1809,8 @@ mm_answer_gss_accept_ctx(int sock, struct sshbuf *m) OM_uint32 flags = 0; /* GSI needs this */ int r; - if (!options.gss_authentication) - fatal("%s: GSSAPI authentication not enabled", __func__); + if (!options.gss_authentication && !options.gss_keyex) + fatal("%s: GSSAPI not enabled", __func__); if ((r = ssh_gssapi_get_buffer_desc(m, &in)) != 0) fatal("%s: buffer error: %s", __func__, ssh_err(r)); @@ -1806,6 +1830,7 @@ mm_answer_gss_accept_ctx(int sock, struct sshbuf *m) monitor_permit(mon_dispatch, MONITOR_REQ_GSSSTEP, 0); monitor_permit(mon_dispatch, MONITOR_REQ_GSSUSEROK, 1); monitor_permit(mon_dispatch, MONITOR_REQ_GSSCHECKMIC, 1); + monitor_permit(mon_dispatch, MONITOR_REQ_GSSSIGN, 1); } return (0); } @@ -1817,8 +1842,8 @@ mm_answer_gss_checkmic(int sock, struct sshbuf *m) OM_uint32 ret; int r; - if (!options.gss_authentication) - fatal("%s: GSSAPI authentication not enabled", __func__); + if (!options.gss_authentication && !options.gss_keyex) + fatal("%s: GSSAPI not enabled", __func__); if ((r = ssh_gssapi_get_buffer_desc(m, &gssbuf)) != 0 || (r = ssh_gssapi_get_buffer_desc(m, &mic)) != 0) @@ -1847,10 +1872,11 @@ mm_answer_gss_userok(int sock, struct sshbuf *m) int r, authenticated; const char *displayname; - if (!options.gss_authentication) - fatal("%s: GSSAPI authentication not enabled", __func__); + if (!options.gss_authentication && !options.gss_keyex) + fatal("%s: GSSAPI not enabled", __func__); - authenticated = authctxt->valid && ssh_gssapi_userok(authctxt->user); + authenticated = authctxt->valid && + ssh_gssapi_userok(authctxt->user, authctxt->pw); sshbuf_reset(m); if ((r = sshbuf_put_u32(m, authenticated)) != 0) @@ -1867,5 +1893,83 @@ mm_answer_gss_userok(int sock, struct sshbuf *m) /* Monitor loop will terminate if authenticated */ return (authenticated); } + +int +mm_answer_gss_sign(int socket, struct sshbuf *m) +{ + gss_buffer_desc data; + gss_buffer_desc hash = GSS_C_EMPTY_BUFFER; + OM_uint32 major, minor; + size_t len; + u_char *p; + int r; + + if (!options.gss_authentication && !options.gss_keyex) + fatal("%s: GSSAPI not enabled", __func__); + + if ((r = sshbuf_get_string(m, &p, &len)) != 0) + fatal("%s: buffer error: %s", __func__, ssh_err(r)); + data.value = p; + data.length = len; + if (data.length != 20) + fatal("%s: data length incorrect: %d", __func__, + (int) data.length); + + /* Save the session ID on the first time around */ + if (session_id2_len == 0) { + session_id2_len = data.length; + session_id2 = xmalloc(session_id2_len); + memcpy(session_id2, data.value, session_id2_len); + } + major = ssh_gssapi_sign(gsscontext, &data, &hash); + + free(data.value); + + sshbuf_reset(m); + if ((r = sshbuf_put_u32(m, major)) != 0 || + (r = sshbuf_put_string(m, hash.value, hash.length)) != 0) + fatal("%s: buffer error: %s", __func__, ssh_err(r)); + + mm_request_send(socket, MONITOR_ANS_GSSSIGN, m); + + gss_release_buffer(&minor, &hash); + + /* Turn on getpwnam permissions */ + monitor_permit(mon_dispatch, MONITOR_REQ_PWNAM, 1); + + /* And credential updating, for when rekeying */ + monitor_permit(mon_dispatch, MONITOR_REQ_GSSUPCREDS, 1); + + return (0); +} + +int +mm_answer_gss_updatecreds(int socket, struct sshbuf *m) { + ssh_gssapi_ccache store; + int r, ok; + + if (!options.gss_authentication && !options.gss_keyex) + fatal("%s: GSSAPI not enabled", __func__); + + if ((r = sshbuf_get_cstring(m, &store.filename, NULL)) != 0 || + (r = sshbuf_get_cstring(m, &store.envvar, NULL)) != 0 || + (r = sshbuf_get_cstring(m, &store.envval, NULL)) != 0) + fatal("%s: buffer error: %s", __func__, ssh_err(r)); + + ok = ssh_gssapi_update_creds(&store); + + free(store.filename); + free(store.envvar); + free(store.envval); + + sshbuf_reset(m); + if ((r = sshbuf_put_u32(m, ok)) != 0) + fatal("%s: buffer error: %s", __func__, ssh_err(r)); + + mm_request_send(socket, MONITOR_ANS_GSSUPCREDS, m); + + return(0); +} + #endif /* GSSAPI */ diff --git a/monitor.h b/monitor.h index 16047299f..44fbed589 100644 --- a/monitor.h +++ b/monitor.h @@ -63,6 +63,9 @@ enum monitor_reqtype { MONITOR_REQ_PAM_FREE_CTX = 110, MONITOR_ANS_PAM_FREE_CTX = 111, MONITOR_REQ_AUDIT_EVENT = 112, MONITOR_REQ_AUDIT_COMMAND = 113, + MONITOR_REQ_GSSSIGN = 150, MONITOR_ANS_GSSSIGN = 151, + MONITOR_REQ_GSSUPCREDS = 152, MONITOR_ANS_GSSUPCREDS = 153, + }; struct monitor { diff --git a/monitor_wrap.c b/monitor_wrap.c index 732fb3476..1865a122a 100644 --- a/monitor_wrap.c +++ b/monitor_wrap.c @@ -984,7 +984,7 @@ mm_ssh_gssapi_checkmic(Gssctxt *ctx, gss_buffer_t gssbuf, gss_buffer_t gssmic) } int -mm_ssh_gssapi_userok(char *user) +mm_ssh_gssapi_userok(char *user, struct passwd *pw) { struct sshbuf *m; int r, authenticated = 0; @@ -1003,4 +1003,55 @@ mm_ssh_gssapi_userok(char *user) debug3("%s: user %sauthenticated",__func__, authenticated ? "" : "not "); return (authenticated); } + +OM_uint32 +mm_ssh_gssapi_sign(Gssctxt *ctx, gss_buffer_desc *data, gss_buffer_desc *hash) +{ + struct sshbuf *m; + OM_uint32 major; + int r; + + if ((m = sshbuf_new()) == NULL) + fatal("%s: sshbuf_new failed", __func__); + if ((r = sshbuf_put_string(m, data->value, data->length)) != 0) + fatal("%s: buffer error: %s", __func__, ssh_err(r)); + + mm_request_send(pmonitor->m_recvfd, MONITOR_REQ_GSSSIGN, m); + mm_request_receive_expect(pmonitor->m_recvfd, MONITOR_ANS_GSSSIGN, m); + + if ((r = sshbuf_get_u32(m, &major)) != 0 || + (r = ssh_gssapi_get_buffer_desc(m, hash)) != 0) + fatal("%s: buffer error: %s", __func__, ssh_err(r)); + + sshbuf_free(m); + + return(major); +} + +int +mm_ssh_gssapi_update_creds(ssh_gssapi_ccache *store) +{ + struct sshbuf *m; + int r, ok; + + if ((m = sshbuf_new()) == NULL) + fatal("%s: sshbuf_new failed", __func__); + if ((r = sshbuf_put_cstring(m, + store->filename ? store->filename : "")) != 0 || + (r = sshbuf_put_cstring(m, + store->envvar ? store->envvar : "")) != 0 || + (r = sshbuf_put_cstring(m, + store->envval ? store->envval : "")) != 0) + fatal("%s: buffer error: %s", __func__, ssh_err(r)); + + mm_request_send(pmonitor->m_recvfd, MONITOR_REQ_GSSUPCREDS, m); + mm_request_receive_expect(pmonitor->m_recvfd, MONITOR_ANS_GSSUPCREDS, m); + + if ((r = sshbuf_get_u32(m, &ok)) != 0) + fatal("%s: buffer error: %s", __func__, ssh_err(r)); + sshbuf_free(m); + + return (ok); +} + #endif /* GSSAPI */ diff --git a/monitor_wrap.h b/monitor_wrap.h index 644da081d..7f93144ff 100644 --- a/monitor_wrap.h +++ b/monitor_wrap.h @@ -60,8 +60,10 @@ int mm_sshkey_verify(const struct sshkey *, const u_char *, size_t, OM_uint32 mm_ssh_gssapi_server_ctx(Gssctxt **, gss_OID); OM_uint32 mm_ssh_gssapi_accept_ctx(Gssctxt *, gss_buffer_desc *, gss_buffer_desc *, OM_uint32 *); -int mm_ssh_gssapi_userok(char *user); +int mm_ssh_gssapi_userok(char *user, struct passwd *); OM_uint32 mm_ssh_gssapi_checkmic(Gssctxt *, gss_buffer_t, gss_buffer_t); +OM_uint32 mm_ssh_gssapi_sign(Gssctxt *, gss_buffer_t, gss_buffer_t); +int mm_ssh_gssapi_update_creds(ssh_gssapi_ccache *); #endif #ifdef USE_PAM diff --git a/readconf.c b/readconf.c index db5f2d547..4ad3c75fe 100644 --- a/readconf.c +++ b/readconf.c @@ -161,6 +161,8 @@ typedef enum { oClearAllForwardings, oNoHostAuthenticationForLocalhost, oEnableSSHKeysign, oRekeyLimit, oVerifyHostKeyDNS, oConnectTimeout, oAddressFamily, oGssAuthentication, oGssDelegateCreds, + oGssTrustDns, oGssKeyEx, oGssClientIdentity, oGssRenewalRekey, + oGssServerIdentity, oServerAliveInterval, oServerAliveCountMax, oIdentitiesOnly, oSendEnv, oSetEnv, oControlPath, oControlMaster, oControlPersist, oHashKnownHosts, @@ -201,10 +203,20 @@ static struct { /* Sometimes-unsupported options */ #if defined(GSSAPI) { "gssapiauthentication", oGssAuthentication }, + { "gssapikeyexchange", oGssKeyEx }, { "gssapidelegatecredentials", oGssDelegateCreds }, + { "gssapitrustdns", oGssTrustDns }, + { "gssapiclientidentity", oGssClientIdentity }, + { "gssapiserveridentity", oGssServerIdentity }, + { "gssapirenewalforcesrekey", oGssRenewalRekey }, # else { "gssapiauthentication", oUnsupported }, + { "gssapikeyexchange", oUnsupported }, { "gssapidelegatecredentials", oUnsupported }, + { "gssapitrustdns", oUnsupported }, + { "gssapiclientidentity", oUnsupported }, + { "gssapiserveridentity", oUnsupported }, + { "gssapirenewalforcesrekey", oUnsupported }, #endif #ifdef ENABLE_PKCS11 { "smartcarddevice", oPKCS11Provider }, @@ -973,10 +985,30 @@ parse_time: intptr = &options->gss_authentication; goto parse_flag; + case oGssKeyEx: + intptr = &options->gss_keyex; + goto parse_flag; + case oGssDelegateCreds: intptr = &options->gss_deleg_creds; goto parse_flag; + case oGssTrustDns: + intptr = &options->gss_trust_dns; + goto parse_flag; + + case oGssClientIdentity: + charptr = &options->gss_client_identity; + goto parse_string; + + case oGssServerIdentity: + charptr = &options->gss_server_identity; + goto parse_string; + + case oGssRenewalRekey: + intptr = &options->gss_renewal_rekey; + goto parse_flag; + case oBatchMode: intptr = &options->batch_mode; goto parse_flag; @@ -1817,7 +1849,12 @@ initialize_options(Options * options) options->pubkey_authentication = -1; options->challenge_response_authentication = -1; options->gss_authentication = -1; + options->gss_keyex = -1; options->gss_deleg_creds = -1; + options->gss_trust_dns = -1; + options->gss_renewal_rekey = -1; + options->gss_client_identity = NULL; + options->gss_server_identity = NULL; options->password_authentication = -1; options->kbd_interactive_authentication = -1; options->kbd_interactive_devices = NULL; @@ -1962,8 +1999,14 @@ fill_default_options(Options * options) options->challenge_response_authentication = 1; if (options->gss_authentication == -1) options->gss_authentication = 0; + if (options->gss_keyex == -1) + options->gss_keyex = 0; if (options->gss_deleg_creds == -1) options->gss_deleg_creds = 0; + if (options->gss_trust_dns == -1) + options->gss_trust_dns = 0; + if (options->gss_renewal_rekey == -1) + options->gss_renewal_rekey = 0; if (options->password_authentication == -1) options->password_authentication = 1; if (options->kbd_interactive_authentication == -1) diff --git a/readconf.h b/readconf.h index c56887816..5ea0c296b 100644 --- a/readconf.h +++ b/readconf.h @@ -40,7 +40,12 @@ typedef struct { int challenge_response_authentication; /* Try S/Key or TIS, authentication. */ int gss_authentication; /* Try GSS authentication */ + int gss_keyex; /* Try GSS key exchange */ int gss_deleg_creds; /* Delegate GSS credentials */ + int gss_trust_dns; /* Trust DNS for GSS canonicalization */ + int gss_renewal_rekey; /* Credential renewal forces rekey */ + char *gss_client_identity; /* Principal to initiate GSSAPI with */ + char *gss_server_identity; /* GSSAPI target principal */ int password_authentication; /* Try password * authentication. */ int kbd_interactive_authentication; /* Try keyboard-interactive auth. */ diff --git a/servconf.c b/servconf.c index c0f6af0be..e1ae07fb7 100644 --- a/servconf.c +++ b/servconf.c @@ -124,8 +124,10 @@ initialize_server_options(ServerOptions *options) options->kerberos_ticket_cleanup = -1; options->kerberos_get_afs_token = -1; options->gss_authentication=-1; + options->gss_keyex = -1; options->gss_cleanup_creds = -1; options->gss_strict_acceptor = -1; + options->gss_store_rekey = -1; options->password_authentication = -1; options->kbd_interactive_authentication = -1; options->challenge_response_authentication = -1; @@ -333,10 +335,14 @@ fill_default_server_options(ServerOptions *options) options->kerberos_get_afs_token = 0; if (options->gss_authentication == -1) options->gss_authentication = 0; + if (options->gss_keyex == -1) + options->gss_keyex = 0; if (options->gss_cleanup_creds == -1) options->gss_cleanup_creds = 1; if (options->gss_strict_acceptor == -1) options->gss_strict_acceptor = 1; + if (options->gss_store_rekey == -1) + options->gss_store_rekey = 0; if (options->password_authentication == -1) options->password_authentication = 1; if (options->kbd_interactive_authentication == -1) @@ -481,6 +487,7 @@ typedef enum { sHostKeyAlgorithms, sClientAliveInterval, sClientAliveCountMax, sAuthorizedKeysFile, sGssAuthentication, sGssCleanupCreds, sGssStrictAcceptor, + sGssKeyEx, sGssStoreRekey, sAcceptEnv, sSetEnv, sPermitTunnel, sMatch, sPermitOpen, sPermitListen, sForceCommand, sChrootDirectory, sUsePrivilegeSeparation, sAllowAgentForwarding, @@ -555,12 +562,20 @@ static struct { #ifdef GSSAPI { "gssapiauthentication", sGssAuthentication, SSHCFG_ALL }, { "gssapicleanupcredentials", sGssCleanupCreds, SSHCFG_GLOBAL }, + { "gssapicleanupcreds", sGssCleanupCreds, SSHCFG_GLOBAL }, { "gssapistrictacceptorcheck", sGssStrictAcceptor, SSHCFG_GLOBAL }, + { "gssapikeyexchange", sGssKeyEx, SSHCFG_GLOBAL }, + { "gssapistorecredentialsonrekey", sGssStoreRekey, SSHCFG_GLOBAL }, #else { "gssapiauthentication", sUnsupported, SSHCFG_ALL }, { "gssapicleanupcredentials", sUnsupported, SSHCFG_GLOBAL }, + { "gssapicleanupcreds", sUnsupported, SSHCFG_GLOBAL }, { "gssapistrictacceptorcheck", sUnsupported, SSHCFG_GLOBAL }, + { "gssapikeyexchange", sUnsupported, SSHCFG_GLOBAL }, + { "gssapistorecredentialsonrekey", sUnsupported, SSHCFG_GLOBAL }, #endif + { "gssusesessionccache", sUnsupported, SSHCFG_GLOBAL }, + { "gssapiusesessioncredcache", sUnsupported, SSHCFG_GLOBAL }, { "passwordauthentication", sPasswordAuthentication, SSHCFG_ALL }, { "kbdinteractiveauthentication", sKbdInteractiveAuthentication, SSHCFG_ALL }, { "challengeresponseauthentication", sChallengeResponseAuthentication, SSHCFG_GLOBAL }, @@ -1459,6 +1474,10 @@ process_server_config_line(ServerOptions *options, char *line, intptr = &options->gss_authentication; goto parse_flag; + case sGssKeyEx: + intptr = &options->gss_keyex; + goto parse_flag; + case sGssCleanupCreds: intptr = &options->gss_cleanup_creds; goto parse_flag; @@ -1467,6 +1486,10 @@ process_server_config_line(ServerOptions *options, char *line, intptr = &options->gss_strict_acceptor; goto parse_flag; + case sGssStoreRekey: + intptr = &options->gss_store_rekey; + goto parse_flag; + case sPasswordAuthentication: intptr = &options->password_authentication; goto parse_flag; @@ -2551,7 +2574,10 @@ dump_config(ServerOptions *o) #endif #ifdef GSSAPI dump_cfg_fmtint(sGssAuthentication, o->gss_authentication); + dump_cfg_fmtint(sGssKeyEx, o->gss_keyex); dump_cfg_fmtint(sGssCleanupCreds, o->gss_cleanup_creds); + dump_cfg_fmtint(sGssStrictAcceptor, o->gss_strict_acceptor); + dump_cfg_fmtint(sGssStoreRekey, o->gss_store_rekey); #endif dump_cfg_fmtint(sPasswordAuthentication, o->password_authentication); dump_cfg_fmtint(sKbdInteractiveAuthentication, diff --git a/servconf.h b/servconf.h index 557521d73..9b117fe27 100644 --- a/servconf.h +++ b/servconf.h @@ -124,8 +124,10 @@ typedef struct { int kerberos_get_afs_token; /* If true, try to get AFS token if * authenticated with Kerberos. */ int gss_authentication; /* If true, permit GSSAPI authentication */ + int gss_keyex; /* If true, permit GSSAPI key exchange */ int gss_cleanup_creds; /* If true, destroy cred cache on logout */ int gss_strict_acceptor; /* If true, restrict the GSSAPI acceptor name */ + int gss_store_rekey; int password_authentication; /* If true, permit password * authentication. */ int kbd_interactive_authentication; /* If true, permit */ diff --git a/ssh-gss.h b/ssh-gss.h index 36180d07a..350ce7882 100644 --- a/ssh-gss.h +++ b/ssh-gss.h @@ -1,6 +1,6 @@ /* $OpenBSD: ssh-gss.h,v 1.14 2018/07/10 09:13:30 djm Exp $ */ /* - * Copyright (c) 2001-2003 Simon Wilkinson. All rights reserved. + * Copyright (c) 2001-2009 Simon Wilkinson. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -61,10 +61,22 @@ #define SSH_GSS_OIDTYPE 0x06 +#define SSH2_MSG_KEXGSS_INIT 30 +#define SSH2_MSG_KEXGSS_CONTINUE 31 +#define SSH2_MSG_KEXGSS_COMPLETE 32 +#define SSH2_MSG_KEXGSS_HOSTKEY 33 +#define SSH2_MSG_KEXGSS_ERROR 34 +#define SSH2_MSG_KEXGSS_GROUPREQ 40 +#define SSH2_MSG_KEXGSS_GROUP 41 +#define KEX_GSS_GRP1_SHA1_ID "gss-group1-sha1-" +#define KEX_GSS_GRP14_SHA1_ID "gss-group14-sha1-" +#define KEX_GSS_GEX_SHA1_ID "gss-gex-sha1-" + typedef struct { char *filename; char *envvar; char *envval; + struct passwd *owner; void *data; } ssh_gssapi_ccache; @@ -72,8 +84,11 @@ typedef struct { gss_buffer_desc displayname; gss_buffer_desc exportedname; gss_cred_id_t creds; + gss_name_t name; struct ssh_gssapi_mech_struct *mech; ssh_gssapi_ccache store; + int used; + int updated; } ssh_gssapi_client; typedef struct ssh_gssapi_mech_struct { @@ -84,6 +99,7 @@ typedef struct ssh_gssapi_mech_struct { int (*userok) (ssh_gssapi_client *, char *); int (*localname) (ssh_gssapi_client *, char **); void (*storecreds) (ssh_gssapi_client *); + int (*updatecreds) (ssh_gssapi_ccache *, ssh_gssapi_client *); } ssh_gssapi_mech; typedef struct { @@ -94,10 +110,11 @@ typedef struct { gss_OID oid; /* client */ gss_cred_id_t creds; /* server */ gss_name_t client; /* server */ - gss_cred_id_t client_creds; /* server */ + gss_cred_id_t client_creds; /* both */ } Gssctxt; extern ssh_gssapi_mech *supported_mechs[]; +extern Gssctxt *gss_kex_context; int ssh_gssapi_check_oid(Gssctxt *, void *, size_t); void ssh_gssapi_set_oid_data(Gssctxt *, void *, size_t); @@ -123,17 +140,33 @@ void ssh_gssapi_delete_ctx(Gssctxt **); OM_uint32 ssh_gssapi_sign(Gssctxt *, gss_buffer_t, gss_buffer_t); void ssh_gssapi_buildmic(struct sshbuf *, const char *, const char *, const char *); -int ssh_gssapi_check_mechanism(Gssctxt **, gss_OID, const char *); +int ssh_gssapi_check_mechanism(Gssctxt **, gss_OID, const char *, const char *); +OM_uint32 ssh_gssapi_client_identity(Gssctxt *, const char *); +int ssh_gssapi_credentials_updated(Gssctxt *); /* In the server */ +typedef int ssh_gssapi_check_fn(Gssctxt **, gss_OID, const char *, + const char *); +char *ssh_gssapi_client_mechanisms(const char *, const char *); +char *ssh_gssapi_kex_mechs(gss_OID_set, ssh_gssapi_check_fn *, const char *, + const char *); +gss_OID ssh_gssapi_id_kex(Gssctxt *, char *, int); +int ssh_gssapi_server_check_mech(Gssctxt **,gss_OID, const char *, + const char *); OM_uint32 ssh_gssapi_server_ctx(Gssctxt **, gss_OID); -int ssh_gssapi_userok(char *name); +int ssh_gssapi_userok(char *name, struct passwd *); OM_uint32 ssh_gssapi_checkmic(Gssctxt *, gss_buffer_t, gss_buffer_t); void ssh_gssapi_do_child(char ***, u_int *); void ssh_gssapi_cleanup_creds(void); void ssh_gssapi_storecreds(void); const char *ssh_gssapi_displayname(void); +char *ssh_gssapi_server_mechanisms(void); +int ssh_gssapi_oid_table_ok(void); + +int ssh_gssapi_update_creds(ssh_gssapi_ccache *store); +void ssh_gssapi_rekey_creds(void); + #endif /* GSSAPI */ #endif /* _SSH_GSS_H */ diff --git a/ssh_config b/ssh_config index c12f5ef52..bcb9f153d 100644 --- a/ssh_config +++ b/ssh_config @@ -24,6 +24,8 @@ # HostbasedAuthentication no # GSSAPIAuthentication no # GSSAPIDelegateCredentials no +# GSSAPIKeyExchange no +# GSSAPITrustDNS no # BatchMode no # CheckHostIP yes # AddressFamily any diff --git a/ssh_config.5 b/ssh_config.5 index f499396a3..5b99921b4 100644 --- a/ssh_config.5 +++ b/ssh_config.5 @@ -718,10 +718,42 @@ The default is Specifies whether user authentication based on GSSAPI is allowed. The default is .Cm no . +.It Cm GSSAPIKeyExchange +Specifies whether key exchange based on GSSAPI may be used. When using +GSSAPI key exchange the server need not have a host key. +The default is +.Cm no . +.It Cm GSSAPIClientIdentity +If set, specifies the GSSAPI client identity that ssh should use when +connecting to the server. The default is unset, which means that the default +identity will be used. +.It Cm GSSAPIServerIdentity +If set, specifies the GSSAPI server identity that ssh should expect when +connecting to the server. The default is unset, which means that the +expected GSSAPI server identity will be determined from the target +hostname. .It Cm GSSAPIDelegateCredentials Forward (delegate) credentials to the server. The default is .Cm no . +.It Cm GSSAPIRenewalForcesRekey +If set to +.Cm yes +then renewal of the client's GSSAPI credentials will force the rekeying of the +ssh connection. With a compatible server, this can delegate the renewed +credentials to a session on the server. +The default is +.Cm no . +.It Cm GSSAPITrustDns +Set to +.Cm yes +to indicate that the DNS is trusted to securely canonicalize +the name of the host being connected to. If +.Cm no , +the hostname entered on the +command line will be passed untouched to the GSSAPI library. +The default is +.Cm no . .It Cm HashKnownHosts Indicates that .Xr ssh 1 diff --git a/sshconnect2.c b/sshconnect2.c index 10e4f0a08..c6a1b1271 100644 --- a/sshconnect2.c +++ b/sshconnect2.c @@ -162,6 +162,11 @@ ssh_kex2(char *host, struct sockaddr *hostaddr, u_short port) struct kex *kex; int r; +#ifdef GSSAPI + char *orig = NULL, *gss = NULL; + char *gss_host = NULL; +#endif + xxx_host = host; xxx_hostaddr = hostaddr; @@ -194,6 +199,35 @@ ssh_kex2(char *host, struct sockaddr *hostaddr, u_short port) order_hostkeyalgs(host, hostaddr, port)); } +#ifdef GSSAPI + if (options.gss_keyex) { + /* Add the GSSAPI mechanisms currently supported on this + * client to the key exchange algorithm proposal */ + orig = myproposal[PROPOSAL_KEX_ALGS]; + + if (options.gss_server_identity) + gss_host = xstrdup(options.gss_server_identity); + else if (options.gss_trust_dns) + gss_host = remote_hostname(active_state); + else + gss_host = xstrdup(host); + + gss = ssh_gssapi_client_mechanisms(gss_host, + options.gss_client_identity); + if (gss) { + debug("Offering GSSAPI proposal: %s", gss); + xasprintf(&myproposal[PROPOSAL_KEX_ALGS], + "%s,%s", gss, orig); + + /* If we've got GSSAPI algorithms, then we also + * support the 'null' hostkey, as a last resort */ + orig = myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS]; + xasprintf(&myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS], + "%s,null", orig); + } + } +#endif + if (options.rekey_limit || options.rekey_interval) packet_set_rekey_limits(options.rekey_limit, options.rekey_interval); @@ -215,15 +249,41 @@ ssh_kex2(char *host, struct sockaddr *hostaddr, u_short port) # endif #endif kex->kex[KEX_C25519_SHA256] = kexc25519_client; +#ifdef GSSAPI + if (options.gss_keyex) { + kex->kex[KEX_GSS_GRP1_SHA1] = kexgss_client; + kex->kex[KEX_GSS_GRP14_SHA1] = kexgss_client; + kex->kex[KEX_GSS_GEX_SHA1] = kexgss_client; + } +#endif kex->client_version_string=client_version_string; kex->server_version_string=server_version_string; kex->verify_host_key=&verify_host_key_callback; +#ifdef GSSAPI + if (options.gss_keyex) { + kex->gss_deleg_creds = options.gss_deleg_creds; + kex->gss_trust_dns = options.gss_trust_dns; + kex->gss_client = options.gss_client_identity; + kex->gss_host = gss_host; + } +#endif + ssh_dispatch_run_fatal(active_state, DISPATCH_BLOCK, &kex->done); /* remove ext-info from the KEX proposals for rekeying */ myproposal[PROPOSAL_KEX_ALGS] = compat_kex_proposal(options.kex_algorithms); +#ifdef GSSAPI + /* repair myproposal after it was crumpled by the */ + /* ext-info removal above */ + if (gss) { + orig = myproposal[PROPOSAL_KEX_ALGS]; + xasprintf(&myproposal[PROPOSAL_KEX_ALGS], + "%s,%s", gss, orig); + free(gss); + } +#endif if ((r = kex_prop2buf(kex->my, myproposal)) != 0) fatal("kex_prop2buf: %s", ssh_err(r)); @@ -314,6 +374,7 @@ int input_gssapi_token(int type, u_int32_t, struct ssh *); int input_gssapi_hash(int type, u_int32_t, struct ssh *); int input_gssapi_error(int, u_int32_t, struct ssh *); int input_gssapi_errtok(int, u_int32_t, struct ssh *); +int userauth_gsskeyex(Authctxt *authctxt); #endif void userauth(Authctxt *, char *); @@ -330,6 +391,11 @@ static char *authmethods_get(void); Authmethod authmethods[] = { #ifdef GSSAPI + {"gssapi-keyex", + userauth_gsskeyex, + NULL, + &options.gss_authentication, + NULL}, {"gssapi-with-mic", userauth_gssapi, NULL, @@ -657,25 +723,40 @@ userauth_gssapi(Authctxt *authctxt) static u_int mech = 0; OM_uint32 min; int r, ok = 0; + char *gss_host; + + if (options.gss_server_identity) + gss_host = xstrdup(options.gss_server_identity); + else if (options.gss_trust_dns) + gss_host = remote_hostname(active_state); + else + gss_host = xstrdup(authctxt->host); /* Try one GSSAPI method at a time, rather than sending them all at * once. */ if (gss_supported == NULL) - gss_indicate_mechs(&min, &gss_supported); + if (GSS_ERROR(gss_indicate_mechs(&min, &gss_supported))) { + gss_supported = NULL; + free(gss_host); + return 0; + } /* Check to see if the mechanism is usable before we offer it */ while (mech < gss_supported->count && !ok) { /* My DER encoding requires length<128 */ if (gss_supported->elements[mech].length < 128 && ssh_gssapi_check_mechanism(&gssctxt, - &gss_supported->elements[mech], authctxt->host)) { + &gss_supported->elements[mech], gss_host, + options.gss_client_identity)) { ok = 1; /* Mechanism works */ } else { mech++; } } + free(gss_host); + if (!ok) return 0; @@ -906,6 +987,54 @@ input_gssapi_error(int type, u_int32_t plen, struct ssh *ssh) free(lang); return r; } + +int +userauth_gsskeyex(Authctxt *authctxt) +{ + struct ssh *ssh = active_state; /* XXX */ + struct sshbuf *b; + gss_buffer_desc gssbuf; + gss_buffer_desc mic = GSS_C_EMPTY_BUFFER; + OM_uint32 ms; + int r; + + static int attempt = 0; + if (attempt++ >= 1) + return (0); + + if (gss_kex_context == NULL) { + debug("No valid Key exchange context"); + return (0); + } + + if ((b = sshbuf_new()) == NULL) + fatal("%s: sshbuf_new failed", __func__); + ssh_gssapi_buildmic(b, authctxt->server_user, authctxt->service, + "gssapi-keyex"); + + if ((gssbuf.value = sshbuf_mutable_ptr(b)) == NULL) + fatal("%s: sshbuf_mutable_ptr failed", __func__); + gssbuf.length = sshbuf_len(b); + + if (GSS_ERROR(ssh_gssapi_sign(gss_kex_context, &gssbuf, &mic))) { + sshbuf_free(b); + return (0); + } + + if ((r = sshpkt_start(ssh, SSH2_MSG_USERAUTH_REQUEST)) != 0 || + (r = sshpkt_put_cstring(ssh, authctxt->server_user)) != 0 || + (r = sshpkt_put_cstring(ssh, authctxt->service)) != 0 || + (r = sshpkt_put_cstring(ssh, authctxt->method->name)) != 0 || + (r = sshpkt_put_string(ssh, mic.value, mic.length)) != 0 || + (r = sshpkt_send(ssh)) != 0) + fatal("%s: %s", __func__, ssh_err(r)); + + sshbuf_free(b); + gss_release_buffer(&ms, &mic); + + return (1); +} + #endif /* GSSAPI */ int diff --git a/sshd.c b/sshd.c index a738c3ab6..2e453cdf8 100644 --- a/sshd.c +++ b/sshd.c @@ -123,6 +123,10 @@ #include "version.h" #include "ssherr.h" +#ifdef USE_SECURITY_SESSION_API +#include +#endif + /* Re-exec fds */ #define REEXEC_DEVCRYPTO_RESERVED_FD (STDERR_FILENO + 1) #define REEXEC_STARTUP_PIPE_FD (STDERR_FILENO + 2) @@ -536,7 +540,7 @@ privsep_preauth_child(void) #ifdef GSSAPI /* Cache supported mechanism OIDs for later use */ - if (options.gss_authentication) + if (options.gss_authentication || options.gss_keyex) ssh_gssapi_prepare_supported_oids(); #endif @@ -1811,10 +1815,13 @@ main(int ac, char **av) free(fp); } accumulate_host_timing_secret(cfg, NULL); +#ifndef GSSAPI + /* The GSSAPI key exchange can run without a host key */ if (!sensitive_data.have_ssh2_key) { logit("sshd: no hostkeys available -- exiting."); exit(1); } +#endif /* * Load certificates. They are stored in an array at identical @@ -2105,6 +2112,60 @@ main(int ac, char **av) rdomain == NULL ? "" : "\""); free(laddr); +#ifdef USE_SECURITY_SESSION_API + /* + * Create a new security session for use by the new user login if + * the current session is the root session or we are not launched + * by inetd (eg: debugging mode or server mode). We do not + * necessarily need to create a session if we are launched from + * inetd because Panther xinetd will create a session for us. + * + * The only case where this logic will fail is if there is an + * inetd running in a non-root session which is not creating + * new sessions for us. Then all the users will end up in the + * same session (bad). + * + * When the client exits, the session will be destroyed for us + * automatically. + * + * We must create the session before any credentials are stored + * (including AFS pags, which happens a few lines below). + */ + { + OSStatus err = 0; + SecuritySessionId sid = 0; + SessionAttributeBits sattrs = 0; + + err = SessionGetInfo(callerSecuritySession, &sid, &sattrs); + if (err) + error("SessionGetInfo() failed with error %.8X", + (unsigned) err); + else + debug("Current Session ID is %.8X / Session Attributes are %.8X", + (unsigned) sid, (unsigned) sattrs); + + if (inetd_flag && !(sattrs & sessionIsRoot)) + debug("Running in inetd mode in a non-root session... " + "assuming inetd created the session for us."); + else { + debug("Creating new security session..."); + err = SessionCreate(0, sessionHasTTY | sessionIsRemote); + if (err) + error("SessionCreate() failed with error %.8X", + (unsigned) err); + + err = SessionGetInfo(callerSecuritySession, &sid, + &sattrs); + if (err) + error("SessionGetInfo() failed with error %.8X", + (unsigned) err); + else + debug("New Session ID is %.8X / Session Attributes are %.8X", + (unsigned) sid, (unsigned) sattrs); + } + } +#endif + /* * We don't want to listen forever unless the other side * successfully authenticates itself. So we set up an alarm which is @@ -2288,6 +2349,48 @@ do_ssh2_kex(void) myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS] = compat_pkalg_proposal( list_hostkey_types()); +#ifdef GSSAPI + { + char *orig; + char *gss = NULL; + char *newstr = NULL; + orig = myproposal[PROPOSAL_KEX_ALGS]; + + /* + * If we don't have a host key, then there's no point advertising + * the other key exchange algorithms + */ + + if (strlen(myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS]) == 0) + orig = NULL; + + if (options.gss_keyex) + gss = ssh_gssapi_server_mechanisms(); + else + gss = NULL; + + if (gss && orig) + xasprintf(&newstr, "%s,%s", gss, orig); + else if (gss) + newstr = gss; + else if (orig) + newstr = orig; + + /* + * If we've got GSSAPI mechanisms, then we've got the 'null' host + * key alg, but we can't tell people about it unless its the only + * host key algorithm we support + */ + if (gss && (strlen(myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS])) == 0) + myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS] = "null"; + + if (newstr) + myproposal[PROPOSAL_KEX_ALGS] = newstr; + else + fatal("No supported key exchange algorithms"); + } +#endif + /* start key exchange */ if ((r = kex_setup(active_state, myproposal)) != 0) fatal("kex_setup: %s", ssh_err(r)); @@ -2305,6 +2408,13 @@ do_ssh2_kex(void) # endif #endif kex->kex[KEX_C25519_SHA256] = kexc25519_server; +#ifdef GSSAPI + if (options.gss_keyex) { + kex->kex[KEX_GSS_GRP1_SHA1] = kexgss_server; + kex->kex[KEX_GSS_GRP14_SHA1] = kexgss_server; + kex->kex[KEX_GSS_GEX_SHA1] = kexgss_server; + } +#endif kex->server = 1; kex->client_version_string=client_version_string; kex->server_version_string=server_version_string; diff --git a/sshd_config b/sshd_config index 19b7c91a1..2c48105f8 100644 --- a/sshd_config +++ b/sshd_config @@ -69,6 +69,8 @@ AuthorizedKeysFile .ssh/authorized_keys # GSSAPI options #GSSAPIAuthentication no #GSSAPICleanupCredentials yes +#GSSAPIStrictAcceptorCheck yes +#GSSAPIKeyExchange no # Set this to 'yes' to enable PAM authentication, account processing, # and session processing. If this is enabled, PAM authentication will diff --git a/sshd_config.5 b/sshd_config.5 index e1b54ba20..a0ac717c7 100644 --- a/sshd_config.5 +++ b/sshd_config.5 @@ -637,6 +637,11 @@ The default is Specifies whether user authentication based on GSSAPI is allowed. The default is .Cm no . +.It Cm GSSAPIKeyExchange +Specifies whether key exchange based on GSSAPI is allowed. GSSAPI key exchange +doesn't rely on ssh keys to verify host identity. +The default is +.Cm no . .It Cm GSSAPICleanupCredentials Specifies whether to automatically destroy the user's credentials cache on logout. @@ -656,6 +661,11 @@ machine's default store. This facility is provided to assist with operation on multi homed machines. The default is .Cm yes . +.It Cm GSSAPIStoreCredentialsOnRekey +Controls whether the user's GSSAPI credentials should be updated following a +successful connection rekeying. This option can be used to accepted renewed +or updated credentials from a compatible client. The default is +.Cm no . .It Cm HostbasedAcceptedKeyTypes Specifies the key types that will be accepted for hostbased authentication as a list of comma-separated patterns. diff --git a/sshkey.c b/sshkey.c index 72c08c7e0..91e99a262 100644 --- a/sshkey.c +++ b/sshkey.c @@ -140,6 +140,7 @@ static const struct keytype keytypes[] = { # endif /* OPENSSL_HAS_NISTP521 */ # endif /* OPENSSL_HAS_ECC */ #endif /* WITH_OPENSSL */ + { "null", "null", NULL, KEY_NULL, 0, 0, 0 }, { NULL, NULL, NULL, -1, -1, 0, 0 } }; @@ -228,7 +229,7 @@ sshkey_alg_list(int certs_only, int plain_only, int include_sigonly, char sep) const struct keytype *kt; for (kt = keytypes; kt->type != -1; kt++) { - if (kt->name == NULL) + if (kt->name == NULL || kt->type == KEY_NULL) continue; if (!include_sigonly && kt->sigonly) continue; diff --git a/sshkey.h b/sshkey.h index 9060b2ecb..0cbdcfd74 100644 --- a/sshkey.h +++ b/sshkey.h @@ -63,6 +63,7 @@ enum sshkey_types { KEY_ED25519_CERT, KEY_XMSS, KEY_XMSS_CERT, + KEY_NULL, KEY_UNSPEC }; -- cgit v1.2.3